|
|
(107 intermediate revisions by 2 users not shown) |
Line 1: |
Line 1: |
| {{Lotensin tablet}}
| | #REDIRECT [[Benazepril]] |
| <div style="width: 80%">
| |
| __NOTOC__
| |
| {{CMG}}; {{AE}} {{AM}}, {{AZ}}
| |
| | |
| '''''For information about Benazepril, click [[Benazepril|here]].'''''
| |
| | |
| ==Disclaimer==
| |
| | |
| '''''WikiDoc Drug Project is a constellation of drug information for healthcare providers and patients vigorously vetted on the basis of FDA package insert, MedlinePlus, Practice Guidelines, Scientific Statements, and scholarly medical literature. The information provided is not a medical advice or treatment. WikiDoc does not promote any medication or off-label use of drugs. Please read our full disclaimer [[wikidoc:General_disclaimer|{{fontcolor|#FF0000|here}}]].'''''
| |
| | |
| ==<span style="color:#FF0000; background:#000000;">Black Box Warning</span>==
| |
| | |
| {| style="border: 3px solid #696969;"
| |
| | style="background: #000000; border: 0px; padding: 20px 20px; width: 800px;" |
| |
| <center>
| |
| <font color="#F8F8FF" style="font-weight: bold;">WARNING: FETAL TOXICITY</font>
| |
| </center>
| |
| | |
| <center>
| |
| <font color="#F8F8FF" size="1" style="font-style: italic;">See full prescribing information for complete boxed warning.</font>
| |
| </center>
| |
| | |
| <font color="#F8F8FF" style="font-weight: bold;">
| |
| * When pregnancy is detected, discontinue Lotensin as soon as possible.
| |
| * Drugs that act directly on the renin-angiotensin system can cause injury and death to the developing fetus.
| |
| </font>
| |
| |}
| |
| | |
| ==Overview==
| |
| | |
| {{PAGENAME}} is an [[angiotensin converting enzyme inhibitor]] drug that is FDA approved for the treatment of [[hypertension]]. There is a Black Box Warning for this drug as shown <span style="background:#000000;">'''[[{{PAGENAME}}#Black Box Warning|{{fontcolor|#FF0000|here}}]]'''</span>. Common adverse reactions include [[cough]], [[dizziness]], [[fatigue]], and [[headache]].
| |
| | |
| ==Adult Indications and Dosage==
| |
| | |
| ===FDA-Labeled Indications and Dosage (Adult)===
| |
| | |
| =====Hypertension=====
| |
| | |
| * Dosing Information
| |
| | |
| :: Initial dose (not receiving a diuretic): [[Lotensin tablet]] 10 mg PO qd
| |
| | |
| :: Initial dose (concurrent diuretic use): the diuretic should be discontinued 2 to 3 days prior to beginning therapy with [[Lotensin tablet]], if blood pressure is not controlled with [[Lotensin tablet]] alone, [[diuretic]] therapy should be resumed. If the [[diuretic]] cannot be discontinued, an initial dose of 5 mg [[Lotensin tablet]] should be used.
| |
| | |
| :: Maintenance dose: [[Lotensin tablet]] 20—40 mg PO qd or [[Lotensin tablet]] 10—20 mg PO bid (MAX 80 mg/day)
| |
| | |
| Lotensin is indicated for the treatment of [[hypertension]]. It may be used alone or in combination with [[thiazide]] [[diuretic]]s.
| |
| | |
| The recommended initial dose for patients not receiving a [[diuretic]] is 10 mg once a day. The usual maintenance dosage range is 20-40 mg per day administered as a single dose or in two equally divided doses. A dose of 80 mg gives an increased response, but experience with this dose is limited. The divided regimen was more effective in controlling trough (pre-dosing) blood pressure than the same dose given as a once-daily regimen. Dosage adjustment should be based on measurement of peak (2-6 hours after dosing) and trough responses. If a once-daily regimen does not give adequate trough response, an increase in dosage or divided administration should be considered. If blood pressure is not controlled with Lotensin alone, a diuretic can be added.
| |
| | |
| Total daily doses above 80 mg have not been evaluated.
| |
| | |
| Concomitant administration of Lotensin with potassium supplements, potassium salt substitutes, or potassium-sparing diuretics can lead to increases of serum potassium.
| |
| | |
| In patients who are currently being treated with a diuretic, symptomatic hypotension occasionally can occur following the initial dose of Lotensin. To reduce the likelihood of hypotension, the diuretic should, if possible, be discontinued two to three days prior to beginning therapy with Lotensin (see ''[[{{PAGENAME}}#Warnings|Warnings]]''). Then, if blood pressure is not controlled with Lotensin alone, diuretic therapy should be resumed.
| |
| | |
| If the diuretic cannot be discontinued, an initial dose of 5 mg Lotensin should be used to avoid excessive hypotension.<ref name="dailymed.nlm.nih.gov">{{Cite web | last = | first = | title = LOTENSIN (BENAZEPRIL HYDROCHLORIDE) TABLET [NOVARTIS PHARMACEUTICALS CORPORATION] | url = http://dailymed.nlm.nih.gov/dailymed/lookup.cfm?setid=4d954024-a191-46e3-ba71-2a7d5b0c65d5 | publisher = | date = | accessdate = }}</ref>
| |
| | |
| ===Off-Label Use and Dosage (Adult)===
| |
| | |
| ====Guideline-Supported Use====
| |
| | |
| =====Condition 1=====
| |
| | |
| * Developed by: (Organisation)
| |
| | |
| * Class of Recommendation: (Class) (Link)
| |
| | |
| * Strength of Evidence: (Category A/B/C) (Link)
| |
| | |
| * Dosing Information
| |
| | |
| :: (Dosage)
| |
| | |
| =====Condition 2=====
| |
| | |
| * Developed by: (Organisation)
| |
| | |
| * Class of Recommendation: (Class) (Link)
| |
| | |
| * Strength of Evidence: (Category A/B/C) (Link)
| |
| | |
| * Dosing Information
| |
| | |
| :: (Dosage)
| |
| | |
| ====Non–Guideline-Supported Use====
| |
| | |
| =====Condition 1=====
| |
| | |
| * Dosing Information
| |
| | |
| :: (Dosage)
| |
| | |
| =====Condition 2=====
| |
| | |
| * Dosing Information
| |
| | |
| :: (Dosage)
| |
| | |
| =====Condition 3=====
| |
| | |
| * Dosing Information
| |
| | |
| :: (Dosage)
| |
| | |
| ==Pediatric Indications and Dosage==
| |
| | |
| ===FDA-Labeled Indications and Dosage (Pediatric)===
| |
| | |
| =====Condition 1=====
| |
| | |
| * Dosing Information
| |
| | |
| :: (Dosage)
| |
| | |
| =====Condition 2=====
| |
| | |
| * Dosing Information
| |
| | |
| :: (Dosage)
| |
| | |
| ===Off-Label Use and Dosage (Pediatric)===
| |
| | |
| ====Guideline-Supported Use====
| |
| | |
| =====[[Heart Failure]], Stage B=====
| |
| | |
| * Developed by: [[American College of Cardiology|American College of Cardiology (ACC)]] and [[American Heart Association|American Heart Association (AHA)]]
| |
| | |
| * Class of Recommendation: [[ACC AHA guidelines classification scheme#Class I: Benefit >>> Risk|Class I]]
| |
| | |
| * Level of Evidence: [[ACC AHA guidelines classification scheme#Level of Evidence A:|Level A]]
| |
| | |
| * Dosing Information
| |
| | |
| :: In all patients with a recent or remote history of [[MI]] or [[ACS]] and reduced [[EF]], [[ACE inhibitor]]s should be used to prevent symptomatic [[HF]] and reduce [[mortality]].<ref name="Yancy-2013">{{Cite journal | last1 = Yancy | first1 = CW. | last2 = Jessup | first2 = M. | last3 = Bozkurt | first3 = B. | last4 = Butler | first4 = J. | last5 = Casey | first5 = DE. | last6 = Drazner | first6 = MH. | last7 = Fonarow | first7 = GC. | last8 = Geraci | first8 = SA. | last9 = Horwich | first9 = T. | title = 2013 ACCF/AHA guideline for the management of heart failure: a report of the American College of Cardiology Foundation/American Heart Association Task Force on practice guidelines. | journal = Circulation | volume = 128 | issue = 16 | pages = e240-327 | month = Oct | year = 2013 | doi = 10.1161/CIR.0b013e31829e8776 | PMID = 23741058 }}</ref>
| |
| | |
| =====Condition 2=====
| |
| | |
| * Developed by: (Organisation)
| |
| | |
| * Class of Recommendation: (Class) (Link)
| |
| | |
| * Strength of Evidence: (Category A/B/C) (Link)
| |
| | |
| * Dosing Information
| |
| | |
| :: (Dosage)
| |
| | |
| ====Non–Guideline-Supported Use====
| |
| | |
| =====Condition 1=====
| |
| | |
| * Dosing Information
| |
| | |
| :: (Dosage)
| |
| | |
| =====Condition 2=====
| |
| | |
| * Dosing Information
| |
| | |
| :: (Dosage)
| |
| | |
| =====Condition 3=====
| |
| | |
| * Dosing Information
| |
| | |
| :: (Dosage)
| |
| | |
| ==Contraindications==
| |
| | |
| * [[Hypersensitivity]] to [[benazapril]] or to any other [[ACE inhibitor]]
| |
| | |
| * History of [[angioedema]] with or without previous [[ACE inhibitor]] treatment
| |
| | |
| ==Warnings==
| |
| | |
| =====Anaphylactoid and Possibly Related Reactions=====
| |
| | |
| Presumably because angiotensin-converting enzyme inhibitors affect the metabolism of [[eicosanoids]] and polypeptides, including endogenous [[bradykinin]], patients receiving [[ACE inhibitors]] (including Lotensin) may be subject to a variety of adverse reactions, some of them serious.
| |
| | |
| '''Head and Neck Angioedema''': [[Angioedema]] of the face, extremities, lips, tongue, glottis, and larynx has been reported in patients treated with [[angiotensin-converting enzyme inhibitors]]. In U.S. clinical trials, symptoms consistent with [[angioedema]] were seen in none of the subjects who received placebo and in about 0.5% of the subjects who received Lotensin. [[Angioedema]] associated with [[laryngeal edema]] can be fatal. If laryngeal [[stridor]] or angioedema of the face, tongue, or [[glottis]] occurs, treatment with Lotensin should be discontinued and appropriate therapy instituted immediately. Where there is involvement of the tongue, [[glottis]], or [[larynx]], likely to cause airway obstruction, appropriate therapy, e.g., subcutaneous [[epinephrine]] injection 1:1000 (0.3 mL to 0.5 mL) should be promptly administered (see ADVERSE REACTIONS).
| |
| | |
| Black patients receiving ACE inhibitors have been reported to have a higher incidence of angioedema compared to nonblacks.
| |
| | |
| '''Intestinal Angioedema''': Intestinal angioedema has been reported in patients treated with [[ACE inhibitors]]. These patients presented with [[abdominal pain]] (with or without [[nausea]] or [[vomiting]]); in some cases there was no prior history of facial angioedema and [[C-1 esterase]] levels were normal. The angioedema was diagnosed by procedures including abdominal [[CT scan]] or [[ultrasound]], or at surgery, and symptoms resolved after stopping the [[ACE inhibitor]]. Intestinal angioedema should be included in the differential diagnosis of patients on [[ACE inhibitors]] presenting with [[abdominal pain]].
| |
| | |
| '''Anaphylactoid Reactions During Desensitization''': Two patients undergoing desensitizing treatment with [[hymenoptera venom]] while receiving [[ACE inhibitor]]s sustained life-threatening [[anaphylactoid reaction]]s. In the same patients, these reactions were avoided when [[ACE inhibitor]]s were temporarily withheld, but they reappeared upon inadvertent rechallenge.
| |
| | |
| '''Anaphylactoid Reactions During Membrane Exposure''': [[Anaphylactoid reaction]]s have been reported in patients dialyzed with high-flux membranes and treated concomitantly with an [[ACE inhibitor]]. [[Anaphylactoid reaction]]s have also been reported in patients undergoing [[low-density lipoprotein]] apheresis with dextran sulfate absorption (a procedure dependent upon devices not approved in the United States).
| |
| | |
| =====Hypotension=====
| |
| | |
| Lotensin can cause symptomatic [[hypotension]]. Like other ACE inhibitors, benazepril has been only rarely associated with [[hypotension]] in uncomplicated hypertensive patients. Symptomatic [[hypotension]] is most likely to occur in patients who have been volume-and/or salt-depleted as a result of prolonged [[diuretic]] therapy, dietary salt restriction, [[dialysis]], [[diarrhea]], or [[vomiting]]. Volume-and/or salt-depletion should be corrected before initiating therapy with Lotensin.
| |
| | |
| In patients with [[congestive heart failure]], with or without associated [[renal insufficiency]], ACE inhibitor therapy may cause excessive [[hypotension]], which may be associated with [[oliguria]] or [[azotemia]] and, rarely, with [[acute renal failure]] and death. In such patients, Lotensin therapy should be started under close medical supervision; they should be followed closely for the first 2 weeks of treatment and whenever the dose of benazepril or diuretic is increased.
| |
| | |
| If [[hypotension]] occurs, the patient should be placed in a supine position, and, if necessary, treated with intravenous infusion of physiological [[saline]]. Lotensin treatment usually can be continued following restoration of blood pressure and volume.
| |
| | |
| =====Fetal toxicity=====
| |
| | |
| : '''[[Pregnancy category#United States|Pregnancy Category (FDA)]]: D'''
| |
| | |
| Use of drugs that act on the renin-angiotensin system during the second and third trimesters of pregnancy reduces fetal renal function and increases fetal and neonatal morbidity and death. Resulting [[oligohydramnios]] can be associated with fetal lung [[hypoplasia]] and skeletal deformations. Potential neonatal adverse effects include skull [[hypoplasia]], [[anuria]], [[hypotension]], [[renal failure]], and death. When pregnancy is detected, discontinue Lotensin as soon as possible. These adverse outcomes are usually associated with use of these drugs in the second and third trimester of pregnancy. Most epidemiologic studies examining fetal abnormalities after exposure to [[antihypertensive]] use in the first trimester have not distinguished drugs affecting the renin-angiotensin system from other [[antihypertensive agent]]s. Appropriate management of [[maternal hypertension]] during pregnancy is important to optimize outcomes for both mother and fetus.
| |
| | |
| In the unusual case that there is no appropriate alternative to therapy with drugs affecting the [[renin-angiotensin system]] for a particular patient, apprise the mother of the potential risk to the fetus. Perform serial ultrasound examinations to assess the intra-amniotic environment. If [[oligohydramnios]] is observed, discontinue Lotensin, unless it is considered lifesaving for the mother. Fetal testing may be appropriate, based on the week of pregnancy. Patients and physicians should be aware, however, that [[oligohydramnios]] may not appear until after the fetus has sustained irreversible injury. Closely observe infants with histories of in utero exposure to Lotensin for [[hypotension]], [[oliguria]], and [[hyperkalemia]] [see Precautions, Pediatric Use].
| |
| | |
| No teratogenic effects of Lotensin were seen in studies of pregnant rats, mice, and rabbits. On a mg/m2 basis, the doses used in these studies were 60 times (in rats), 9 times (in mice), and more than 0.8 times (in rabbits) the maximum recommended human dose (assuming a 50-kg woman). On a mg/kg basis these multiples are 300 times (in rats), 90 times (in mice), and more than 3 times (in rabbits) the maximum recommended human dose.
| |
| | |
| =====Hepatic Failure=====
| |
| | |
| Rarely, [[ACE inhibitors]] have been associated with a syndrome that starts with [[cholestatic jaundice]] and progresses to [[fulminant hepatic necrosis]] and (sometimes) death. The mechanism of this syndrome is not understood. Patients receiving [[ACE inhibitor]]s who develop [[jaundice]] or marked elevations of hepatic enzymes should discontinue the ACE inhibitor and receive appropriate medical follow-up.
| |
| | |
| ==Adverse Reactions==
| |
| | |
| ===Clinical Trials Experience===
| |
| | |
| =====Condition 1=====
| |
| | |
| ======Central Nervous System======
| |
| | |
| : (list/description of adverse reactions)
| |
| | |
| ======Cardiovascular======
| |
| | |
| : (list/description of adverse reactions)
| |
| | |
| ======Respiratory======
| |
| | |
| : (list/description of adverse reactions)
| |
| | |
| ======Gastrointestinal======
| |
| | |
| : (list/description of adverse reactions)
| |
| | |
| ======Hypersensitive Reactions======
| |
| | |
| : (list/description of adverse reactions)
| |
| | |
| ======Miscellaneous======
| |
| | |
| : (list/description of adverse reactions)
| |
| | |
| =====Condition 1=====
| |
| | |
| ======Central Nervous System======
| |
| | |
| : (list/description of adverse reactions)
| |
| | |
| ======Cardiovascular======
| |
| | |
| : (list/description of adverse reactions)
| |
| | |
| ======Respiratory======
| |
| | |
| : (list/description of adverse reactions)
| |
| | |
| ======Gastrointestinal======
| |
| | |
| : (list/description of adverse reactions)
| |
| | |
| ======Hypersensitive Reactions======
| |
| | |
| : (list/description of adverse reactions)
| |
| | |
| ======Miscellaneous======
| |
| | |
| : (list/description of adverse reactions)
| |
| | |
| ===Postmarketing Experience===
| |
| | |
| (Description)
| |
| | |
| ==Drug Interactions==
| |
| | |
| * Drug 1
| |
| * Drug 2
| |
| * Drug 3
| |
| * Drug 4
| |
| * Drug 5
| |
| | |
| =====Drug 1=====
| |
| | |
| (Description)
| |
| | |
| =====Drug 2=====
| |
| | |
| (Description)
| |
| | |
| =====Drug 3=====
| |
| | |
| (Description)
| |
| | |
| =====Drug 4=====
| |
| | |
| (Description)
| |
| | |
| =====Drug 5=====
| |
| | |
| (Description)
| |
| | |
| ==Use in Specific Populations==
| |
| | |
| ====Pregnancy====
| |
| | |
| : '''[[Pregnancy category#United States|Pregnancy Category (FDA)]]: D'''
| |
| | |
| =====Fetal toxicity=====
| |
| | |
| Use of drugs that act on the renin-angiotensin system during the second and third trimesters of pregnancy reduces fetal renal function and increases fetal and neonatal morbidity and death. Resulting [[oligohydramnios]] can be associated with fetal lung [[hypoplasia]] and skeletal deformations. Potential neonatal adverse effects include skull [[hypoplasia]], [[anuria]], [[hypotension]], [[renal failure]], and death. When pregnancy is detected, discontinue Lotensin as soon as possible. These adverse outcomes are usually associated with use of these drugs in the second and third trimester of pregnancy. Most epidemiologic studies examining fetal abnormalities after exposure to [[antihypertensive]] use in the first trimester have not distinguished drugs affecting the renin-angiotensin system from other [[antihypertensive agent]]s. Appropriate management of [[maternal hypertension]] during pregnancy is important to optimize outcomes for both mother and fetus.
| |
| | |
| In the unusual case that there is no appropriate alternative to therapy with drugs affecting the [[renin-angiotensin system]] for a particular patient, apprise the mother of the potential risk to the fetus. Perform serial ultrasound examinations to assess the intra-amniotic environment. If [[oligohydramnios]] is observed, discontinue Lotensin, unless it is considered lifesaving for the mother. Fetal testing may be appropriate, based on the week of pregnancy. Patients and physicians should be aware, however, that [[oligohydramnios]] may not appear until after the fetus has sustained irreversible injury. Closely observe infants with histories of in utero exposure to Lotensin for [[hypotension]], [[oliguria]], and [[hyperkalemia]] [see Precautions, Pediatric Use].
| |
| | |
| No teratogenic effects of Lotensin were seen in studies of pregnant rats, mice, and rabbits. On a mg/m2 basis, the doses used in these studies were 60 times (in rats), 9 times (in mice), and more than 0.8 times (in rabbits) the maximum recommended human dose (assuming a 50-kg woman). On a mg/kg basis these multiples are 300 times (in rats), 90 times (in mice), and more than 3 times (in rabbits) the maximum recommended human dose.
| |
| | |
| ====Labor and Delivery====
| |
| | |
| FDA Package Insert for {{PAGENAME}} contains no information regarding ''Labor and Delivery''.
| |
| | |
| ====Nursing Mothers====
| |
| | |
| FDA Package Insert for {{PAGENAME}} contains no information regarding ''Nursing Mothers''.
| |
| | |
| ====Pediatric Use====
| |
| | |
| FDA Package Insert for {{PAGENAME}} contains no information regarding ''Pediatric Use''.
| |
| | |
| ====Geriatric Use====
| |
| | |
| FDA Package Insert for {{PAGENAME}} contains no information regarding ''Geriatric Use''.
| |
| | |
| ====Gender====
| |
| | |
| FDA Package Insert for {{PAGENAME}} contains no information regarding ''Gender''.
| |
| | |
| ====Race====
| |
| | |
| FDA Package Insert for {{PAGENAME}} contains no information regarding ''Race''.
| |
| | |
| ====Renal Impairment====
| |
| | |
| As a consequence of inhibiting the renin-angiotensin-aldosterone system, changes in renal function may be anticipated in susceptible individuals. In patients with severe congestive heart failure whose renal function may depend on the activity of the renin-angiotensin-aldosterone system, treatment with angiotensin-converting enzyme inhibitors, including Lotensin, may be associated with oliguria and/or progressive azotemia and (rarely) with acute renal failure and/or death. In a small study of hypertensive patients with renal artery stenosis in a solitary kidney or bilateral renal artery stenosis, treatment with Lotensin was associated with increases in blood urea nitrogen and serum creatinine; these increases were reversible upon discontinuation of Lotensin or diuretic therapy, or both. When such patients are treated with ACE inhibitors, renal function should be monitored during the first few weeks of therapy. Some hypertensive patients with no apparent preexisting renal vascular disease have developed increases in blood urea nitrogen and serum creatinine, usually minor and transient, especially when Lotensin has been given concomitantly with a diuretic. This is more likely to occur in patients with preexisting renal impairment. Dosage reduction of Lotensin and/or discontinuation of the diuretic may be required. Evaluation of the hypertensive patient should always include assessment of renal function (see DOSAGE AND ADMINISTRATION).
| |
| | |
| ====Hepatic Impairment====
| |
| | |
| FDA Package Insert for {{PAGENAME}} contains no information regarding ''Hepatic Impairment''.
| |
| | |
| ====Females of Reproductive Potential and Males====
| |
| | |
| FDA Package Insert for {{PAGENAME}} contains no information regarding ''Females of Reproductive Potential and Males''.
| |
| | |
| ====Immunocompromised Patients====
| |
| | |
| FDA Package Insert for {{PAGENAME}} contains no information regarding ''Immunocompromised Patients''.
| |
| | |
| ====Others====
| |
| | |
| '''Hyperkalemia''': In clinical trials, hyperkalemia (serum potassium at least 0.5 mEq/L greater than the upper limit of normal) occurred in approximately 1% of hypertensive patients receiving Lotensin. In most cases, these were isolated values which resolved despite continued therapy. Risk factors for the development of hyperkalemia include renal insufficiency, diabetes mellitus, and the concomitant use of potassium-sparing diuretics, potassium supplements, and/or potassium-containing salt substitutes, which should be used cautiously, if at all, with Lotensin (see Drug Interactions).
| |
| | |
| '''Cough''': Presumably due to the inhibition of the degradation of endogenous bradykinin, persistent nonproductive cough has been reported with all ACE inhibitors, always resolving after discontinuation of therapy. ACE inhibitor-induced cough should be considered in the differential diagnosis of cough.
| |
| | |
| '''Surgery/Anesthesia''': In patients undergoing surgery or during anesthesia with agents that produce hypotension, benazepril will block the angiotensin II formation that could otherwise occur secondary to compensatory renin release. Hypotension that occurs as a result of this mechanism can be corrected by volume expansion.
| |
| | |
| ==Administration and Monitoring==
| |
| | |
| ====Administration====
| |
| | |
| Oral
| |
| | |
| ====Monitoring====
| |
| | |
| =====Hypertensive patients with renal artery stenosis in a solitary kidney or bilateral renal artery stenosis=====
| |
| | |
| When hypertensive patients with renal artery stenosis in a solitary kidney or bilateral renal artery stenosis patients are treated with ACE inhibitors, renal function should be monitored during the first few weeks of therapy.
| |
| | |
| =====Potassium Supplements and Potassium-Sparing Diuretics=====
| |
| | |
| Concomitant potassium supplements and potassium-sparing diuretics use with Lotensin may effect potassium levels. Monitor potassium periodically.
| |
| | |
| =====Condition 3=====
| |
| | |
| (Description regarding monitoring, from ''Warnings'' section)
| |
| | |
| ==IV Compatibility==
| |
| | |
| FDA Package Insert for {{PAGENAME}} contains no information regarding ''IV Compatibility''.
| |
| | |
| ==Overdosage==
| |
| | |
| | |
| ===Acute Overdose===
| |
| | |
| ====Signs and Symptoms====
| |
| | |
| Human overdoses of benazepril have not been reported, but the most common manifestation of human benazepril overdosage is likely to be hypotension, which can be associated with electrolyte disturbances and renal failure.
| |
| | |
| Laboratory determinations of serum levels of benazepril and its metabolites are not widely available, and such determinations have, in any event, no established role in the management of benazepril overdose.
| |
| | |
| ====Management====
| |
| | |
| No data are available to suggest physiological maneuvers (e.g., maneuvers to change the pH of the urine) that might accelerate elimination of benazepril and its metabolites. Benazepril is only slightly dialyzable, but dialysis might be considered in overdosed patients with severely impaired renal function (see WARNINGS).
| |
| | |
| Angiotensin II could presumably serve as a specific antagonist-antidote in the setting of benazepril overdose, but angiotensin II is essentially unavailable outside of scattered research facilities. Because the hypotensive effect of benazepril is achieved through vasodilation and effective hypovolemia, it is reasonable to treat benazepril overdose by infusion of normal saline solution.
| |
| | |
| If ingestion is recent, activated charcoal should be considered. Gastric decontamination (e.g., vomiting, gastric lavage) may be considered in individual cases, in the early period after ingestion.
| |
| | |
| Patients should be closely monitored for blood pressure and clinical symptoms. Supportive management should be employed to ensure adequate hydration and to maintain systemic blood pressure.
| |
| | |
| In the case of marked hypotension, physiological saline solution should be administered intravenously; depending on the clinical situation the use of vasopressors (e.g., catecholamines i.v.) may be considered.
| |
| | |
| ===Chronic Overdose===
| |
| | |
| ====Signs and Symptoms====
| |
| | |
| FDA Package Insert for {{PAGENAME}} contains no information regarding ''Chronic Overdose''.
| |
| | |
| ====Management====
| |
| | |
| FDA Package Insert for {{PAGENAME}} contains no information regarding ''Chronic Overdose''.
| |
| | |
| ==Pharmacology==
| |
| | |
| {{Drugbox2
| |
| | verifiedrevid = 459529583
| |
| | IUPAC_name = 2-[(3''S'')-3-{[(2''S'')-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino}-
| |
| | image = Benazepril structure.png
| |
| | |
| <!--Clinical data-->
| |
| | tradename = Lotensin
| |
| | MedlinePlus = a692011
| |
| | pregnancy_category = D
| |
| | legal_status = Rx-only
| |
| | routes_of_administration = Oral
| |
| | |
| <!--Pharmacokinetic data-->
| |
| | bioavailability =
| |
| | protein_bound = 96.7%
| |
| | metabolism = [[Liver|Hepatic]] [[glucuronidation]]
| |
| | elimination_half-life = 10-11 hours
| |
| | excretion = [[Kidney|Renal]] and biliary
| |
| | |
| <!--Identifiers-->
| |
| | CASNo_Ref = {{cascite|correct|CAS}}
| |
| | CAS_number_Ref = {{cascite|correct|??}}
| |
| | CAS_number = 86541-75-5
| |
| | ATC_prefix = C09
| |
| | ATC_suffix = AA07
| |
| | PubChem = 5362124
| |
| | DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| |
| | DrugBank = DB00542
| |
| | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| |
| | ChemSpiderID = 4514935
| |
| | UNII_Ref = {{fdacite|correct|FDA}}
| |
| | UNII = UDM7Q7QWP8
| |
| | ChEBI_Ref = {{ebicite|correct|EBI}}
| |
| | ChEBI = 3011
| |
| | ChEMBL_Ref = {{ebicite|correct|EBI}}
| |
| | ChEMBL = 838
| |
| | |
| <!--Chemical data-->
| |
| | C=24 | H=28 | N=2 | O=5
| |
| | molecular_weight = 424.49 g/mol
| |
| | smiles = O=C(OCC)[C@@H](N[C@@H]2C(=O)N(c1ccccc1CC2)CC(=O)O)CCc3ccccc3
| |
| | InChI = 1/C24H28N2O5/c1-2-31-24(30)20(14-12-17-8-4-3-5-9-17)25-19-15-13-18-10-6-7-11-21(18)26(23(19)29)16-22(27)28/h3-11,19-20,25H,2,12-16H2,1H3,(H,27,28)/t19-,20-/m0/s1
| |
| | InChIKey = XPCFTKFZXHTYIP-PMACEKPBBT
| |
| | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| |
| | StdInChI = 1S/C24H28N2O5/c1-2-31-24(30)20(14-12-17-8-4-3-5-9-17)25-19-15-13-18-10-6-7-11-21(18)26(23(19)29)16-22(27)28/h3-11,19-20,25H,2,12-16H2,1H3,(H,27,28)/t19-,20-/m0/s1
| |
| | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| |
| | StdInChIKey = XPCFTKFZXHTYIP-PMACEKPBSA-N
| |
| }}
| |
| | |
| ===Mechanism of Action===
| |
| | |
| Benazepril and benazeprilat inhibit [[angiotensin-converting enzyme]] ([[ACE]]) in human subjects and animals. [[ACE]] is a peptidyl dipeptidase that catalyzes the conversion of [[angiotensin I]] to the vasoconstrictor substance, [[angiotensin II]]. Angiotensin II also stimulates [[aldosterone]] secretion by the [[adrenal cortex]]. | |
| | |
| Inhibition of ACE results in decreased plasma angiotensin II, which leads to decreased vasopressor activity and to decreased [[aldosterone]] secretion. The latter decrease may result in a small increase of serum [[potassium]]. [[Hypertensive]] patients treated with Lotensin alone for up to 52 weeks had elevations of serum [[potassium]] of up to 0.2 mEq/L. Similar patients treated with Lotensin and [[hydrochlorothiazide]] for up to 24 weeks had no consistent changes in their serum potassium (see PRECAUTIONS).
| |
| | |
| Removal of [[angiotensin II]] negative feedback on [[renin]] secretion leads to increased plasma [[renin]] activity. In animal studies, benazepril had no inhibitory effect on the vasopressor response to [[angiotensin II]] and did not interfere with the hemodynamic effects of the autonomic [[neurotransmitters]] [[acetylcholine]], [[epinephrine]], and [[norepinephrine]].
| |
| ACE is identical to [[kininase]], an enzyme that degrades [[bradykinin]]. Whether increased levels of [[bradykinin]], a potent vasodepressor peptide, play a role in the therapeutic effects of Lotensin remains to be elucidated.
| |
| | |
| While the mechanism through which benazepril lowers [[blood pressure]] is believed to be primarily suppression of the [[renin-angiotensin-aldosterone system]], benazepril has an [[antihypertensive]] effect even in patients with low-renin [[hypertension]] (see INDICATIONS AND USAGE).
| |
| | |
| ===Structure===
| |
| | |
| Benazepril hydrochloride is a white to off-white crystalline powder, soluble (>100 mg/mL) in water, in ethanol, and in methanol. Its chemical name is benazepril 3-[[1-(ethoxy-carbonyl)-3-phenyl-(1S)-propyl]amino]-2,3,4,5-tetrahydro-2-oxo-1H-1-(3S)-benzazepine-1-acetic acid monohydrochloride; its structural formula is
| |
| | |
| {|
| |
| | [[File:Lotensin tablet structure.jpeg|thumb|400px]]
| |
| |}
| |
| | |
| Its empirical formula is C24H28N2O5•HCl, and its molecular weight is 460.96.
| |
| | |
| Benazeprilat, the active metabolite of benazepril, is a non-sulfhydryl angiotensin-converting enzyme inhibitor. Benazepril is converted to benazeprilat by hepatic cleavage of the ester group.
| |
| | |
| Lotensin is supplied as tablets containing 5 mg, 10 mg, 20 mg, and 40 mg of benazepril hydrochloride for oral administration. The inactive ingredients are colloidal silicon dioxide, crospovidone, hydrogenated castor oil (5-mg, 10-mg, and 20-mg tablets), hypromellose, iron oxides, lactose, magnesium stearate (40-mg tablets), microcrystalline cellulose, polysorbate 80, propylene glycol (5-mg and 40-mg tablets), starch, talc, and titanium dioxide.
| |
| | |
| ===Pharmacodynamics===
| |
| | |
| Single and multiple doses of 10 mg or more of Lotensin cause inhibition of plasma ACE activity by at least 80%-90% for at least 24 hours after dosing. Pressor responses to exogenous angiotensin I were inhibited by 60%-90% (up to 4 hours post-dose) at the 10-mg dose.
| |
| | |
| ===Pharmacokinetics===
| |
| | |
| Following oral administration of Lotensin, peak plasma concentrations of benazepril are reached within 0.5-1.0 hours. The extent of absorption is at least 37% as determined by urinary recovery and is not significantly influenced by the presence of food in the GI tract.
| |
| | |
| Cleavage of the ester group (primarily in the liver) converts benazepril to its active metabolite, benazeprilat. Peak plasma concentrations of benazeprilat are reached 1-2 hours after drug intake in the fasting state and 2-4 hours after drug intake in the nonfasting state. The serum protein binding of benazepril is about 96.7% and that of benazeprilat about 95.3%, as measured by equilibrium dialysis; on the basis of in vitro studies, the degree of protein binding should be unaffected by age, [[hepatic dysfunction]], or concentration (over the concentration range of 0.24-23.6 µmol/L).
| |
| | |
| Benazepril is almost completely metabolized to benazeprilat, which has much greater [[ACE]] inhibitory activity than benazepril, and to the [[glucuronide]] conjugates of benazepril and benazeprilat. Only trace amounts of an administered dose of Lotensin can be recovered in the urine as unchanged benazepril, while about 20% of the dose is excreted as benazeprilat, 4% as benazepril glucuronide, and 8% as benazeprilat glucuronide.
| |
| | |
| The kinetics of benazepril are approximately dose-proportional within the dosage range of 10-80 mg.
| |
| | |
| In adults, the effective half-life of accumulation of benazeprilat following multiple dosing of benazepril hydrochloride is 10-11 hours. Thus, steady-state concentrations of benazeprilat should be reached after 2 or 3 doses of benazepril hydrochloride given once daily.
| |
| | |
| The kinetics did not change, and there was no significant accumulation during chronic administration (28 days) of once-daily doses between 5 mg and 20 mg. Accumulation ratios based on AUC and urinary recovery of benazeprilat were 1.19 and 1.27, respectively.
| |
| | |
| Benazepril and benazeprilat are cleared predominantly by renal excretion in healthy subjects with normal renal function. Nonrenal (i.e., biliary) excretion accounts for approximately 11%-12% of benazeprilat excretion in healthy subjects. In patients with [[renal failure]], biliary clearance may compensate to an extent for deficient [[renal clearance]].
| |
| | |
| In patients with [[renal insufficiency]], the disposition of benazepril and benazeprilat in patients with mild-to-moderate [[renal insufficiency]] ([[creatinine clearance]] >30 mL/min) is similar to that in patients with normal renal function. In patients with [[creatinine clearance]] ≤30 mL/min, peak benazeprilat levels and the initial (alpha phase) half-life increase, and time to steady state may be delayed (see DOSAGE AND ADMINISTRATION).
| |
| | |
| When dialysis was started 2 hours after ingestion of 10 mg of benazepril, approximately 6% of benazeprilat was removed in 4 hours of dialysis. The parent compound, benazepril, was not detected in the dialysate.
| |
| | |
| In patients with [[hepatic insufficiency]] (due to [[cirrhosis]]), the pharmacokinetics of benazeprilat are essentially unaltered. The pharmacokinetics of benazepril and benazeprilat do not appear to be influenced by age.
| |
| | |
| In pediatric patients, (N=45) hypertensive, age 6 to 16 years, given multiple daily doses of Lotensin (0.1 to 0.5 mg/kg), the clearance of benazeprilat for children 6 to 12 years old was 0.35 L/hr/kg, more than twice that of healthy adults receiving a single dose of 10 mg (0.13 L/hr/kg). In adolescents, it was 0.17 L/hr/kg, 27% higher than that of healthy adults. The terminal elimination half-life of benazeprilat in pediatric patients was around 5 hours, one-third that observed in adults.
| |
| | |
| ===Nonclinical Toxicology===
| |
| | |
| FDA Package Insert for {{PAGENAME}} contains no information regarding ''Nonclinical Toxicology''.
| |
| | |
| | |
| ==Clinical Studies==
| |
| | |
| =====Hypertension=====
| |
| | |
| ======Adult======
| |
| | |
| In single-dose studies, Lotensin lowered blood pressure within 1 hour, with peak reductions achieved 2-4 hours after dosing. The antihypertensive effect of a single dose persisted for 24 hours. In multiple-dose studies, once-daily doses of 20-80 mg decreased seated pressure (systolic/diastolic) 24 hours after dosing by about 6-12/4-7 mmHg. The trough values represent reductions of about 50% of that seen at peak.
| |
| | |
| Four dose-response studies using once-daily dosing were conducted in 470 mild-to-moderate hypertensive patients not using diuretics. The minimal effective once-daily dose of Lotensin was 10 mg; but further falls in blood pressure, especially at morning trough, were seen with higher doses in the studied dosing range (10-80 mg). In studies comparing the same daily dose of Lotensin given as a single morning dose or as a twice-daily dose, blood pressure reductions at the time of morning trough blood levels were greater with the divided regimen.
| |
| | |
| The antihypertensive effects of Lotensin were not appreciably different in patients receiving high- or low-sodium diets.
| |
| | |
| In normal human volunteers, single doses of benazepril caused an increase in renal blood flow but had no effect on glomerular filtration rate.
| |
| Use of Lotensin in combination with thiazide diuretics gives a blood-pressure-lowering effect greater than that seen with either agent alone. By blocking the renin-angiotensin-aldosterone axis, administration of Lotensin tends to reduce the potassium loss associated with the diuretic.
| |
| | |
| ======Pediatric======
| |
| | |
| In a clinical study of 107 pediatric patients, 7 to 16 years of age, with either systolic or diastolic pressure above the 95th percentile, patients were given 0.1 or 0.2 mg/kg then titrated up to 0.3 or 0.6 mg/kg with a maximum dose of 40 mg once daily. After four weeks of treatment, the 85 patients whose blood pressure was reduced on therapy were then randomized to either placebo or benazepril and were followed up for an additional two weeks. At the end of two weeks, blood pressure (both systolic and diastolic) in children withdrawn to placebo rose by 4 to 6 mmHg more than in children on benazepril. No dose-response was observed for the three doses.
| |
| | |
| ==How Supplied==
| |
| | |
| Lotensin is available in tablets of 5 mg, 10 mg, 20 mg, and 40 mg, packaged with a desiccant in bottles of 100 tablets.
| |
| | |
| Each tablet is imprinted with LOTENSIN on one side and the tablet strength (“5,” “10,” “20,” or “40”) on the other.
| |
| | |
| * National Drug Code (NDC):
| |
| | |
| put table here
| |
| | |
| * Storage: Do not store above 30°C (86°F). Protect from moisture. Dispense in tight container (USP).
| |
| * Manufactured by: Novartis Pharmaceuticals Corporation, Suffern, New York 10901
| |
| * Distributed by: Novartis Pharmaceuticals Corporation, East Hanover, New Jersey 07936
| |
| | |
| ==Images==
| |
| | |
| ===Drug Images===
| |
| | |
| {|
| |
| | [[File:Lotensin tablet 5 mg.jpg|thumb|400px]]
| |
| |}
| |
| | |
| {|
| |
| | [[File:Lotensin tablet 10 mg.jpg|thumb|400px]]
| |
| |}
| |
| | |
| {|
| |
| | [[File:Lotensin tablet 20 mg.jpg|thumb|400px]]
| |
| |}
| |
| | |
| {|
| |
| | [[File:Lotensin tablet 40 mg.jpg|thumb|400px]]
| |
| |}
| |
| | |
| ===Package and Label Display Panel===
| |
| | |
| {|
| |
| | [[File:Lotensin tablet 5 mg package.jpeg|thumb|400px]]
| |
| |}
| |
| | |
| {|
| |
| | [[File:Lotensin tablet 10 mg package.jpeg|thumb|400px]]
| |
| |}
| |
| | |
| {|
| |
| | [[File:Lotensin tablet 20 mg package.jpeg|thumb|400px]]
| |
| |}
| |
| | |
| {|
| |
| | [[File:Lotensin tablet 40 mg package.jpeg|thumb|400px]]
| |
| |}
| |
| | |
| {|
| |
| | [[File:Lotensin tablet 5mg Display Panel.png|thumb|400px]]
| |
| |}
| |
| | |
| {|
| |
| | [[File:Lotensin tablet 10 mg Display Panel.png|thumb|400px]]
| |
| |}
| |
| | |
| {|
| |
| | [[File:Lotensin tablet 20 mg Display Panel.png|thumb|400px]]
| |
| |}
| |
| | |
| {|
| |
| | [[File:Lotensin tablet 40 mg Display Panel.png|thumb|400px]]
| |
| |}
| |
| | |
| ==Patient Information==
| |
| | |
| ===Patient Information from FDA===
| |
| | |
| '''[[Pregnancy]]''': Female patients of childbearing age should be told about the consequences of exposure to [[Lotensin]] during pregnancy. Discuss treatment options with women planning to become pregnant. Patients should be asked to report pregnancies to their physicians as soon as possible.
| |
| | |
| '''[[Angioedema]]''': Angioedema, including laryngeal edema, can occur at any time with treatment with ACE inhibitors. Patients should be so advised and told to report immediately any signs or symptoms suggesting angioedema (swelling of face, eyes, lips, or tongue, or difficulty in breathing) and to take no more drug until they have consulted with the prescribing physician.
| |
| | |
| '''Symptomatic [[Hypotension]]''': Patients should be cautioned that lightheadedness can occur, especially during the first days of therapy, and it should be reported to the prescribing physician. Patients should be told that if syncope occurs, Lotensin should be discontinued until the prescribing physician has been consulted.
| |
| | |
| All patients should be cautioned that inadequate fluid intake or excessive perspiration, diarrhea, or vomiting can lead to an excessive fall in blood pressure, with the same consequences of lightheadedness and possible syncope.
| |
| | |
| '''[[Hyperkalemia]]''': Patients should be told not to use potassium supplements or salt substitutes containing potassium without consulting the prescribing physician.
| |
| | |
| '''[[Neutropenia]]''': Patients should be told to promptly report any indication of infection (e.g., sore throat, fever), which could be a sign of neutropenia.
| |
| | |
| ===Patient Information from NLM===
| |
| | |
| For patient information about benazepril from NLM, click [[Benazepril (patient information)|here]].
| |
| | |
| ==Precautions with Alcohol==
| |
| | |
| Alcohol-{{PAGENAME}} interaction has not been established. Talk to your doctor about the effects of taking alcohol with this medication.
| |
| | |
| ==Look-Alike Drug Names==
| |
| | |
| There are no look-alike drug names published in the ISMP Medication Safety Alert.<ref name="www.ismp.org">{{Cite web | last = | first = | title = https://www.ismp.org | url = https://www.ismp.org | publisher = | date = | accessdate = }}</ref>
| |
| | |
| ==[http://www.fda.gov/drugs/drugsafety/drugshortages/ucm050792.htm Drug Shortage Status]==
| |
| | |
| ==[http://www.goodrx.com/{{urlencode:{{#if:{{{1|}}}|{{{1}}}|{{PAGENAME}}}}}}/price Price]==
| |
| | |
| ==References==
| |
| | |
| {{reflist}}
| |
| | |
| </div>
| |