|
|
Line 1: |
Line 1: |
| {{Drugbox
| | #REDIRECT [[Halobetasol]] |
| | Verifiedfields = changed
| |
| | verifiedrevid = 470619490
| |
| | IUPAC_name = (6α,11β,16β)-21-chloro-6,9-difluoro-11,17-dihydroxy-16-methylpregna-1,4-diene-3,20-dione
| |
| | image = Ulobetasol.png
| |
| | |
| <!--Clinical data-->
| |
| | tradename =
| |
| | Drugs.com = {{drugs.com|CONS|ulobetasol}}
| |
| | MedlinePlus = a601060
| |
| | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| |
| | pregnancy_US = <!-- A / B / C / D / X -->
| |
| | pregnancy_category =
| |
| | legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S8 -->
| |
| | legal_UK = <!-- GSL / P / POM / CD -->
| |
| | legal_US = <!-- OTC / Rx-only -->
| |
| | legal_status =
| |
| | routes_of_administration =
| |
| | |
| <!--Pharmacokinetic data-->
| |
| | bioavailability =
| |
| | protein_bound =
| |
| | metabolism =
| |
| | elimination_half-life =
| |
| | excretion =
| |
| | |
| <!--Identifiers-->
| |
| | CAS_number_Ref = {{cascite|changed|??}}
| |
| | CAS_number = 98651-66-2
| |
| | ATC_prefix = D07
| |
| | ATC_suffix = AC21
| |
| | PubChem = 5311167
| |
| | DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| |
| | DrugBank =
| |
| | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| |
| | ChemSpiderID = 4470691
| |
| | UNII_Ref = {{fdacite|correct|FDA}}
| |
| | UNII = 9P6159HM7T
| |
| | KEGG_Ref = {{keggcite|correct|kegg}}
| |
| | KEGG = D08660
| |
| | ChEMBL_Ref = {{ebicite|changed|EBI}}
| |
| | ChEMBL = 1201360
| |
| | |
| <!--Chemical data-->
| |
| | C=22 | H=27 | Cl=1 | F=2 | O=4
| |
| | molecular_weight = 428.897
| |
| | smiles = ClCC(=O)[C@]3(O)[C@]2(C[C@H](O)[C@]4(F)[C@@]/1(\C(=C/C(=O)\C=C\1)[C@@H](F)C[C@H]4[C@@H]2C[C@@H]3C)C)C
| |
| | InChI = 1/C22H27ClF2O4/c1-11-6-13-14-8-16(24)15-7-12(26)4-5-19(15,2)21(14,25)17(27)9-20(13,3)22(11,29)18(28)10-23/h4-5,7,11,13-14,16-17,27,29H,6,8-10H2,1-3H3/t11-,13-,14-,16-,17-,19-,20-,21-,22-/m0/s1
| |
| | InChIKey = LEHFPXVYPMWYQD-XHIJKXOTBD
| |
| | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| |
| | StdInChI = 1S/C22H27ClF2O4/c1-11-6-13-14-8-16(24)15-7-12(26)4-5-19(15,2)21(14,25)17(27)9-20(13,3)22(11,29)18(28)10-23/h4-5,7,11,13-14,16-17,27,29H,6,8-10H2,1-3H3/t11-,13-,14-,16-,17-,19-,20-,21-,22-/m0/s1
| |
| | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| |
| | StdInChIKey = LEHFPXVYPMWYQD-XHIJKXOTSA-N
| |
| | synonyms = <small>(6''S'',8''S'',9''S'',10''S'',11''S'',13''S'',14''S'',16''S'',17''R'')-17-(2-Chloroacetyl)-6,9-difluoro-11,17-dihydroxy-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[''a'']phenanthren-3-one</small>
| |
| }}
| |
| __NOTOC__
| |
| {{SI}}
| |
| {{CMG}}
| |
| ==Overview==
| |
| '''Ulobetasol''' ([[International Nonproprietary Name|INN]]) or '''halobetasol''' ([[United States Adopted Name|USAN]]) is a [[corticosteroid]] used to treat [[psoriasis]]. It is a group I corticosteroid under the US classification, the most potent class of such drugs. Halobetasol propionate is usually supplied as a 0.05% topical cream.
| |
| ==References==
| |
| | |
| {{reflist|2}}
| |
| | |
| [[Category:Glucocorticoids]]
| |
| [[Category:Organofluorides]]
| |
| [[Category:Organochlorides]]
| |
| [[Category:Alcohols]]
| |
| [[Category:Ketones]]
| |
| [[Category:Drug]]
| |