Thiethylperazine: Difference between revisions
m Protected "Thiethylperazine": Protecting pages from unwanted edits ([edit=sysop] (indefinite) [move=sysop] (indefinite)) |
No edit summary |
||
Line 1: | Line 1: | ||
{{ | {{Drugbox | ||
| IUPAC_name = 2- | | verifiedrevid = 470606662 | ||
| image = Thiethylperazine | | IUPAC_name = 2-(ethylthio)-10-[3-(4-methylpiperazin-1-yl)propyl]-10''H''-phenothiazine | ||
| image = Thiethylperazine.png | |||
<!--Clinical data--> | |||
| tradename = | |||
| Drugs.com = {{drugs.com|CONS|thiethylperazine}} | |||
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | |||
| pregnancy_US = <!-- A / B / C / D / X --> | |||
| pregnancy_category = | |||
| legal_AU = <!-- Unscheduled / S2 / S4 / S8 --> | |||
| legal_UK = <!-- GSL / P / POM / CD --> | |||
| legal_US = <!-- OTC / Rx-only --> | |||
| legal_status = | |||
| routes_of_administration = | |||
<!--Pharmacokinetic data--> | |||
| bioavailability = | |||
| protein_bound = 60% | |||
| metabolism = | |||
| elimination_half-life = | |||
| excretion = | |||
<!--Identifiers--> | |||
| CASNo_Ref = {{cascite|correct|CAS}} | |||
| CAS_number_Ref = {{cascite|correct|??}} | |||
| CAS_number = 1420-55-9 | | CAS_number = 1420-55-9 | ||
| ATC_prefix = R06 | | ATC_prefix = R06 | ||
| ATC_suffix = AD03 | | ATC_suffix = AD03 | ||
| ATC_supplemental = | | ATC_supplemental = | ||
| PubChem = 5440 | | PubChem = 5440 | ||
| DrugBank = | | DrugBank_Ref = {{drugbankcite|correct|drugbank}} | ||
| C=22 | H=29 | N=3 | S=2 | | DrugBank = DB00372 | ||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | |||
| ChemSpiderID = 5245 | |||
| UNII_Ref = {{fdacite|correct|FDA}} | |||
| UNII = 8ETK1WAF6R | |||
| KEGG_Ref = {{keggcite|correct|kegg}} | |||
| KEGG = D02354 | |||
| ChEBI_Ref = {{ebicite|correct|EBI}} | |||
| ChEBI = 9544 | |||
| ChEMBL_Ref = {{ebicite|correct|EBI}} | |||
| ChEMBL = 1378 | |||
<!--Chemical data--> | |||
| C=22 | H=29 | N=3 | S=2 | |||
| molecular_weight = 399.618 g/mol | | molecular_weight = 399.618 g/mol | ||
| | | smiles = S(c2cc1N(c3c(Sc1cc2)cccc3)CCCN4CCN(C)CC4)CC | ||
| | | InChI = 1/C22H29N3S2/c1-3-26-18-9-10-22-20(17-18)25(19-7-4-5-8-21(19)27-22)12-6-11-24-15-13-23(2)14-16-24/h4-5,7-10,17H,3,6,11-16H2,1-2H3 | ||
| | | InChIKey = XCTYLCDETUVOIP-UHFFFAOYAY | ||
| | | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | ||
| | | StdInChI = 1S/C22H29N3S2/c1-3-26-18-9-10-22-20(17-18)25(19-7-4-5-8-21(19)27-22)12-6-11-24-15-13-23(2)14-16-24/h4-5,7-10,17H,3,6,11-16H2,1-2H3 | ||
| | | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | ||
| StdInChIKey = XCTYLCDETUVOIP-UHFFFAOYSA-N | |||
| | |||
| | |||
}} | }} | ||
__NOTOC__ | |||
{{SI}} | |||
[[ | {{CMG}} | ||
[[ | |||
==Overview== | |||
'''Thiethylperazine''' ('''Torecan''') is an [[antiemetic]] of the [[phenothiazine]] class. Though it was never licensed or used as an [[antipsychotic]], it may have such effects. | |||
Thiethylperazine activates the transport protein [[ABCC1]] that clears [[beta-amyloid]] from brains of mice. | |||
==References== | |||
{{reflist|2}} | |||
{{Antiemetics}} | |||
{{Antipsychotics}} | |||
{{Antihistamines}} | |||
{{ | {{Dopaminergics}} | ||
{{Piperazines}} | |||
{{Tricyclics}} | |||
[[ | [[Category:Piperazines]] | ||
[[Category:Phenothiazines]] | |||
[[Category:Thioethers]] | |||
[[Category:Drug]] |
Revision as of 17:29, 10 April 2015
![]() | |
Clinical data | |
---|---|
AHFS/Drugs.com | Micromedex Detailed Consumer Information |
ATC code | |
Pharmacokinetic data | |
Protein binding | 60% |
Identifiers | |
| |
CAS Number | |
PubChem CID | |
DrugBank | |
ChemSpider | |
UNII | |
KEGG | |
ChEBI | |
ChEMBL | |
E number | {{#property:P628}} |
ECHA InfoCard | {{#property:P2566}}Lua error in Module:EditAtWikidata at line 36: attempt to index field 'wikibase' (a nil value). |
Chemical and physical data | |
Formula | C22H29N3S2 |
Molar mass | 399.618 g/mol |
3D model (JSmol) | |
| |
| |
(verify) |
WikiDoc Resources for Thiethylperazine |
Articles |
---|
Most recent articles on Thiethylperazine Most cited articles on Thiethylperazine |
Media |
Powerpoint slides on Thiethylperazine |
Evidence Based Medicine |
Clinical Trials |
Ongoing Trials on Thiethylperazine at Clinical Trials.gov Trial results on Thiethylperazine Clinical Trials on Thiethylperazine at Google
|
Guidelines / Policies / Govt |
US National Guidelines Clearinghouse on Thiethylperazine NICE Guidance on Thiethylperazine
|
Books |
News |
Commentary |
Definitions |
Patient Resources / Community |
Patient resources on Thiethylperazine Discussion groups on Thiethylperazine Patient Handouts on Thiethylperazine Directions to Hospitals Treating Thiethylperazine Risk calculators and risk factors for Thiethylperazine
|
Healthcare Provider Resources |
Causes & Risk Factors for Thiethylperazine |
Continuing Medical Education (CME) |
International |
|
Business |
Experimental / Informatics |
Editor-In-Chief: C. Michael Gibson, M.S., M.D. [1]
Overview
Thiethylperazine (Torecan) is an antiemetic of the phenothiazine class. Though it was never licensed or used as an antipsychotic, it may have such effects.
Thiethylperazine activates the transport protein ABCC1 that clears beta-amyloid from brains of mice.