Tricaine mesilate: Difference between revisions

Jump to navigation Jump to search
Turky Alkathery (talk | contribs)
Created page with "{{Drugbox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 455329821 | IUPAC_name = Ethyl 3-aminobenzoate methanesulfonic acid | image = tricaine.png <!..."
 
Turky Alkathery (talk | contribs)
Redirected page to Tricaine mesylate
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
{{Drugbox
#REDIRECT [[Tricaine mesylate]]
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 455329821
| IUPAC_name = Ethyl 3-aminobenzoate methanesulfonic acid
| image = tricaine.png
 
<!--Clinical data-->
| tradename = 
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B            / C / D / X -->
| pregnancy_category = 
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status = 
| routes_of_administration =
 
<!--Pharmacokinetic data-->
| bioavailability = 
| protein_bound = 
| metabolism = 
| elimination_half-life = 
| excretion =
 
<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 886-86-2
| CAS_supplemental = 
| ATCvet = yes
| ATC_prefix = N01
| ATC_suffix = AX93
| ATC_supplemental = 
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = 
|  PubChem = 13454
|  ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 12878
|  InChI = 1/C9H11NO2.CH4O3S/c1-2-12-9(11)7-4-3-5-8(10)6-7;1-5(2,3)4/h3-6H,2,10H2,1H3;1H3,(H,2,3,4)
|  InChIKey = FQZJYWMRQDKBQN-UHFFFAOYAO
|  StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C9H11NO2.CH4O3S/c1-2-12-9(11)7-4-3-5-8(10)6-7;1-5(2,3)4/h3-6H,2,10H2,1H3;1H3,(H,2,3,4)
|  StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = FQZJYWMRQDKBQN-UHFFFAOYSA-N
 
<!--Chemical data-->
| chemical_formula = 
| C=10 | H=15 | N=1 | O=5 | S=1
| molecular_weight = 261.296 g/mol
| smiles = [NH3+]C1=CC=CC(C(OCC)=O)=C1.CS(=O)([O-])=O
| synonyms = Metacaine<br />Tricaine<br />MS-222<br />Finquel<br />TMS
| melting_point = 149.5
}}
 
'''Tricaine mesylate''' ('''Tricaine methanesulfonate''', '''TMS''', '''MS-222'''), is white powder used for [[anesthesia]], sedation, or [[euthanasia]] of fish. TMS is the only anesthetic licensed in the United States for fin fish that are intended for human consumption.
The drug can have selective toxicity for [[poikilotherm]]s due to their lower rate of metabolism in the liver.<ref>Wayson KA(1976)."Studies on the comparative pharmacology and selective toxicity of tricaine methanesulfonate: metabolism as a basis of the selectivity toxicity in poikilotherms."''J Pharmacol Exp Ther'''''198'''(3):695-708. [PMID 185356]</ref>
 
TMS is a [[muscle relaxant]] that operates by preventing [[action potential]]s. {{citation needed|date=February 2013}}By blocking action potentials, no signals can be exchanged between the [[brain]] and the extremities. There will be no [[sensory input]] or [[muscle contraction]]s which would have been caused by action potential, which includes most muscles.
 
The optimum concentration may vary with the size and species of the fish, and other variables.
 
It is easily soluble in water (both fresh and salt) but it drastically decreases the [[pH]] of water, increasing the acidity, which may be toxic for fish.  [[Sodium bicarbonate]] can be used to buffer the solution to a pH range of 6.5-7.5. Usually an equal amount of buffer is added to attain a neutral pH.<ref>http://www.research.cornell.edu/care/documents/ACUPs/ACUP306.pdf</ref> In salt/marine/sea water, the buffer use may not be necessary because sea water itself has buffering capacity.
 
The solution of TMS needs to be prepared freshly each time because TMS is light-sensitive and might form toxic by-products upon exposure to light.
 
==References==
<references/>
 
{{DEFAULTSORT:Tricaine Mesylate}}
[[Category:General anesthetics]]
[[Category:Benzoates]]

Latest revision as of 18:47, 14 April 2015

Redirect to: