|
|
| (One intermediate revision by the same user not shown) |
| Line 1: |
Line 1: |
| {{DrugProjectFormSinglePage
| | #REDIRECT[[Miconazole (topical)]] |
| |authorTag={{KS}}
| |
| |OTC=Yes
| |
| |genericName=Miconazole nitrate
| |
| |aOrAn=an
| |
| |drugClass=antifungal agent,
| |
| |indicationType=treatment
| |
| |indication=candidal vulvovaginitis, [[tinea]]
| |
| |adverseReactions=[[contact dermatitis]]
| |
| |blackBoxWarningTitle=<span style="color:#FF0000;">ConditionName: </span>
| |
| |blackBoxWarningBody=<i><span style="color:#FF0000;">ConditionName: </span></i>
| |
| | |
| * Content
| |
| | |
| <!--Adult Indications and Dosage-->
| |
| | |
| <!--FDA-Labeled Indications and Dosage (Adult)-->
| |
| |fdaLIADAdult===Indications==
| |
| * For treatment of most [[athlete's foot]] (tinea pedis), jock itch (tinea crusis), ringworm (tinea corporis).
| |
| | |
| * For the treatment of superficial skin infections caused by Yeast ([[Candida Albicans]]).
| |
| | |
| * Relieves [[itching]], scaling, cracking, burning, redness, soreness, irritation discomfort and chafing associated with jock itch.
| |
| | |
| * Candidal vulvovaginitis
| |
| | |
| ==Dosing==
| |
| | |
| * Candidal vulvovaginitis: (suppository) 200 mg intravaginally at bedtime for 3 days OR 100 mg intravaginally at bedtime for 7 days OR 1200 mg intravaginally once.
| |
|
| |
| * Candidal vulvovaginitis: (cream) insert 1 applicatorful (5 g) of 2% cream intravaginally daily for 7 days, or 1 applicatorful (5 g) of 4% cream intravaginally daily for 3 days.
| |
| | |
| * Candidal vulvovaginitis: (HIV patients, duration) uncomplicated cases, 3 to 7 days; severe or recurrent, 7 or more days.
| |
| | |
| * Tinea, Superficial: apply topically to affected areas twice daily.
| |
| |offLabelAdultGuideSupport=There is limited information regarding <i>Off-Label Guideline-Supported Use</i> of {{PAGENAME}} in adult patients.
| |
| |offLabelAdultNoGuideSupport=There is limited information regarding <i>Off-Label Non–Guideline-Supported Use</i> of {{PAGENAME}} in adult patients.
| |
| |fdaLIADPed===Indication==
| |
| * Candidal vulvovaginitis.
| |
| * Tinea, Superficial
| |
| | |
| ==Dosage==
| |
| * Candidal vulvovaginitis: 12 yr and older, 200 mg vaginally at bedtime for 3 days.
| |
| * Candidal vulvovaginitis: 12 yr and older, 100 mg vaginally at bedtime for 7 days.
| |
| * Candidal vulvovaginitis: 12 yr and older, 1200 mg vaginally once.
| |
| * Tinea, Superficial: (2 yr and older) apply topically to affected areas twice daily
| |
| |offLabelPedGuideSupport=There is limited information regarding <i>Off-Label Guideline-Supported Use</i> of {{PAGENAME}} in pediatric patients.
| |
| |offLabelPedNoGuideSupport===Indication==
| |
| * Diaper rash<ref name="pmid11358560">{{cite journal| author=Concannon P, Gisoldi E, Phillips S, Grossman R| title=Diaper dermatitis: a therapeutic dilemma. Results of a double-blind placebo controlled trial of miconazole nitrate 0.25%. | journal=Pediatr Dermatol | year= 2001 | volume= 18 | issue= 2 | pages= 149-55 | pmid=11358560 | doi= | pmc= | url=http://www.ncbi.nlm.nih.gov/entrez/eutils/elink.fcgi?dbfrom=pubmed&tool=sumsearch.org/cite&retmode=ref&cmd=prlinks&id=11358560 }} </ref>
| |
| |warnings='''Do not use''':
| |
| | |
| * Do not use on children under 2 years of age unless directed by a doctor.
| |
| | |
| * Avoid contact with eyes.
| |
| | |
| * For athletes foot and ringworm - if irritation occurs, or if there is no improvement within 4 weeks, discontinue use and consult a doctor.
| |
| | |
| * For jock itch - if irritation occurs, or if there is no improvement within two weeks, discontinue use and consult a doctor.
| |
| | |
| * Keep out of reach of children. If swallowed, get medical help or contact a Poison Control Center right away.
| |
| |clinicalTrials=There is limited information regarding <i>Clinical Trial Experience</i> of {{PAGENAME}} in the drug label.
| |
| |postmarketing=There is limited information regarding <i>Postmarketing Experience</i> of {{PAGENAME}} in the drug label.
| |
| |useInPregnancyFDA=*
| |
| |useInPregnancyAUS=* '''Australian Drug Evaluation Committee (ADEC) Pregnancy Category'''
| |
| | |
| There is no Australian Drug Evaluation Committee (ADEC) guidance on usage of {{PAGENAME}} in women who are pregnant.
| |
| |useInLaborDelivery=There is no FDA guidance on use of {{PAGENAME}} during labor and delivery.
| |
| |useInNursing=There is no FDA guidance on the use of {{PAGENAME}} with respect to nursing mothers.
| |
| |useInPed=There is no FDA guidance on the use of {{PAGENAME}} with respect to pediatric patients.
| |
| |useInGeri=There is no FDA guidance on the use of {{PAGENAME}} with respect to geriatric patients.
| |
| |useInGender=There is no FDA guidance on the use of {{PAGENAME}} with respect to specific gender populations.
| |
| |useInRace=There is no FDA guidance on the use of {{PAGENAME}} with respect to specific racial populations.
| |
| |useInRenalImpair=There is no FDA guidance on the use of {{PAGENAME}} in patients with renal impairment.
| |
| |useInHepaticImpair=There is no FDA guidance on the use of {{PAGENAME}} in patients with hepatic impairment.
| |
| |useInReproPotential=There is no FDA guidance on the use of {{PAGENAME}} in women of reproductive potentials and males.
| |
| |useInImmunocomp=There is no FDA guidance one the use of {{PAGENAME}} in patients who are immunocompromised.
| |
| |administration=* Topical
| |
| |monitoring=There is limited information regarding <i>Monitoring</i> of {{PAGENAME}} in the drug label.
| |
| |IVCompat=There is limited information regarding <i>IV Compatibility</i> of {{PAGENAME}} in the drug label.
| |
| |overdose=There is limited information regarding <i>Chronic Overdose</i> of {{PAGENAME}} in the drug label.
| |
| |drugBox={{Drugbox2
| |
| | Watchedfields = changed
| |
| | verifiedrevid = 461740624
| |
| | IUPAC_name = (''RS'')-1-(2-(2,4-Dichlorobenzyloxy)-2-(2,4-dichlorophenyl)ethyl)-1''H''-imidazole
| |
| | image = Miconazole2DCSD.png
| |
| | width = 200px
| |
| | image2 = Miconazole ball-and-stick.png
| |
| | width2 = 200px
| |
| | imagename = 1 : 1 mixture (racemate)
| |
| | drug_name = Miconazole
| |
| | |
| <!--Clinical data-->
| |
| | tradename = Desenex, Monistat, Zeasorb-AF
| |
| | Drugs.com = {{drugs.com|monograph|miconazole-nitrate}}
| |
| | MedlinePlus = a601203
| |
| | pregnancy_AU = A
| |
| | pregnancy_US = C
| |
| | pregnancy_category = In Australia, it is category A when used topically. In the US, the pregnancy category is C for oral and topical treatment.
| |
| | legal_AU = S2
| |
| | legal_CA =
| |
| | legal_UK = POM
| |
| | legal_US = OTC
| |
| | legal_status = Schedule 2 in Australia for topical formulations, schedule 3 (Aus) for vaginal use and for oral [[candidiasis]], otherwise schedule 4 in Australia
| |
| | routes_of_administration = [[topical]], [[vaginal]]
| |
| | |
| <!--Pharmacokinetic data-->
| |
| | bioavailability = n/a
| |
| | metabolism = n/a
| |
| | elimination_half-life = n/a
| |
| | excretion = n/a
| |
| | |
| <!--Identifiers-->
| |
| | CASNo_Ref = {{cascite|correct|CAS}}
| |
| | CAS_number_Ref = {{cascite|correct|??}}
| |
| | CAS_number = 22916-47-8
| |
| | ATC_prefix = A01
| |
| | ATC_suffix = AB09
| |
| | ATC_supplemental = {{ATC|A07|AC01}} {{ATC|D01|AC02}} {{ATC|G01|AF04}} {{ATC|J02|AB01}} {{ATC|S02|AA13}}
| |
| | PubChem = 4189
| |
| | IUPHAR_ligand = 2449
| |
| | DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| |
| | DrugBank = DB01110
| |
| | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| |
| | ChemSpiderID = 4044
| |
| | UNII_Ref = {{fdacite|correct|FDA}}
| |
| | UNII = 7NNO0D7S5M
| |
| | KEGG_Ref = {{keggcite|correct|kegg}}
| |
| | KEGG = D00416
| |
| | ChEBI_Ref = {{ebicite|correct|EBI}}
| |
| | ChEBI = 6923
| |
| | ChEMBL_Ref = {{ebicite|correct|EBI}}
| |
| | ChEMBL = 91
| |
| | |
| <!--Chemical data-->
| |
| | C=18 | H=14 | Cl=4 | N=2 | O=1
| |
| | molecular_weight = 416.127 g/mol
| |
| | smiles = Clc1ccc(c(Cl)c1)C(OCc2ccc(Cl)cc2Cl)Cn3ccnc3
| |
| | InChI = 1/C18H14Cl4N2O/c19-13-2-1-12(16(21)7-13)10-25-18(9-24-6-5-23-11-24)15-4-3-14(20)8-17(15)22/h1-8,11,18H,9-10H2
| |
| | InChIKey = BYBLEWFAAKGYCD-UHFFFAOYAA
| |
| | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| |
| | StdInChI = 1S/C18H14Cl4N2O/c19-13-2-1-12(16(21)7-13)10-25-18(9-24-6-5-23-11-24)15-4-3-14(20)8-17(15)22/h1-8,11,18H,9-10H2
| |
| | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| |
| | StdInChIKey = BYBLEWFAAKGYCD-UHFFFAOYSA-N
| |
| }}
| |
| |PD=There is limited information regarding <i>Pharmacodynamics</i> of {{PAGENAME}} in the drug label.
| |
| |PK=There is limited information regarding <i>Pharmacokinetics</i> of {{PAGENAME}} in the drug label.
| |
| |nonClinToxic=There is limited information regarding <i>Nonclinical Toxicology</i> of {{PAGENAME}} in the drug label.
| |
| |clinicalStudies=There is limited information regarding <i>Clinical Studies</i> of {{PAGENAME}} in the drug label.
| |
| |storage=* Protect from freezing. Avoid excessive heat.
| |
| |fdaPatientInfo=* Clean the affected area and dry thoroughly. Apply a layer of cream over affected area twice daily (morning and night) or as directed by a doctor.
| |
| * For athlete's foot and ringworm, use daily for 4 weeks.
| |
| * For jock itch, use daily for 2 weeks.
| |
| * For athlete's foot, pay special attention to spaces between toes: wear well fitting, ventilated shoes, and change shoes and socks at least once daily.
| |
| | |
| '''KEEP OUT OF REACH OF CHILDREN'''
| |
| | |
| * If swallowed get medical help or contact a Poison Control Center.
| |
| |alcohol=* Alcohol-{{PAGENAME}} interaction has not been established. Talk to your doctor about the effects of taking alcohol with this medication.
| |
| |brandNames=Miconazole
| |
| |drugShortage=
| |
| }}
| |
| {{PillImage
| |
| |fileName=No image.jpg
| |
| }}
| |
| {{LabelImage
| |
| |fileName=Miconazole ingredients and appearance.png
| |
| }}
| |
| {{LabelImage
| |
| |fileName=Miconazole nitrate.jpg
| |
| }}
| |
| <!--Pill Image-->
| |
| | |
| | |
| | |
| <!--Label Display Image-->
| |
| | |
| | |
| | |
| | |
| | |
| <!--Category-->
| |
| [[Category:Ethers]]
| |
| [[Category:Drug]]
| |