View source for Bromhexine

{{Drugbox
| Verifiedfields = changed
| verifiedrevid = 443272001
| IUPAC_name = 2,4-dibromo-6-{[cyclohexyl(methyl)amino]methyl}aniline
| image =File:Bromhexine-PlainPNG.png  
| image2 =File:Bromhexine 3D.png 

<!--Clinical data-->
| tradename =  
| Drugs.com = {{drugs.com|international|bromhexine}}
| pregnancy_category = A ([[Australia|Aus]])
| legal_status =  
| routes_of_administration =  

<!--Pharmacokinetic data-->
| bioavailability = 75-80%
| metabolism =  
| elimination_half-life = 12 hr
| excretion =  

<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 3572-43-8
| ATC_prefix = R05
| ATC_suffix = CB02
| PubChem = 2442
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 2348
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = Q1J152VB1P
| DrugBank_Ref = {{drugbankcite|changed|drugbank}}
| DrugBank = DB09019
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D07542
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 77032
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 253376

<!--Chemical data-->
| C=14 | H=20 | Br=2 | N=2 
| molecular_weight = 376.13
| smiles = Brc1cc(c(N)c(Br)c1)CN(C)C2CCCCC2
| InChI = 1/C14H20Br2N2/c1-18(12-5-3-2-4-6-12)9-10-7-11(15)8-13(16)14(10)17/h7-8,12H,2-6,9,17H2,1H3
| InChIKey = OJGDCBLYJGHCIH-UHFFFAOYAY
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C14H20Br2N2/c1-18(12-5-3-2-4-6-12)9-10-7-11(15)8-13(16)14(10)17/h7-8,12H,2-6,9,17H2,1H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = OJGDCBLYJGHCIH-UHFFFAOYSA-N
}}
__Notoc__
{{SI}}
{{CMG}}
==Overview==

'''Bromhexine''' is a [[mucolytic]] (expectorant) agent used in the treatment of [[respiratory system|respiratory]] disorders associated with viscid or excessive [[mucus]].  In addition, bromhexine has antioxidant properties.<ref name="CDoPA">{{cite book |last=Morton |first=Ian |author2=Hall, Judith |title=Concise Dictionary of Pharmacological Agents |url=http://books.google.com/books?id=mqaOMOtk61IC&pg=PA55 |accessdate=2009-06-03 |year=1999 |publisher=Springer |isbn=0-7514-0499-3 |page=55}}</ref>

==Function==
Bromhexine is intended to support the body's mechanisms for clearing [[mucus]] from the [[respiratory tract]].

It is secretolytic, increasing the production of [[serous]] mucus in the respiratory tract and makes the [[phlegm]] thinner and less [[viscous]]. This contributes to a [[secretomotoric]] effect by helping the [[cilia]] transport the phlegm out of the [[lungs]]. For this reason it is often added to [[antitussive|cough syrups]].

Bromhexine is a synthetic derivative of the herbal active ingredient [[vasicine]]. It has been shown to increase the proportion of serous bronchial secretion, making it more easily [[expectorant|expectorated]]. It is indicated as "secretolytic therapy in bronchopulmonary diseases associated with abnormal mucus secretion and impaired mucus transport".

Bromhexine is contained in various formulations, high and low strength syrups 8&nbsp;mg/5&nbsp;ml, 4&nbsp;mg/5&nbsp;ml, tablets and soluble tablets (both with 8&nbsp;mg bromhexine) and solution for oral use 10&nbsp;mg/5&nbsp;ml, adapted to the need of the patients. The [[posology]] varies with the age and weight, but there are products for all age groups from infant on. Bromhexine is well established and tolerated.

Sometimes it is replaced by its metabolite [[ambroxol]], as in Mucosolvan or Mucoangin.

==Brand names==
* Bisolvon
* Paxirasol
* Barkacin
* Bromhexin
* Vasican
* Bisolex
* Robitussin Chesty/Forte
* Duro-Tuss Chesty
* Benadryl Chesty/Forte
* Movex
* Bromex
* Solvex
* Mucolyte
* Brofentol
* Brofentol Plus
* Dysolvon
* Flegamina

==References==
{{reflist|2}}

{{Cough and cold preparations}}

[[Category:Antioxidants]]
[[Category:Antidotes]]
[[Category:Expectorants]]
[[Category:Anilines]]
[[Category:Organobromides]]