Template:Metoprolol: Difference between revisions
Jump to navigation
Jump to search
Ahmed Zaghw (talk | contribs) (Created page with "{| style="margin: 0 0 3em 3em; border: 1px solid #696969; float: right; width:20em" cellpadding="0" cellspacing="0"; ! style="padding: 0 5px; font-size: 100%; background:#F8F8...") |
No edit summary |
||
(40 intermediate revisions by 6 users not shown) | |||
Line 1: | Line 1: | ||
{| | {{Drugbox | ||
| verifiedrevid = 459444186 | |||
| IUPAC_name = (''RS'')-1-(Isopropylamino)-3-[4-(2-methoxyethyl)phenoxy]propan-2-ol | |||
! | | image = 2000px-Metoprolol structure.svg.png | ||
|- | | drug_name = Metoprolol | ||
| | <!--Clinical data--> | ||
| tradename = Lopressor, Toprol-xl | |||
| Drugs.com = {{drugs.com|monograph|metoprolol-succinate}} | |||
| MedlinePlus = a682864 | |||
|- | | licence_US = Metoprolol | ||
| pregnancy_AU = C | |||
| pregnancy_US = C | |||
! | | legal_status = Rx-only | ||
|- | | routes_of_administration = Oral, [[Intravenous|IV]] | ||
| | <!--Pharmacokinetic data--> | ||
| bioavailability = 12% | |||
| | | metabolism = [[Liver|Hepatic]] via [[CYP2D6]], [[CYP3A4]] | ||
| elimination_half-life = 3-7 hours | |||
| | | excretion = [[Kidney|Renal]] | ||
| | <!--Identifiers--> | ||
| CAS_number_Ref = {{cascite|correct|??}} | |||
| | | CAS_number = 51384-51-1 | ||
| ATC_prefix = C07 | |||
|- | | ATC_suffix = AB02 | ||
| PubChem = 4171 | |||
| | | IUPHAR_ligand = 553 | ||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} | |||
| | | DrugBank = DB00264 | ||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | |||
|- | | ChemSpiderID = 4027 | ||
| UNII_Ref = {{fdacite|correct|FDA}} | |||
|- | | UNII = GEB06NHM23 | ||
| KEGG_Ref = {{keggcite|correct|kegg}} | |||
|- | | KEGG = D02358 | ||
|} | | ChEBI_Ref = {{ebicite|correct|EBI}} | ||
| ChEBI = 6904 | |||
| ChEMBL_Ref = {{ebicite|correct|EBI}} | |||
| ChEMBL = 13 | |||
<!--Chemical data--> | |||
| C=15 | H=25 | N=1 | O=3 | |||
| molecular_weight = 267.364 [[gram|g]]/[[Mole (unit)|mol]] | |||
| smiles = O(c1ccc(cc1)CCOC)CC(O)CNC(C)C | |||
| InChI = 1/C15H25NO3/c1-12(2)16-10-14(17)11-19-15-6-4-13(5-7-15)8-9-18-3/h4-7,12,14,16-17H,8-11H2,1-3H3 | |||
| InChIKey = IUBSYMUCCVWXPE-UHFFFAOYAN | |||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | |||
| StdInChI = 1S/C15H25NO3/c1-12(2)16-10-14(17)11-19-15-6-4-13(5-7-15)8-9-18-3/h4-7,12,14,16-17H,8-11H2,1-3H3 | |||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | |||
| StdInChIKey = IUBSYMUCCVWXPE-UHFFFAOYSA-N | |||
| melting_point = 120 | |||
}} |
Latest revision as of 15:36, 21 March 2014
Clinical data | |
---|---|
Trade names | Lopressor, Toprol-xl |
AHFS/Drugs.com | Monograph |
MedlinePlus | a682864 |
[[Regulation of therapeutic goods |Template:Engvar data]] |
|
Pregnancy category | |
Routes of administration | Oral, IV |
ATC code | |
Legal status | |
Legal status |
|
Pharmacokinetic data | |
Bioavailability | 12% |
Metabolism | Hepatic via CYP2D6, CYP3A4 |
Elimination half-life | 3-7 hours |
Excretion | Renal |
Identifiers | |
| |
CAS Number | |
PubChem CID | |
IUPHAR/BPS | |
DrugBank | |
ChemSpider | |
UNII | |
KEGG | |
ChEBI | |
ChEMBL | |
E number | {{#property:P628}} |
ECHA InfoCard | {{#property:P2566}}Lua error in Module:EditAtWikidata at line 36: attempt to index field 'wikibase' (a nil value). |
Chemical and physical data | |
Formula | C15H25NO3 |
Molar mass | 267.364 g/mol |
3D model (JSmol) | |
Melting point | 120 °C (248 °F) |
| |
| |
(verify) |