View source for Sarmazenil

{{Drugbox
| Verifiedfields = changed
| verifiedrevid = 449586590
| IUPAC_name = Ethyl 7-chloro-5-methyl-6-oxo-5,6-dihydro-4''H''-imidazo[1,5-''a''][1,4]benzodiazepine-3-carboxylate
| image =Sarmazenil.png
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 46547

<!--Clinical data-->
| tradename =  
| Drugs.com = {{drugs.com|international|sarmazenil}}
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B            / C / D / X -->
| pregnancy_category =  
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status =  
| routes_of_administration =  

<!--Pharmacokinetic data-->
| bioavailability =  
| protein_bound =  
| metabolism =  
| elimination_half-life =  
| excretion =  

<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 78771-13-8
| CAS_supplemental =  
| ATCvet = yes
| ATC_prefix = V03
| ATC_suffix = AB91
| ATC_supplemental =  
| PubChem = 71231
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =  
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = F84AE7X24P
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID      = 64366

<!--Chemical data-->
| chemical_formula =  
| C=15 | H=14 | Cl=1 | N=3 | O=3 
| molecular_weight = 319.743 g/mol
| smiles = CCOC(=O)C1=C2CN(C(=O)C3=C(N2C=N1)C=CC=C3Cl)C
| InChI             = 1/C15H14ClN3O3/c1-3-22-15(21)13-11-7-18(2)14(20)12-9(16)5-4-6-10(12)19(11)8-17-13/h4-6,8H,3,7H2,1-2H3
| InChIKey          = WSDBAFQWNWJTNG-UHFFFAOYAU
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI          = 1S/C15H14ClN3O3/c1-3-22-15(21)13-11-7-18(2)14(20)12-9(16)5-4-6-10(12)19(11)8-17-13/h4-6,8H,3,7H2,1-2H3
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey       = WSDBAFQWNWJTNG-UHFFFAOYSA-N
}}
__Notoc__
{{SI}}
{{CMG}}
==Overview==

'''Sarmazenil''' ('''Ro15-3505''') is a drug from the [[benzodiazepine]] family. It acts as a partial [[inverse agonist]] of [[benzodiazepine receptor]]s,<ref>{{ cite journal | author = López-Romero B, Evrard G, Durant F, Sevrin M, George P | title = Molecular structure and stereoelectronic properties of sarmazenil--a weak inverse agonist at the omega modulatory sites (benzodiazepine receptors): comparison with bretazenil and flumazenil | journal = Bioorganic and Medicinal Chemistry | year = 1998 | volume = 6 | issue = 10 | pages = 1745–57 | pmid = 9839004 | doi = 10.1016/S0968-0896(98)00117-5 }}</ref> meaning that it causes the opposite effects to most benzodiazepine drugs, and instead acts as an [[anxiogenic]] and [[convulsant]]. It is used in [[veterinary medicine]] to reverse the effects of benzodiazepine sedative drugs in order to rapidly re-awaken anesthetized animals.<ref>{{ cite journal | author = Henke J, Roberts U, Otto K, Lendl C, Matis U, Brill T, Erhardt W | title = Clinical investigations of an i.m. combination anesthesia with fentanyl / climazolam / xylazine and postoperative i.v. antagonism with naloxone / sarmazenil / yohimbine in guinea pigs | language = German | journal = Tierärztliche Praxis | year = 1996 | volume = 24 | issue = 1 | pages = 85–7 | pmid = 8720962 }}</ref><ref>{{ cite journal | author = Janovsky M, Tataruch F, Ambuehl M, Giacometti M | title = A Zoletil-Rompun mixture as an alternative to the use of opioids for immobilization of feral red deer | journal = Journal of Wildlife Diseases | year = 2000 | volume = 36 | issue = 4 | pages = 663–9 | pmid = 11085427 | doi = 10.7589/0090-3558-36.4.663 }}</ref><ref>{{ cite journal | author = Walzer C, Huber C | title = Partial antagonism of tiletamine-zolazepam anesthesia in cheetah | journal = Journal of Wildlife Diseases | year = 2002 | volume = 38 | issue = 2 | pages = 468–72 | pmid = 12038151 | doi = 10.7589/0090-3558-38.2.468 }}</ref>

==See also==
* [[Benzodiazepine]]
* [[Flumazenil]]

==References==
{{reflist|2}}

{{Benzodiazepines}}
{{GABAergics}}

[[Category:GABAA receptor negative allosteric modulators]]
[[Category:Convulsants]]
[[Category:Anxiogenics]]
[[Category:Lactams]]
[[Category:Organochlorides]]
[[Category:Imidazobenzodiazepines]]
[[Category:Carboxylate esters]]
[[Category:Ethyl esters]]
[[Category:Drug]]