View source for Flufenamic acid

{{Drugbox
| Watchedfields = changed
| verifiedrevid = 443821617
| IUPAC_name = 2-{[3-(Trifluoromethyl)phenyl]amino}benzoic acid
| image = flufenamic acid.png
| image2 = Flufenamic acid0.png

<!--Clinical data-->
| tradename =  
| Drugs.com = {{drugs.com|international|flufenamic-acid}}
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B            / C / D / X -->
| pregnancy_category =  
| legal_AU = S4
| legal_CA = <!--             / Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL         / P       / POM / CD / Class A, B, C -->
| legal_US = <!-- OTC                   / Rx-only  / Schedule I, II, III, IV, V -->
| legal_status =  
| routes_of_administration = oral, topical

<!--Pharmacokinetic data-->
| bioavailability =  
| protein_bound = extensively
| metabolism = [[Hydroxylation]], [[glucuronidation]]
| elimination_half-life = ~3 h
| excretion = 50% urine, 36% feces

<!--Identifiers-->
| CASNo_Ref = {{cascite|correct|CAS}}
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 530-78-9
| ATC_prefix = M01
| ATC_suffix = AG03
| PubChem = 3371
| IUPHAR_ligand = 2447
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB02266
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 3254
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 60GCX7Y6BH
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D01581
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 42638
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 23588

<!--Chemical data-->
| C=14 | H=10 | F=3 | N=1 | O=2 
| molecular_weight = 281.22991 g/mol
| smiles = FC(F)(F)c1cc(ccc1)Nc2ccccc2C(=O)O
| InChI = 1/C14H10F3NO2/c15-14(16,17)9-4-3-5-10(8-9)18-12-7-2-1-6-11(12)13(19)20/h1-8,18H,(H,19,20)
| InChIKey = LPEPZBJOKDYZAD-UHFFFAOYAI
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C14H10F3NO2/c15-14(16,17)9-4-3-5-10(8-9)18-12-7-2-1-6-11(12)13(19)20/h1-8,18H,(H,19,20)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = LPEPZBJOKDYZAD-UHFFFAOYSA-N
| melting_point = 124
| melting_high = 125
| melting_notes = resolidification and remelting at 134°C to 136°C
| solubility = Practically insoluble in water; soluble in [[ethanol]], [[chloroform]] and [[diethyl ether]]
}}
__NOTOC__
{{SI}}
{{CMG}}
==Overview==
'''Flufenamic acid''', also known as Fluffy or Fluf, is a [[non-steroidal anti-inflammatory drug]].It is pale yellow crystalline powder. In humans, flufenamic acid acts in part by binding to and reducing the activity of [[AKR1C3|prostaglandin F synthase]] and activating [[TRPC6]], a property it shares with the anti-inflammatory herb [[St Johns Wort]].

Flufenamic acid also blocks voltage-gated sodium channels responsible for the depolarising after-potential (DAP) that underlies phasic firing in the phasic firing of magnocellular neurons in the supraoptic and paraventricular nuclei.

==References==
{{Reflist|2}}

{{Anti-inflammatory and antirheumatic products}}

[[Category:Organofluorides]]
[[Category:NMDA receptor antagonists]]
[[Category:Drug]]