Calcium glucoheptonate: Difference between revisions
Jump to navigation
Jump to search
m (Bot: Automated text replacement (-{{SIB}} + & -{{EH}} + & -{{EJ}} + & -{{Editor Help}} + & -{{Editor Join}} +)) |
m (Protected "Calcium glucoheptonate": Bot: Protecting all pages from category Drug ([Edit=Allow only administrators] (indefinite) [Move=Allow only administrators] (indefinite))) |
||
(2 intermediate revisions by one other user not shown) | |||
Line 1: | Line 1: | ||
{{Drugbox | |||
| Verifiedfields = changed | |||
| Watchedfields = changed | |||
| verifiedrevid = 401940746 | |||
| IUPAC_name = calcium (2R,3R,4S,5R,6R)-2,3,4,5,6,7-hexahydroxyheptanoate | |||
| image = calcium glucoheptonate.png | |||
<!--Clinical data--> | |||
| tradename = | |||
| Drugs.com = {{drugs.com|international|calcium-glucoheptonate}} | |||
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | |||
| pregnancy_US = <!-- A / B / C / D / X --> | |||
| pregnancy_category = | |||
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> | |||
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> | |||
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> | |||
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> | |||
| legal_status = | |||
| routes_of_administration = | |||
<!--Pharmacokinetic data--> | |||
| bioavailability = | |||
| protein_bound = | |||
| metabolism = | |||
| elimination_half-life = | |||
| excretion = | |||
<!--Identifiers--> | |||
| CASNo_Ref = {{cascite|correct|CAS}} | |||
| CAS_number_Ref = {{cascite|correct|??}} | |||
| CAS_number = 29039-00-7 | |||
| ATC_prefix = A12 | |||
| ATC_suffix = AA10 | |||
| PubChem = 28327 | |||
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} | |||
| DrugBank = DB00326 | |||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | |||
| ChemSpiderID = 16741933 | |||
| UNII_Ref = {{fdacite|changed|FDA}} | |||
| UNII = L11651398J | |||
<!--Chemical data--> | |||
| C=14 | H=26 | Ca=1 | O=16 | |||
| | | molecular_weight = 490.425 g/mol | ||
| | | smiles = [Ca+2].O[C@@H]([C@H](O)[C@@H](O)C([O-])=O)[C@H](O)C(O)CO.[O-]C(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)C(O)CO | ||
| InChI = 1/2C7H14O8.Ca/c2*8-1-2(9)3(10)4(11)5(12)6(13)7(14)15;/h2*2-6,8-13H,1H2,(H,14,15);/q;;+2/p-2/t2*2?,3-,4-,5+,6-;/m11./s1 | |||
| | | InChIKey = FATUQANACHZLRT-DKUZMZKCBH | ||
| | | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | ||
| StdInChI = 1S/2C7H14O8.Ca/c2*8-1-2(9)3(10)4(11)5(12)6(13)7(14)15;/h2*2-6,8-13H,1H2,(H,14,15);/q;;+2/p-2/t2*2?,3-,4-,5+,6-;/m11./s1 | |||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | |||
| molecular_weight | | StdInChIKey = FATUQANACHZLRT-YTESCSPLSA-L | ||
| | |||
| | |||
| | |||
| | |||
| | |||
| | |||
| | |||
}} | }} | ||
__NOTOC__ | |||
{{SI}} | {{SI}} | ||
{{CMG}} | |||
==Overview== | |||
'''Calcium glucoheptonate''' is a [[Dietary mineral|mineral supplement]]. | '''Calcium glucoheptonate''' is a [[Dietary mineral|mineral supplement]]. | ||
==References== | |||
{{Reflist|2}} | |||
{{Mineral supplements}} | {{Mineral supplements}} | ||
[[Category:Calcium compounds]] | [[Category:Calcium compounds]] | ||
[[Category:Drug]] | |||
{{ | |||
{{gastrointestinal-drug-stub}} |
Latest revision as of 18:31, 18 August 2015
Clinical data | |
---|---|
AHFS/Drugs.com | International Drug Names |
ATC code | |
Identifiers | |
| |
CAS Number | |
PubChem CID | |
DrugBank | |
ChemSpider | |
UNII | |
E number | {{#property:P628}} |
ECHA InfoCard | {{#property:P2566}}Lua error in Module:EditAtWikidata at line 36: attempt to index field 'wikibase' (a nil value). |
Chemical and physical data | |
Formula | C14H26CaO16 |
Molar mass | 490.425 g/mol |
3D model (JSmol) | |
| |
| |
(what is this?) (verify) |
Editor-In-Chief: C. Michael Gibson, M.S., M.D. [1]
Overview
Calcium glucoheptonate is a mineral supplement.
References
Categories:
- Pages with script errors
- Template:drugs.com link with non-standard subpage
- Articles with changed DrugBank identifier
- E number from Wikidata
- ECHA InfoCard ID from Wikidata
- Chemical articles with unknown parameter in Infobox drug
- Articles without EBI source
- Articles without KEGG source
- Drugs with no legal status
- Drugboxes which contain changes to verified fields
- Drugboxes which contain changes to watched fields
- Calcium compounds
- Drug