Ethacridine lactate: Difference between revisions
m Protected "Ethacridine lactate": Protecting pages from unwanted edits ([edit=sysop] (indefinite) [move=sysop] (indefinite)) |
Kiran Singh (talk | contribs) No edit summary |
||
Line 1: | Line 1: | ||
{{Drugbox | |||
| Verifiedfields = changed | |||
| verifiedrevid = 477162867 | |||
| IUPAC_name = 7-ethoxyacridine-3,9-diamine; 2-hydroxypropanoic acid | |||
| image =Ethacridinlactat.png | |||
| alt = Skeletal formulas of ethacridine lactate | |||
| image2 = Ethacridine lactate 3D spacefill.png | |||
| alt2 = Ball-and-stick models of the component ions of ethacridine lactate | |||
<!--Clinical data--> | |||
| tradename = | |||
| Drugs.com = {{drugs.com|international|ethacridine-lactate}} | |||
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | |||
| pregnancy_US = <!-- A / B / C / D / X --> | |||
| pregnancy_category = | |||
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> | |||
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> | |||
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> | |||
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> | |||
| legal_status = | |||
| routes_of_administration = | |||
<!--Pharmacokinetic data--> | |||
| bioavailability = | |||
| protein_bound = | |||
| metabolism = | |||
| elimination_half-life = | |||
| excretion = | |||
<!--Identifiers--> | |||
| CAS_number_Ref = {{cascite|changed|??}} | |||
| CAS_number = 1837-57-6 | |||
| ATCvet = | |||
| ATC_prefix = B05 | |||
| ATC_suffix = CA08 | |||
| ATC_supplemental = {{ATC|D08|AA01}} | |||
| PubChem = 15789 | |||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} | |||
| DrugBank = | |||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | |||
| ChemSpiderID = 15012 | |||
| KEGG_Ref = {{keggcite|correct|kegg}} | |||
| KEGG = D01248 | |||
| ChEMBL_Ref = {{ebicite|correct|EBI}} | |||
| ChEMBL = 582355 | |||
<!--Chemical data--> | |||
| C=18 | H=21 | N=3 | O=4 | |||
| molecular_weight = 343.37 | |||
| smiles = O=C(O)C(O)C.O(c2ccc1nc3c(c(c1c2)N)ccc(c3)N)CC | |||
| InChI = 1/C15H15N3O.C3H6O3/c1-2-19-10-4-6-13-12(8-10)15(17)11-5-3-9(16)7-14(11)18-13;1-2(4)3(5)6/h3-8H,2,16H2,1H3,(H2,17,18);2,4H,1H3,(H,5,6) | |||
| InChIKey = IYLLULUTZPKQBW-UHFFFAOYAM | |||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | |||
| StdInChI = 1S/C15H15N3O.C3H6O3/c1-2-19-10-4-6-13-12(8-10)15(17)11-5-3-9(16)7-14(11)18-13;1-2(4)3(5)6/h3-8H,2,16H2,1H3,(H2,17,18);2,4H,1H3,(H,5,6) | |||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | |||
| StdInChIKey = IYLLULUTZPKQBW-UHFFFAOYSA-N | |||
}} | |||
__Notoc__ | |||
{{SI}} | |||
{{CMG}} | |||
==Overview== | |||
'''Ethacridine lactate''' is an [[aromatic]] [[organic compound]] based on [[acridine]]. Synonyms include acrinol, rivanol and ethacridine monolactate monohydrate. Its formal name is 2-ethoxy-6,9-diaminoacridine monolactate monohydrate. It forms orange-yellow crystals with a melting point of 226 °C and it has a stinging smell. | '''Ethacridine lactate''' is an [[aromatic]] [[organic compound]] based on [[acridine]]. Synonyms include acrinol, rivanol and ethacridine monolactate monohydrate. Its formal name is 2-ethoxy-6,9-diaminoacridine monolactate monohydrate. It forms orange-yellow crystals with a melting point of 226 °C and it has a stinging smell. | ||
Its primary use is as an [[antiseptic]] in solutions of 0.1%. | Its primary use is as an [[antiseptic]] in solutions of 0.1%. |
Revision as of 14:25, 10 April 2015
Clinical data | |
---|---|
AHFS/Drugs.com | International Drug Names |
ATC code | |
Identifiers | |
| |
CAS Number | |
PubChem CID | |
ChemSpider | |
KEGG | |
ChEMBL | |
E number | {{#property:P628}} |
ECHA InfoCard | {{#property:P2566}}Lua error in Module:EditAtWikidata at line 36: attempt to index field 'wikibase' (a nil value). |
Chemical and physical data | |
Formula | C18H21N3O4 |
Molar mass | 343.37 |
3D model (JSmol) | |
| |
| |
(what is this?) (verify) |
Editor-In-Chief: C. Michael Gibson, M.S., M.D. [1]
Overview
Ethacridine lactate is an aromatic organic compound based on acridine. Synonyms include acrinol, rivanol and ethacridine monolactate monohydrate. Its formal name is 2-ethoxy-6,9-diaminoacridine monolactate monohydrate. It forms orange-yellow crystals with a melting point of 226 °C and it has a stinging smell.
Its primary use is as an antiseptic in solutions of 0.1%.
Ethacridine is also used as an agent for second trimester abortion. Up to 150 ml of a 0.1% solution is instilled extra-amniotically using a foley catheter. After 20 to 40 hours, 'mini labor' ensues. In China, an intra-amniotic method has also been used. Ethacridine as an abortifacient is found to be safer and better tolerated than 20% hypertonic saline.
References
- Obstetrics & Gynecology 1983;61:733-736
- Merck Index, 11th Ed., 3668.
External links
- Pages with script errors
- Template:drugs.com link with non-standard subpage
- Articles with changed CASNo identifier
- E number from Wikidata
- ECHA InfoCard ID from Wikidata
- Chemical articles with unknown parameter in Infobox drug
- Chemical pages without DrugBank identifier
- Articles without UNII source
- Drugs with no legal status
- Drugboxes which contain changes to verified fields
- Antiseptics
- Aromatic compounds