View source for Stepronin

{{Drugbox
| verifiedrevid = 447817179
| IUPAC_name = ''N''-{2-[(2-thienylcarbonyl)thio]propanoyl}glycine
| image = Stepronin.png

<!--Clinical data-->
| tradename =  
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B            / C / D / X -->
| pregnancy_category =  
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA = <!--             / Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL         / P       / POM / CD / Class A, B, C -->
| legal_US = <!-- OTC                   / Rx-only  / Schedule I, II, III, IV, V -->
| legal_status =  
| routes_of_administration =  

<!--Pharmacokinetic data-->
| bioavailability =  
| protein_bound =  
| metabolism =  
| elimination_half-life =  
| excretion =  

<!--Identifiers-->
| CASNo_Ref = {{cascite}}
| CAS_number = 72324-18-6
| ATC_prefix = R05
| ATC_suffix = CB11
| PubChem = 54120
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB01423
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 48889
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 0NOY894QRB
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D07381

<!--Chemical data-->
| C=10 | H=11 | N=1 | O=4 | S=2 
| molecular_weight = 273.331 g/mol
| smiles = CC(C(=O)NCC(=O)O)SC(=O)C1=CC=CS1
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C10H11NO4S2/c1-6(9(14)11-5-8(12)13)17-10(15)7-3-2-4-16-7/h2-4,6H,5H2,1H3,(H,11,14)(H,12,13)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = JNYSEDHQJCOWQU-UHFFFAOYSA-N
}}
                     __NOTOC__
{{SI}}
{{CMG}}

==Overview==
'''Stepronin''' is a [[mucolytic]]<ref>{{cite pmid|3843171}}</ref> and [[expectorant]].<ref>{{cite pmid|8177972}}</ref>

==References==
{{reflist|2}}

{{Cough and cold preparations}}

[[Category:Expectorants]]
[[Category:Thiophenes]]
[[Category:Amides]]
[[Category:Drug]]