View source for Niflumic acid

{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 457481224
| IUPAC_name = 2-{[3-(trifluoromethyl)phenyl]amino}nicotinic acid
| image = Niflumic acid.png

<!--Clinical data-->
| tradename =  
| Drugs.com = {{drugs.com|international|niflumic-acid}}
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B            / C / D / X -->
| pregnancy_category =  
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA = <!--             / Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL         / P       / POM / CD / Class A, B, C -->
| legal_US = <!-- OTC                   / Rx-only  / Schedule I, II, III, IV, V -->
| legal_status =  
| routes_of_administration =  

<!--Pharmacokinetic data-->
| bioavailability =  
| protein_bound =  
| metabolism =  
| elimination_half-life = 2.5 hr<ref>{{cite web | title = Half life | url = http://www.drugbank.ca/drugs/DB04552 | work = Drug Bank | accessdate = 15 July 2011 }}</ref>
| excretion =  

<!--Identifiers-->
| CASNo_Ref = {{cascite}}
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 4394-00-7
| ATC_prefix = M01
| ATC_suffix = AX02
| ATC_supplemental = {{ATC|M02|AA17}}
| IUPHAR_ligand = 2439
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =  
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 63323
| UNII_Ref = {{fdacite|changed|FDA}}
| UNII = 4U5MP5IUD8
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D08275
|  PubChem = 4488
|  ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 4333
|  smiles = C1=CC(=CC(=C1)NC2=C(C=CC=N2)C(=O)O)C(F)(F)F
|  InChI = 1/C13H9F3N2O2/c14-13(15,16)8-3-1-4-9(7-8)18-11-10(12(19)20)5-2-6-17-11/h1-7H,(H,17,18)(H,19,20)
|  InChIKey = JZFPYUNJRRFVQU-UHFFFAOYAR
|  StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C13H9F3N2O2/c14-13(15,16)8-3-1-4-9(7-8)18-11-10(12(19)20)5-2-6-17-11/h1-7H,(H,17,18)(H,19,20)
|  StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = JZFPYUNJRRFVQU-UHFFFAOYSA-N

<!--Chemical data-->
| C=13 | H=9 | F=3 | N=2 | O=2 
| molecular_weight = 282.21797 g/mol
}}
__NOTOC__

{{SI}}

{{CMG}}

==Overview==
'''Niflumic acid''' is a drug used for joint and muscular pain. It is categorized as an inhibitor of [[cyclooxygenase-2]]. In experimental biology, it has been employed to inhibit [[chloride channel]]s.<ref>{{cite journal|last=Knauf|first=Philip A.|author2=Mann, Nancy A |title=Use of niflumic acid to determine the nature of the asymmetry of the human erythrocyte anion exchange system|journal=J. Gen. Physiol.|year=1984|volume=83|pages=703–725|pmid=6736917|doi=10.1085/jgp.83.5.703|pmc=2215658}}</ref> It has also been reported to act on GABA-A<ref>Sinkkonen ST et al. (2003): ''Receptor subtype-dependent positive and negative modulation of GABA(A) receptor function by niflumic acid, a nonsteroidal anti-inflammatory drug'', ''Mol Pharmacol'', p. 753-63. PMID 12920213</ref> and NMDA channels<ref>{{cite journal|last=Lerma J.|first=Martin d.R.|journal=Mol. Pharmacol.|year=1992|volume=41|pages=217–222|pmid=1371581|issue=2|title=Chloride transport blockers prevent N-methyl-D-aspartate receptor-channel complex activation}}</ref> and to block T-type calcium channels.<ref>Balderas E et al. (2012): ''Niflumic acid blocks native and recombinant T-type channels'', ''J Cell Physiol'', p. 2542-55. PMID 21898399</ref>

==References==
{{Reflist|2}}

{{Anti-inflammatory and antirheumatic products}}
{{Topical products for joint and muscular pain}}
{{Channelergics}}
{{GABAAR PAMs}}
{{Glutamatergics}}

[[Category:Nicotinic acids]]
[[Category:Anilines]]
[[Category:Organofluorides]]
[[Category:Calcium channel blockers]]
[[Category:GABAA receptor positive allosteric modulators]]
[[Category:NMDA receptor antagonists]]
[[Category:Drug]]