Fenbufen: Difference between revisions

Jump to navigation Jump to search
Newer edit →
VisualWikitext
WikiBot (talk | contribs)
Bots, Bureaucrats, bureaucrats, interwiki, nocaptcha, Administrators
57,550 edits
m Protected "Fenbufen": Protecting pages from unwanted edits ([edit=sysop] (indefinite) [move=sysop] (indefinite))
 
Turky Alkathery (talk | contribs)
CMEUser, nocaptcha, Administrators
6,562 edits
No edit summary
Line 1: Line 1:
{{drugbox
{{Drugbox
| IUPAC_name = gamma-Oxo-(1,1'-biphenyl)-4-butanoic Acid
| verifiedrevid = 443753907
| IUPAC_name = 4-(4-Biphenylyl)-4-oxobutanoic acid<br>or<br>4-Oxo-4-(4-phenylphenyl)butanoic acid
| image = Fenbufen.svg
| image = Fenbufen.svg
| CAS_number = 36330-85-5
| image2 = Fenbufen-from-xtal-1988-3D-balls.png
| ATC_prefix =
 
| ATC_suffix =
<!--Clinical data-->
| ATC_supplemental =
| tradename =
| PubChem =
| Drugs.com = {{drugs.com|international|fenbufen}}
| DrugBank =
| pregnancy_category =
| C = 16 |H = 14 |O = 3
| legal_status = POM
| molecular_weight =  
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| pregnancy_category =  
| legal_status =  
| routes_of_administration = Oral
| routes_of_administration = Oral
<!--Pharmacokinetic data-->
| bioavailability = 
| protein_bound = 
| metabolism = 
| elimination_half-life = 
| excretion =
<!--Identifiers-->
| CAS_number = 36330-85-5
| ATC_prefix = M01
| ATC_suffix = AE05
| ATC_supplemental = 
| PubChem = 3335
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB08981
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 3218
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 9815R1WR9B
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D01344
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 31599
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 277522
<!--Chemical data-->
| C=16 | H=14 | O=3
| molecular_weight = 254.2854
| smiles = O=C(O)CCC(=O)c2ccc(c1ccccc1)cc2
| InChI = 1/C16H14O3/c17-15(10-11-16(18)19)14-8-6-13(7-9-14)12-4-2-1-3-5-12/h1-9H,10-11H2,(H,18,19)
| InChIKey = ZPAKPRAICRBAOD-UHFFFAOYAO
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C16H14O3/c17-15(10-11-16(18)19)14-8-6-13(7-9-14)12-4-2-1-3-5-12/h1-9H,10-11H2,(H,18,19)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = ZPAKPRAICRBAOD-UHFFFAOYSA-N
}}
}}
'''Fenbufen''' is a [[non-steroidal anti-inflammatory drug]] used primarily to treat inflammation in [[osteoarthritis]], [[ankylosing spondylitis]], and [[tendinitis]]. It can also be used to relieve backaches, sprains, and fractures. Fenbufen is available as a capsule or tablet sold with the brand names '''Cepal''', '''Cinopal''', '''Cybufen''', '''Lederfen''', and '''Reugast'''. Fenbufen acts by preventing [[cyclooxygenase]] from producing the [[prostaglandin]]s that cause inflammation.
 
{{NSAIDs}}
'''Fenbufen''' is a [[non-steroidal anti-inflammatory drug]] used primarily to treat inflammation in [[osteoarthritis]], [[ankylosing spondylitis]], and [[tendinitis]]. It can also be used to relieve backaches, sprains, and fractures. Fenbufen is available as a capsule or tablet sold with the brand names '''Cepal''', '''Cinopal''', '''Cybufen''', '''Lederfen''', and '''Reugast'''. Fenbufen acts by preventing [[cyclooxygenase]] from producing [[prostaglandin]]s which can cause inflammation.
 
==Synthesis==
[[Image:Fenbufen synthesis.svg|thumb|center|700px|Fenbufen synthesis.<ref>http://drugsynthesis.blogspot.co.uk/2012/10/laboratory-synthesis-of-fenbufen.html</ref>]]
 
==References==
{{Reflist}}
{{Anti-inflammatory and antirheumatic products}}
{{Anti-inflammatory and antirheumatic products}}
{{pharma-stub}}


[[Category:Non-steroidal anti-inflammatory drugs]]
[[Category:Non-steroidal anti-inflammatory drugs]]
[[Category:Drugs]]
 
{{WikiDoc Sources}}
 
{{musculoskeletal-drug-stub}}

Revision as of 16:22, 11 April 2015

Fenbufen
File:Fenbufen.svg
Clinical data
AHFS/Drugs.comInternational Drug Names
Routes of
administration		Oral
ATC code
Legal status
Legal status
  • POM
Identifiers
CAS Number
PubChem CID
DrugBank
ChemSpider
UNII
KEGG
ChEBI
ChEMBL
E number{{#property:P628}}
ECHA InfoCard{{#property:P2566}}Lua error in Module:EditAtWikidata at line 36: attempt to index field 'wikibase' (a nil value).
Chemical and physical data
FormulaC16H14O3
Molar mass254.2854
3D model (JSmol)
  (verify)

Fenbufen is a non-steroidal anti-inflammatory drug used primarily to treat inflammation in osteoarthritis, ankylosing spondylitis, and tendinitis. It can also be used to relieve backaches, sprains, and fractures. Fenbufen is available as a capsule or tablet sold with the brand names Cepal, Cinopal, Cybufen, Lederfen, and Reugast. Fenbufen acts by preventing cyclooxygenase from producing prostaglandins which can cause inflammation.

Synthesis

File:Fenbufen synthesis.svg
Fenbufen synthesis.[1]

References

  1. ↑ http://drugsynthesis.blogspot.co.uk/2012/10/laboratory-synthesis-of-fenbufen.html


Template:Musculoskeletal-drug-stub

Retrieved from "https://www.wikidoc.org/index.php?title=Fenbufen&oldid=1086294"