View source for Cefapirin

{{Drugbox
| Watchedfields = changed
| verifiedrevid = 460022704
| IUPAC_name =  
| image = Cefapirin.png

<!--Clinical data-->
| tradename =  
| Drugs.com = {{drugs.com|international|cefapirin}}
| MedlinePlus = a601206
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = B
| pregnancy_category =  
| legal_AU = <!-- Unscheduled / S2 / S4 / S8 -->
| legal_UK = <!-- GSL / P / POM / CD -->
| legal_US = Rx-only
| legal_status =  
| routes_of_administration = [[Intravenous therapy|Intravenous]], [[Intramuscular injection|intramuscular]]

<!--Pharmacokinetic data-->
| bioavailability =  
| protein_bound =  
| metabolism =  
| elimination_half-life =  
| excretion =  

<!--Identifiers-->
| CASNo_Ref = {{cascite|correct|CAS}}
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 21593-23-7
| ATC_prefix = J01
| ATC_suffix = DB08
| ATC_supplemental = {{ATCvet|G51|AA05}} {{ATCvet|J51|DB08}}
| PubChem = 30699
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
 | DrugBank = DB01139
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 28486
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 89B59H32VN
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D07636
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 554446
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 1599

<!--Chemical data-->
| C=17 | H=17 | N=3 | O=6 | S=2 
| molecular_weight = 423.466 g/mol
| smiles = O=C2N1/C(=C(\CS[C@@H]1[C@@H]2NC(=O)CSc3ccncc3)COC(=O)C)C(=O)O
| InChI = 1/C17H17N3O6S2/c1-9(21)26-6-10-7-28-16-13(15(23)20(16)14(10)17(24)25)19-12(22)8-27-11-2-4-18-5-3-11/h2-5,13,16H,6-8H2,1H3,(H,19,22)(H,24,25)/t13-,16-/m1/s1
| InChIKey = UQLLWWBDSUHNEB-CZUORRHYBF
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C17H17N3O6S2/c1-9(21)26-6-10-7-28-16-13(15(23)20(16)14(10)17(24)25)19-12(22)8-27-11-2-4-18-5-3-11/h2-5,13,16H,6-8H2,1H3,(H,19,22)(H,24,25)/t13-,16-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = UQLLWWBDSUHNEB-CZUORRHYSA-N
}}
              __NOTOC__
{{SI}}
{{CMG}}

==Overview==


'''Cefapirin''' ([[International Nonproprietary Name|INN]], also spelled '''cephapirin''') is an injectable, first-generation [[cephalosporin]] [[antibiotic]]. It is marketed under the trade name Cefadyl. Production for use in humans has been discontinued in the United States.<ref>http://www.accessdata.fda.gov/scripts/cder/drugsatfda/index.cfm?fuseaction=Search.Overview&DrugName=CEFADYL</ref>

It also has a role in [[veterinary medicine]] as Metricure, an intrauterine preparation, and combined with [[prednisolone]] in Mastiplan, an intramammary preparation. Both are licenced in cattle.

==References==
{{reflist|2}}

{{CephalosporinAntiBiotics}}

[[Category:Cephalosporin antibiotics]]
[[Category:Pyridines]]
[[Category:Drug]]