|
|
(One intermediate revision by one other user not shown) |
Line 1: |
Line 1: |
| {{drugbox
| | #REDIRECT [[Bumetanide#Pharmacology]] |
| | IUPAC_name = 3-butylamino-4-phenoxy-5-sulfamoyl-benzoic acid
| |
| | image = Bumetanide structure_svg.png
| |
| | image2 = Bumetanide_Bumex .gif
| |
| | width = 160px
| |
| | CAS_number = 28395-03-1
| |
| | ATC_prefix = C03
| |
| | ATC_suffix = CA02
| |
| | ATC_supplemental =
| |
| | PubChem = 2471
| |
| | DrugBank = APRD00294
| |
| | smiles = CCCCNc1cc(cc(c1Oc2ccccc2)S(N)(=O)=O)C(O)=O
| |
| | C = 17 | H = 20 | N = 2 | O = 5 | S = 1
| |
| | molecular_weight = 364.417 g/mol
| |
| | bioavailability = almost complete
| |
| | protein_bound = 97%
| |
| | metabolism = hepatic
| |
| | elimination_half-life = 60-90 minutes
| |
| | pregnancy_AU = B3
| |
| | pregnancy_US = C
| |
| | legal_AU = S4
| |
| | legal_UK = POM
| |
| | legal_US = Rx-only
| |
| | routes_of_administration = oral
| |
| | excretion = renal
| |
| }}
| |
| <!-- FAIR USE of Bumetanide_Bumex .gif: see image description page at http://en.wikipedia.org/wiki/Image:Bumetanide_Bumex .gif for rationale -->
| |
| {{CMG}}
| |
| | |
| {{Editor Join}}
| |
| | |
| ==[[Bumetanide (patient information)|For patient information, click here]]==
| |
| | |
| '''Bumetanide''' is a [[loop diuretic]] of the sulfamyl category to treat [[heart failure]]. It is often used in patients in whom high doses of [[furosemide]] are ineffective. It is marketed by [[Hoffmann-La Roche]] with the brand name Bumex. The main difference between the two substances is in [[bioavailability]]. Furosemide is incompletely absorbed in the intestine (40%), and there is substantial inter- and intraindividual differences in bioavailability (range 10-90%). Bumetanide is completely absorbed (80%), and the absorption is not altered when it is taken with food. It is said to be a more predictable diuretic, meaning that the predictable absorption is reflected in a more predictable effect.
| |
| | |
| Bumetanide is 40 times more potent than furosemide (for patients with normal [[renal function]]).
| |
| | |
| ==External links==
| |
| * [http://www.rocheusa.com/products/bumex/pi.pdf Bumex] (manufacturer's website)
| |
| * [http://www.meds-help.com/bumetanide/ Bumetanide] (patient information)
| |
| | |
| | |
| {{Antihypertensives and diuretics}}
| |
| [[th:บูมีทาไนด์]]
| |
| [[Category:Loop diuretics]]
| |
| [[Category:Drugs]]
| |
| {{WikiDoc Help Menu}}
| |
| {{WikiDoc Sources}}
| |