Line 1:
Line 1: {{DISPLAYTITLE:Flutemetamol (<sup>18</sup>F)}}
[[File :Flutemetamol Info .png|right |300px ]]
{{Infobox drug new
| drug_name = Flutemetamol (<sup>18</sup>F)
| IUPAC_name = 2-[3-(<sup>18</sup>F)Fluoro-4-(methylamino)phenyl]-1,3-benzothiazol-6-ol
| image = Flutemetamol wiki str.png
| alt =
| caption =
<!-- Clinical data -->
| tradename = Vizamyl
| Drugs.com = {{Drugs.com|CONS|flutemetamol-f-18-intravenous}}
| MedlinePlus =
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = C
| pregnancy_category=
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_CA = <!-- OTC, Rx-only, Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL, P, POM, CD, CD Lic, CD POM, CD No Reg POM, CD (Benz) POM, CD (Anab) POM or CD Inv POM -->
| legal_US = Rx-only
| legal_status =
| routes_of_administration = [[Intravenous]]
<!-- Pharmacokinetic data -->
| bioavailability =
| protein_bound =
| metabolism =
| onset =
| elimination_half-life =
| excretion =
<!-- Identifiers -->
| CAS_number =
| ATCvet =
| ATC_prefix = V09
| ATC_suffix = AX04
| PubChem = 15950376
| DrugBank =
| ChemSpiderID = 13092196
| UNII = 0F3M7032P5
| ChEBI = 76611
<!-- Chemical data -->
| chemical_formula = C<sub>14</sub>H<sub>11</sub><sup>18</sup>FN<sub>2</sub>OS
| molecular_weight = 273.316 g/mol
| smiles = CNC1=C(C=C(C=C1)C2=NC3=C(S2)C=C(C=C3)O)[18F]
| StdInChI=1S/C14H11FN2OS/c1-16-11-4-2-8(6-10(11)15)14-17-12-5-3-9(18)7-13(12)19-14/h2-7,16,18H,1H3/i15-1
| StdInChIKey = VVECGOCJFKTUAX-HUYCHCPVSA-N
}}
__NOTOC__
__NOTOC__
{{SI}}
{{SI}}
Editor-In-Chief: C. Michael Gibson, M.S., M.D. [1]
Overview Flutemetamol (18 F) (trade name Vizamyl , by GE Healthcare ) is a PET scanning radiopharmaceutical containing the radionuclide fluorine-18 , used as a diagnostic tool for Alzheimer's disease .[ 1]
Mechanism of action After the substance is given intravenously , it accumulates in beta amyloid plaques in the patient's brain, which thus become visible via positron emission tomography (PET).[ 1]
References
↑ 1.0 1.1 H. Spreitzer (18 August 2014). "Neue Wirkstoffe – Flutemetamol". Österreichische Apothekerzeitung (in German) (17/2014): 43.
Template:Diagnostic radiopharmaceuticals
Template:Pharma-stub
