Diiodotyrosine: Difference between revisions

Jump to navigation Jump to search
← Older editNewer edit →
VisualWikitext
WikiBot (talk | contribs)
Bots, Bureaucrats, bureaucrats, interwiki, nocaptcha, Administrators
57,550 edits
m Bot: Automated text replacement (-{{SIB}} + & -{{EH}} + & -{{EJ}} + & -{{Editor Help}} + & -{{Editor Join}} +)
Turky Alkathery (talk | contribs)
CMEUser, nocaptcha, Administrators
6,562 edits
No edit summary
Line 1: Line 1:
{{Chembox new
{{Chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 443688991
| ImageFile = Diiodotyrosine.png
| ImageFile = Diiodotyrosine.png
| ImageSize =  
| ImageSize =  
| IUPACName =  
| IUPACName =  
| OtherNames =  
| OtherNames =  
| Section1 = {{Chembox Identifiers
|Section1={{Chembox Identifiers
|   CASNo = 66-02-4
| CASNo_Ref = {{cascite|correct|??}}
|   PubChem = 6181
| CASNo = 66-02-4
|   SMILES =  
| PubChem = 6181
|   MeSHName = Diiodotyrosine
| UNII_Ref = {{fdacite|correct|FDA}}
  }}
| UNII = 6L57Q44ZWW
| Section2 = {{Chembox Properties
| PubChem2 = 7058163
|   Formula = C<sub>9</sub>H<sub>9</sub>I<sub>2</sub>NO<sub>3</sub>
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
|   MolarMass = 432.982 g/mol
| ChemSpiderID = 8946
|   Appearance =  
| SMILES = Ic1cc(cc(I)c1O)C[C@@H](C(=O)O)N
|   Density =  
| InChI = 1/C9H9I2NO3/c10-5-1-4(2-6(11)8(5)13)3-7(12)9(14)15/h1-2,7,13H,3,12H2,(H,14,15)/t7-/m0/s1
|   MeltingPt =  
| InChIKey = NYPYHUZRZVSYKL-ZETCQYMHBZ
|   BoilingPt =  
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
  }}
| StdInChI = 1S/C9H9I2NO3/c10-5-1-4(2-6(11)8(5)13)3-7(12)9(14)15/h1-2,7,13H,3,12H2,(H,14,15)/t7-/m0/s1
| Section3 = {{Chembox Hazards
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
|   Solubility =  
| StdInChIKey = NYPYHUZRZVSYKL-ZETCQYMHSA-N
|   MainHazards =  
| MeSHName = Diiodotyrosine
|   FlashPt =  
}}
|   Autoignition =  
|Section2={{Chembox Properties
  }}
| Formula = C<sub>9</sub>H<sub>9</sub>I<sub>2</sub>NO<sub>3</sub>
| MolarMass = 432.982 g/mol
| Appearance =  
| Density =  
| MeltingPt =  
| BoilingPt =  
}}
|Section3={{Chembox Hazards
| Solubility =  
| MainHazards =  
| FlashPt =  
| AutoignitionPt =
}}
}}
}}
{{SI}}
'''Diiodotyrosine''' (DIT) is a precursor in the production of [[thyroid hormone]], and results from iodization of [[monoiodotyrosine]] at the other [[Meta- (chemistry)|meta-]] position on the [[phenol]] ring.
__NOTOC__


==Function==
DIT is a modulator of the enzyme [[thyroid peroxidase]] (which is involved in the production of thyroid hormones).<ref name="pmid1149735">{{cite journal |author=Dème D, Fimiani E, Pommier J, Nunez J |title=Free diiodotyrosine effects on protein iodination and thyroid hormone synthesis catalyzed by thyroid peroxidase |journal=Eur. J. Biochem. |volume=51 |issue=2 |pages=329–36 |date=February 1975 |pmid=1149735 |doi= 10.1111/j.1432-1033.1975.tb03932.x|url=http://www3.interscience.wiley.com/resolve/openurl?genre=article&sid=nlm:pubmed&issn=0014-2956&date=1975&volume=51&issue=2&spage=329}}</ref> 


'''Diiodotyrosine''' is a precursor of [[thyroid hormone]].
[[Triiodothyronine]] is formed, when diiodotyrosine is combined with [[monoiodotyrosine]] (in the [[Colloid (thyroid)|colloid]] of the [[thyroid follicle]]).
 
Two molecules of DIT combine to make the thyroid hormone [[thyroxine]] ('T4' and 'T3').
 
==See also==
* [[Diiodotyrosine transaminase]]
 
==References==
{{reflist}}


==External links==
==External links==
* {{ATC|H03|BX01}}
* {{ATC|H03|BX01}}


{{Thyroid therapy}}
{{Thyroid therapy}}
{{Thyroid hormone intermediates}}
[[Category:Iodinated tyrosine derivatives]]
[[Category:Iodinated tyrosine derivatives]]
[[Category:Endocrinology]]


[[de:Diiodtyrosin]]


{{WikiDoc Help Menu}}
{{organohalide-stub}}
{{WikiDoc Sources}}

Revision as of 18:33, 9 April 2015

Template:Chembox E number
Diiodotyrosine
Identifiers
3D model (JSmol)
ChemSpider
ECHA InfoCard Lua error in Module:Wikidata at line 879: attempt to index field 'wikibase' (a nil value). Lua error in Module:Wikidata at line 879: attempt to index field 'wikibase' (a nil value).
MeSH Diiodotyrosine
UNII
Properties
C9H9I2NO3
Molar mass 432.982 g/mol
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
☒N verify (what is ☑Y☒N ?)
Infobox references

Diiodotyrosine (DIT) is a precursor in the production of thyroid hormone, and results from iodization of monoiodotyrosine at the other meta- position on the phenol ring.

Function

DIT is a modulator of the enzyme thyroid peroxidase (which is involved in the production of thyroid hormones).[1]

Triiodothyronine is formed, when diiodotyrosine is combined with monoiodotyrosine (in the colloid of the thyroid follicle).

Two molecules of DIT combine to make the thyroid hormone thyroxine ('T4' and 'T3').

See also

References

  1. ↑ Dème D, Fimiani E, Pommier J, Nunez J (February 1975). "Free diiodotyrosine effects on protein iodination and thyroid hormone synthesis catalyzed by thyroid peroxidase". Eur. J. Biochem. 51 (2): 329–36. doi:10.1111/j.1432-1033.1975.tb03932.x. PMID 1149735.

External links

Template:Thyroid therapy Template:Thyroid hormone intermediates


Template:Organohalide-stub

Retrieved from "https://www.wikidoc.org/index.php?title=Diiodotyrosine&oldid=1085558"