Alprenolol: Difference between revisions
Jump to navigation
Jump to search
No edit summary |
m Protected "Alprenolol": Bot: Protecting all pages from category Drug ([Edit=Allow only administrators] (indefinite) [Move=Allow only administrators] (indefinite)) |
||
| (5 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
{{Drugbox | |||
| verifiedrevid = 443660388 | |||
| IUPAC_name = (''RS'')-1-(2-allylphenoxy)-3-(isopropylamino)propan-2-ol | |||
| image = Alprenolol2.png | |||
<!--Clinical data--> | |||
| tradename = | |||
| Drugs.com = {{drugs.com|international|alprenolol}} | |||
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | |||
| pregnancy_US = <!-- A / B / C / D / X --> | |||
| pregnancy_category = | |||
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> | |||
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> | |||
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> | |||
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> | |||
| legal_status = | |||
| routes_of_administration = Oral | |||
<!--Pharmacokinetic data--> | |||
| bioavailability = | |||
| protein_bound = 80% - 90% | |||
| metabolism = | |||
| elimination_half-life = 2-3 hours → 4-OH-alprenolol | |||
| excretion = | |||
<!--Identifiers--> | |||
| CASNo_Ref = {{cascite|correct|CAS}} | |||
| CAS_number_Ref = {{cascite|correct|??}} | |||
| CAS_number = 13655-52-2 | |||
| ATC_prefix = C07 | |||
| ATC_suffix = AA01 | |||
| ATC_supplemental = | |||
| PubChem = 2119 | |||
| IUPHAR_ligand = 563 | |||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} | |||
| DrugBank = DB00866 | |||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | |||
| ChemSpiderID = 2035 | |||
| UNII_Ref = {{fdacite|correct|FDA}} | |||
| UNII = 877K5MQ27W | |||
| KEGG_Ref = {{keggcite|correct|kegg}} | |||
| KEGG = D07156 | |||
| ChEBI_Ref = {{ebicite|correct|EBI}} | |||
| ChEBI = 51211 | |||
| ChEMBL_Ref = {{ebicite|correct|EBI}} | |||
| ChEMBL = 266195 | |||
<!--Chemical data--> | |||
| chemical_formula = | |||
| C=15 | H=23 | N=1 | O=2 | |||
| molecular_weight = 249.34 g/mol | |||
| smiles = O(c1ccccc1C\C=C)CC(O)CNC(C)C | |||
| InChI = 1/C15H23NO2/c1-4-7-13-8-5-6-9-15(13)18-11-14(17)10-16-12(2)3/h4-6,8-9,12,14,16-17H,1,7,10-11H2,2-3H3 | |||
| InChIKey = PAZJSJFMUHDSTF-UHFFFAOYAS | |||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | |||
| StdInChI = 1S/C15H23NO2/c1-4-7-13-8-5-6-9-15(13)18-11-14(17)10-16-12(2)3/h4-6,8-9,12,14,16-17H,1,7,10-11H2,2-3H3 | |||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | |||
| StdInChIKey = PAZJSJFMUHDSTF-UHFFFAOYSA-N | |||
}} | |||
__NOTOC__ | |||
{{CMG}}; {{AE}} {{SS}} | |||
{{SB}} Atenenol (Tsuruhara Seiyaku, Japan); Elp (Shyh Dar, Taiwan); Skajilol (Kotobuki Seiyaku, Japan) | |||
==Overview== | |||
'''Alprenolol''', or '''alfeprol''', '''alpheprol''', and '''alprenololum''' ('''Gubernal''', '''Regletin''', '''Yobir''', '''Apllobal''', '''Aptine''', '''Aptol Duriles'''), is a non-selective [[beta blocker]] as well as [[5-HT1A_receptor|5-HT<sub>1A</sub> receptor]] [[receptor_antagonist|antagonist]], used in the treatment of [[angina pectoris]].<ref name="pmid4393977">{{cite journal |author=Hickie JB |title=Alprenolol ("aptin") in angina pectoris. A double-blind multicentre trial |journal=Med. J. Aust. |volume=2 |issue=6 |pages=268–72 |date=August 1970 |pmid=4393977 |doi= |url=}}</ref> It is no longer marketed by AstraZeneca, but may still be available from other [[pharmaceutical_industry|pharmaceutical companies]] or [[generic drug|generically]]. | |||
==References== | |||
{{Reflist|2}} | |||
{{Beta blockers}} | |||
[[Category:Cardiovascular Drugs]] | |||
[[Category:Drug]] | |||
[[Category:Beta blockers]] | [[Category:Beta blockers]] | ||
Latest revision as of 17:24, 18 August 2015
 | |
| Clinical data | |
|---|---|
| AHFS/Drugs.com | International Drug Names |
| Routes of administration | Oral |
| ATC code | |
| Pharmacokinetic data | |
| Protein binding | 80% - 90% |
| Elimination half-life | 2-3 hours → 4-OH-alprenolol |
| Identifiers | |
| |
| CAS Number | |
| PubChem CID | |
| IUPHAR/BPS | |
| DrugBank | |
| ChemSpider | |
| UNII | |
| KEGG | |
| ChEBI | |
| ChEMBL | |
| E number | {{#property:P628}} |
| ECHA InfoCard | {{#property:P2566}}Lua error in Module:EditAtWikidata at line 36: attempt to index field 'wikibase' (a nil value). |
| Chemical and physical data | |
| Formula | C15H23NO2 |
| Molar mass | 249.34 g/mol |
| 3D model (JSmol) | |
| |
| |
| (verify) | |
Editor-In-Chief: C. Michael Gibson, M.S., M.D. [1]; Associate Editor(s)-in-Chief: Sheng Shi, M.D. [2]
Synonyms / Brand Names: Atenenol (Tsuruhara Seiyaku, Japan); Elp (Shyh Dar, Taiwan); Skajilol (Kotobuki Seiyaku, Japan)
Overview
Alprenolol, or alfeprol, alpheprol, and alprenololum (Gubernal, Regletin, Yobir, Apllobal, Aptine, Aptol Duriles), is a non-selective beta blocker as well as 5-HT1A receptor antagonist, used in the treatment of angina pectoris.[1] It is no longer marketed by AstraZeneca, but may still be available from other pharmaceutical companies or generically.