View source for Delapril

{{Drugbox
| verifiedrevid = 444593478
| IUPAC_name = 2-[(2''S'')-''N''-(2,3-dihydro-1''H''-inden-2-yl)-2-{[(2''S'')-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino}propanamido]acetic acid
| image = Delapril.png

<!--Clinical data-->
| tradename =  
| Drugs.com = {{drugs.com|international|delapril}}
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B            / C / D / X -->
| pregnancy_category =  
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status =  
| routes_of_administration =  

<!--Pharmacokinetic data-->
| bioavailability =  
| protein_bound =  
| metabolism =  
| elimination_half-life =  
| excretion =  

<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 83435-66-9
| ATC_prefix = C09
| ATC_suffix = AA12
| ATC_supplemental =  
| PubChem = 5362116
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =  
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = W77UAL9THI
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D07781
| ChemSpiderID      = 4514931
| chemical_formula  = C<sub>26</sub>H<sub>32</sub>N<sub>2</sub>O<sub>5</sub>
| molecular_weight  = 452.543
| smiles            = O=C(OCC)[C@@H](N[C@H](C(=O)N(CC(=O)O)C2Cc1ccccc1C2)C)CCc3ccccc3
| InChI             = 1/C26H32N2O5/c1-3-33-26(32)23(14-13-19-9-5-4-6-10-19)27-18(2)25(31)28(17-24(29)30)22-15-20-11-7-8-12-21(20)16-22/h4-12,18,22-23,27H,3,13-17H2,1-2H3,(H,29,30)/t18-,23-/m0/s1
| InChIKey          = WOUOLAUOZXOLJQ-MBSDFSHPBY
| StdInChI          = 1S/C26H32N2O5/c1-3-33-26(32)23(14-13-19-9-5-4-6-10-19)27-18(2)25(31)28(17-24(29)30)22-15-20-11-7-8-12-21(20)16-22/h4-12,18,22-23,27H,3,13-17H2,1-2H3,(H,29,30)/t18-,23-/m0/s1
| StdInChIKey       = WOUOLAUOZXOLJQ-MBSDFSHPSA-N

<!--Chemical data-->
| chemical_formula =  
| C=26 | H=32 | N=2 | O=5 
| molecular_weight = 452.542 g/mol
}}
__NOTOC__
{{SI}}
{{CMG}}

==Overview==
'''Delapril''' ([[International Nonproprietary Name|INN]], also known as '''alindapril''') is an [[ACE inhibitor]] used as an [[antihypertensive]] drug<ref>{{cite pmid|17703633}}</ref> in a number of European and Asian countries.<ref>Drugs.com: [http://www.drugs.com/international/delapril.html Delapril]</ref>

==References==
{{reflist|2}}

{{ACE inhibitors}}


[[Category:ACE inhibitors]]
[[Category:Cardiovascular Drugs]]
[[Category:Drug]]