|
|
(One intermediate revision by the same user not shown) |
Line 1: |
Line 1: |
| <small>'''''Synonyms / Brand Names:''''' </small>
| | {{Drugbox |
| | | verifiedrevid = 443722856 |
| | | IUPAC_name = 4-methoxy-''N''-[2-(1-methyl-2-piperidin-1-ylethyl)phenyl]benzamide |
| | | image = Encainide.png |
|
| |
|
| {{CMG}} | | <!--Clinical data--> |
| | | tradename = Enkaid |
| | | Drugs.com = {{drugs.com|CONS|encainide}} |
| | | MedlinePlus = a605040 |
| | | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
| | | pregnancy_US = <!-- A / B / C / D / X --> |
| | | pregnancy_category = |
| | | legal_AU = <!-- Unscheduled / S2 / S4 / S8 --> |
| | | legal_UK = <!-- GSL / P / POM / CD --> |
| | | legal_US = <!-- OTC / Rx-only --> |
| | | legal_status = Withdrawn |
| | | routes_of_administration = |
|
| |
|
| ==Dosing and Administration==
| | <!--Pharmacokinetic data--> |
| <br> | | | bioavailability = |
| ---- | | | protein_bound = |
| <br>
| | | metabolism = |
| <font size="4">
| | | elimination_half-life = |
| [[{{PAGENAME}}#FDA Package Insert Resources|FDA Package Insert Resources]]
| | | excretion = |
| <br></font size><small>Indications, Contraindications, Side Effects, Drug Interactions, etc.</small><font size="4"><br>
| |
| <br>
| |
| [[{{PAGENAME}}#Publication Resources|Publication Resources]]
| |
| <br></font size><small>Recent articles, WikiDoc State of the Art Review, Textbook Information</small><font size="4"><br>
| |
| <br>
| |
| [[{{PAGENAME}}#Trial Resources|Trial Resources]]
| |
| <br></font size><small>Ongoing Trials, Trial Results</small><font size="4"><br>
| |
| <br>
| |
| [[{{PAGENAME}}#Guidelines & Evidence Based Medicine Resources|Guidelines & Evidence Based Medicine Resources]]
| |
| <br></font size><small>US National Guidelines, Cochrane Collaboration, etc.</small><font size="4"><br>
| |
| <br>
| |
| [[{{PAGENAME}}#Media Resources|Media Resources]]
| |
| <br></font size><small>Slides, Video, Images, MP3, Podcasts, etc.</small><font size="4"><br><br>
| |
| [[{{PAGENAME}}#Patient Resources|Patient Resources]]
| |
| <br></font size><small>Discussion Groups, Handouts, Blogs, News, etc.</small><font size="4"><br>
| |
| <br>
| |
| [[{{PAGENAME}}#International Resources|International Resources]]
| |
| <br></font size><small>en Español</small><font size="4"><br>
| |
| <br>
| |
| ----
| |
| <br>
| |
| <br>
| |
| <br>
| |
| <br>
| |
|
| |
|
| ==FDA Package Insert Resources==
| | <!--Identifiers--> |
| [[{{PAGENAME}} indications|Indications]]
| | | CAS_number = 66778-36-7 |
| <br> | | | ATC_prefix = C01 |
| <br>
| | | ATC_suffix = BC08 |
| [[{{PAGENAME}} contraindications|Contraindications]]
| | | ATC_supplemental = |
| <br>
| | | PubChem = 48041 |
| <br>
| | | DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
| [[{{PAGENAME}} side effects|Side Effects]]
| | | DrugBank = DB01228 |
| <br>
| | | ChEMBL = 315838 |
| <br>
| | | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| [[{{PAGENAME}} drug interactions|Drug Interactions]]
| | | ChemSpiderID = 43697 |
| <br>
| | | UNII_Ref = {{fdacite|correct|FDA}} |
| <br>
| | | UNII = SY3J0147NB |
| [[{{PAGENAME}} precautions|Precautions]]
| | | KEGG_Ref = {{keggcite|correct|kegg}} |
| <br>
| | | KEGG = D07894 |
| <br>
| | | ChEBI_Ref = {{ebicite|correct|EBI}} |
| [[{{PAGENAME}} overdose|Overdose]]
| | | ChEBI = 4788 |
| <br>
| |
| <br>
| |
| [[{{PAGENAME}} instructions for administration|Instructions for Administration]]
| |
| <br>
| |
| <br>
| |
| [[{{PAGENAME}} how supplied|How Supplied]]
| |
| <br>
| |
| <br>
| |
| [[{{PAGENAME}} pharmacokinetics and molecular data|Pharmacokinetics and Molecular Data]]
| |
| <br>
| |
| <br>
| |
| [FDA label]
| |
| <br>
| |
| <br>
| |
| [http://google2.fda.gov/search?q={{urlencode:{{#if:{{{1|}}}|{{{1}}}|{{PAGENAME}}}}}}&x=0&y=0&client=FDA&site=FDA&lr=&proxystylesheet=FDA&output=xml_no_dtd&getfields=* FDA on {{PAGENAME}}]
| |
| <br>
| |
| <br>
| |
| </font size><small>[[{{PAGENAME}}#Dosing and Administration|Return to top]]</small><font size="4">
| |
| <br>
| |
| <br>
| |
|
| |
|
| ==Publication Resources== | | <!--Chemical data--> |
| [http://www.ncbi.nlm.nih.gov/entrez/query.fcgi?CMD=search&db=pubmed&term={{urlencode:{{#if:{{{1|}}}|{{{1}}}|{{PAGENAME}}}}}} Most Recent Articles on {{#if:{{{1|}}}|{{{1}}}|{{PAGENAME}}}}]
| | | C=22 | H=28 | N=2 | O=2 |
| <br>
| | | molecular_weight = 352.47 g/mol |
| <br>
| | | smiles = CC(CN1CCCCC1)c3ccccc3NC(=O)c2ccc(OC)cc2 |
| [http://www.ncbi.nlm.nih.gov/sites/entrez?cmd=search&db=pubmed&term={{urlencode:{{#if:{{{1|}}}|{{{1}}}|{{PAGENAME}}}}}}%20AND%20systematic%5Bsb%5D Review Articles on {{PAGENAME}}]
| | | InChI = 1/C22H28N2O2/c1-24-16-6-5-8-19(24)13-10-17-7-3-4-9-21(17)23-22(25)18-11-14-20(26-2)15-12-18/h3-4,7,9,11-12,14-15,19H,5-6,8,10,13,16H2,1-2H3,(H,23,25) |
| <br>
| | | InChIKey = PJWPNDMDCLXCOM-UHFFFAOYAR |
| <br>
| | | StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| [http://www.ncbi.nlm.nih.gov/entrez/query.fcgi?cmd=search&db=pubmed&term={{urlencode:{{#if:{{{1|}}}|{{{1}}}|{{PAGENAME}}}}}}+AND+%28%28N+Engl+J+Med%5Bta%5D%29+OR+%28Lancet%5Bta%5D%29+OR+%28BMJ%5Bta%5D%29%29 Articles on {{PAGENAME}} in N Eng J Med, Lancet, BMJ]
| | | StdInChI = 1S/C22H28N2O2/c1-24-16-6-5-8-19(24)13-10-17-7-3-4-9-21(17)23-22(25)18-11-14-20(26-2)15-12-18/h3-4,7,9,11-12,14-15,19H,5-6,8,10,13,16H2,1-2H3,(H,23,25) |
| <br>
| | | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
| <br>
| | | StdInChIKey = PJWPNDMDCLXCOM-UHFFFAOYSA-N |
| [[Encainide detailed information|WikiDoc State of the Art Review]]
| | }} |
| <br>
| | __NOTOC__ |
| <br>
| | {{SI}} |
| [http://books.google.com/books?ie=UTF-8&oe=utf-8&q={{urlencode:{{#if:{{{1|}}}|{{{1}}}|{{PAGENAME}}}}}}&qt_s=Search&sa=N&tab=gp Textbook Information on {{PAGENAME}}]
| | {{CMG}} |
| <br>
| |
| <br>
| |
| </font size><small>[[{{PAGENAME}}#Dosing and Administration|Return to top]]</small><font size="4">
| |
| <br>
| |
| <br>
| |
| | |
| ==Trial Resources==
| |
| [http://clinicaltrials.gov/search/open/condition={{urlencode:{{#if:{{{1|}}}|{{{1}}}|{{PAGENAME}}}}}} Ongoing Trials with {{PAGENAME}} at Clinical Trials.gov]
| |
| <br>
| |
| <br>
| |
| [http://www.ncbi.nlm.nih.gov/entrez/query.fcgi?cmd=search&db=pubmed&term={{urlencode:{{#if:{{{1|}}}|{{{1}}}|{{PAGENAME}}}}}}+AND+%28randomized+controlled+trial%5BPublication+Type%5D+OR+%28randomized%5BTitle%2FAbstract%5D+AND+controlled%5BTitle%2FAbstract%5D+AND+trial%5BTitle%2FAbstract%5D%29%29 Trial Results with {{PAGENAME}}]
| |
| <br>
| |
| <br>
| |
| </font size><small>[[{{PAGENAME}}#Dosing and Administration|Return to top]]</small><font size="4">
| |
| <br>
| |
| <br>
| |
|
| |
|
| ==Guidelines & Evidence Based Medicine Resources== | | ==Overview== |
| [http://www.guideline.gov/search/searchresults.aspx?Type=3&txtSearch={{urlencode:{{#if:{{{1|}}}|{{{1}}}|{{PAGENAME}}}}}}&num=20 US National Guidelines Clearinghouse on {{PAGENAME}}]
| | '''Encainide''' (trade name '''Enkaid''') is a class Ic [[antiarrhythmic agent]]. It is no longer used because of its frequent [[proarrhythmic]] side effects.<ref>{{cite pmid|1900101}}</ref> |
| <br>
| |
| <br>
| |
| [http://www.ncbi.nlm.nih.gov/entrez/query.fcgi?cmd=search&db=pubmed&term={{urlencode:({{#if:{{{1|}}}|{{{1}}}|{{PAGENAME}}}}) AND (Cochrane Database Syst Rev[ta])}} Cochrane Collaboration on {{PAGENAME}}]
| |
| <br>
| |
| <br>
| |
| [http://www.ncbi.nlm.nih.gov/entrez/query.fcgi?cmd=search&db=pubmed&term={{urlencode:({{#if:{{{1|}}}|{{{1}}}|{{PAGENAME}}}}) AND (Cost effectiveness)}} Cost Effectiveness of {{PAGENAME}}]
| |
| <br>
| |
| <br>
| |
| </font size><small>[[{{PAGENAME}}#Dosing and Administration|Return to top]]</small><font size="4">
| |
| <br>
| |
| <br>
| |
| ==Media Resources==
| |
| [http://www.google.com/search?q={{urlencode:{{#if:{{{1|}}}|{{{1}}}|{{PAGENAME}}}}}}+ppt&ie=utf-8&oe=utf-8&aq=t&rls=org.mozilla:en-US:official&client=firefox-a Powerpoint Slides on {{PAGENAME}}]
| |
| <br>
| |
| <br>
| |
| [http://images.google.com/images?q={{urlencode:{{#if:{{{1|}}}|{{{1}}}|{{PAGENAME}}}}}}&ie=UTF-8&oe=utf-8&rls=org.mozilla:en-US:official&client=firefox-a&um=1&sa=N&tab=wi Images of {{PAGENAME}}]
| |
| <br>
| |
| <br>
| |
| [http://www.google.com/search?hl=en&client=firefox-a&rls=org.mozilla%3Aen-US%3Aofficial&hs=hPo&q={{urlencode:{{#if:{{{1|}}}|{{{1}}}|{{PAGENAME}}}}}}+podcasts+OR+MP3&btnG=Search Podcasts & MP3s on {{PAGENAME}}]
| |
| <br> | |
| <br>
| |
| [http://video.google.com/videosearch?q={{urlencode:{{#if:{{{1|}}}|{{{1}}}|{{PAGENAME}}}}}}&ie=UTF-8&oe=utf-8&rls=org.mozilla:en-US:official&um=1&sa=N&tab=fv# Videos on {{PAGENAME}}]
| |
| <br>
| |
| <br>
| |
| </font size><small>[[{{PAGENAME}}#Dosing and Administration|Return to top]]</small><font size="4">
| |
| <br>
| |
| <br>
| |
|
| |
|
| ==Patient Resources== | | ==References== |
| [[{{PAGENAME}} (patient information)|Patient Information from National Library of Medicine]]
| | {{reflist|2}} |
| <br>
| |
| <br>
| |
| [http://www.google.com/search?hl=en&q={{urlencode:{{#if:{{{1|}}}|{{{1}}}|{{PAGENAME}}}}}}+more:for_patients&cx=disease_for_patients&sa=N&oi=cooptsr&resnum=0&ct=col3&cd=1 Patient Resources on {{PAGENAME}}]
| |
| <br>
| |
| <br>
| |
| [http://groups.google.com/groups/search?ie=UTF-8&oe=utf-8&q={{urlencode:{{#if:{{{1|}}}|{{{1}}}|{{PAGENAME}}}}}}&qt_s=Search Discussion Groups on {{PAGENAME}}]
| |
| <br>
| |
| <br>
| |
| [http://www.google.com/search?hl=en&client=firefox-a&rls=org.mozilla:en-US:official&q={{urlencode:{{#if:{{{1|}}}|{{{1}}}|{{PAGENAME}}}}}}+more:patient_handouts&cx=disease_for_health_professionals&sa=N&oi=coopctx&resnum=0&ct=col1&cd=3 Patient Handouts on {{PAGENAME}}]
| |
| <br>
| |
| <br>
| |
| [http://blogsearch.google.com/blogsearch?q={{urlencode:{{#if:{{{1|}}}|{{{1}}}|{{PAGENAME}}}}}}&ie=UTF-8&oe=utf-8&rls=org.mozilla:en-US:official&client=firefox-a&um=1&sa=N&tab=wb Blogs on {{PAGENAME}}]
| |
| <br>
| |
| <br>
| |
| [http://news.google.com/news?q={{urlencode:{{#if:{{{1|}}}|{{{1}}}|{{PAGENAME}}}}}}&ie=UTF-8&oe=utf-8&rls=org.mozilla:en-US:official&client=firefox-a&um=1&sa=N&tab=wn {{PAGENAME}} in the News]
| |
| <br>
| |
| <br>
| |
| [http://finance.google.com/finance?ie=UTF-8&oe=utf-8&q={{urlencode:{{#if:{{{1|}}}|{{{1}}}|{{PAGENAME}}}}}}&qt_s=Search&sa=N&tab=te {{PAGENAME}} in the Marketplace]
| |
| <br>
| |
| <br>
| |
| </font size><small>[[{{PAGENAME}}#Dosing and Administration|Return to top]]</small><font size="4">
| |
| <br>
| |
| <br>
| |
|
| |
|
| ==International Resources==
| | {{Antiarrhythmic agents}} |
| [http://www.google.com/search?q={{urlencode:{{#if:{{{1|}}}|{{{1}}}|{{PAGENAME}}}}}}+en+espanol&ie=utf-8&oe=utf-8&aq=t&rls=org.mozilla:en-US:official&client=firefox-a {{PAGENAME}} en Español]
| |
| <br>
| |
| <br>
| |
| </font size><small>[[{{PAGENAME}}#Dosing and Administration|Return to top]]</small><font size="4">
| |
| <br>
| |
| <br>
| |
| </font size>
| |
| ----
| |
| {{FDA}}
| |
|
| |
|
| [[Category:Drugs]] | | [[Category:Antiarrhythmic agents]] |
| | [[Category:Cardiovascular Drugs]] |
| | [[Category:Drug]] |