Mizolastine: Difference between revisions

Jump to navigation Jump to search
WikiBot (talk | contribs)
m Robot: Automated text replacement (-{{SIB}} + & -{{EH}} + & -{{EJ}} + & -{{Editor Help}} + & -{{Editor Join}} +)
Turky Alkathery (talk | contribs)
No edit summary
Line 1: Line 1:
{{Drugbox
{{Drugbox
| IUPAC_name       = 2-[ [1-[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]piperidin-4-yl]-methylamino]-3H-pyrimidin-4-one
| Verifiedfields = changed
| image             =
| Watchedfields = changed
| CAS_number       =  
| verifiedrevid = 449584902
| ATC_prefix       = R06
| IUPAC_name = 2-[{1-[1-(4-fluorobenzyl)-1''H''-benzimidazol-2-yl]piperidin-4-yl}(methyl)amino]pyrimidin-4(1''H'')-one
| ATC_suffix       = AX25  
| image = mizolastine.png
| PubChem           = 65906
 
| DrugBank          =  
<!--Clinical data-->
| C=24|H=25|F=1|N=6|O=1
| tradename = 
| molecular_weight = 432.493 g/mol
| Drugs.com = {{drugs.com|international|mizolastine}}
| bioavailability  =  
| pregnancy_category = 
| protein_bound    =  
| legal_status = POM
| metabolism        =  
| routes_of_administration = Oral
| elimination_half-life =  
 
| excretion        =  
<!--Pharmacokinetic data-->
| pregnancy_AU      = <!-- A / B1 / B2 / B3 / C / D / X -->
| bioavailability = 
| pregnancy_US      =  <!-- A / B            / C / D / X -->
| protein_bound = 
| pregnancy_category= 
| metabolism = 
| legal_AU          =  <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| elimination_half-life = 
| legal_CA          =  <!--             / Schedule I, II, III, IV, V, VI, VII, VIII -->
| excretion = 
| legal_UK         = <!-- GSL        / P      / POM / CD / Class A, B, C -->
 
| legal_US          =  <!-- OTC                  / Rx-only  / Schedule I, II, III, IV, V -->
<!--Identifiers-->
| legal_status      =  
| CAS_number_Ref = {{cascite|correct|??}}
| routes_of_administration =  
| CAS_number = 108612-45-9
| ATC_prefix = R06
| ATC_suffix = AX25
| PubChem = 65906
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 244O1F90NA
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D01117
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 94454
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID      = 59315
 
 
<!--Chemical data-->
| C=24 | H=25 | F=1 | N=6 | O=1  
| molecular_weight = 432.493 g/mol
| smiles            = CN(C1CCN(CC1)C2=NC3=CC=CC=C3N2CC4=CC=C(C=C4)F)C5=NC=CC(=O)N5
| InChI            = 1/C24H25FN6O/c1-29(23-26-13-10-22(32)28-23)19-11-14-30(15-12-19)24-27-20-4-2-3-5-21(20)31(24)16-17-6-8-18(25)9-7-17/h2-10,13,19H,11-12,14-16H2,1H3,(H,26,28,32)
| InChIKey          = PVLJETXTTWAYEW-UHFFFAOYAR
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI         = 1S/C24H25FN6O/c1-29(23-26-13-10-22(32)28-23)19-11-14-30(15-12-19)24-27-20-4-2-3-5-21(20)31(24)16-17-6-8-18(25)9-7-17/h2-10,13,19H,11-12,14-16H2,1H3,(H,26,28,32)
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey      = PVLJETXTTWAYEW-UHFFFAOYSA-N
}}
}}
{{SI}}


'''Mizolastine''' ('''Mizollen''') is a once daily, non-sedating [[antihistamine]]. It blocks [[H1 receptor|H<sub>1</sub> receptor]]s and is commonly fast-acting. It does not prevent the actual release of histamine from mast cells, just prevents it binding to receptors. Side effects can include dry mouth and throat.<ref>{{Cite web
| title = MIZOLASTINE: British National Formulary
| accessdate = 2010-02-01
| url = http://bnf.org/bnf/bnf/58/68614.htm
}}</ref>


==Overview==
== References ==
'''Mizolastine''' is an [[antihistamine]].
{{Reflist|2}}


{{Antihistamines}}
{{Antihistamines}}
{{Histaminergics}}


[[Category:Benzimidazoles]]
[[Category:Benzimidazoles]]
[[Category:Piperidines]]
[[Category:Piperidines]]
[[Category:H1 receptor antagonists]]
[[Category:Organofluorides]]
[[Category:Pyrimidones]]


{{WH}}
{{respiratory-system-drug-stub}}
{{WikiDoc Sources}}

Revision as of 14:53, 13 April 2015

Mizolastine
Clinical data
AHFS/Drugs.comInternational Drug Names
Routes of
administration
Oral
ATC code
Legal status
Legal status
  • POM
Identifiers
CAS Number
PubChem CID
ChemSpider
UNII
KEGG
ChEMBL
E number{{#property:P628}}
ECHA InfoCard{{#property:P2566}}Lua error in Module:EditAtWikidata at line 36: attempt to index field 'wikibase' (a nil value).
Chemical and physical data
FormulaC24H25FN6O
Molar mass432.493 g/mol
3D model (JSmol)
 ☒N☑Y (what is this?)  (verify)

Mizolastine (Mizollen) is a once daily, non-sedating antihistamine. It blocks H1 receptors and is commonly fast-acting. It does not prevent the actual release of histamine from mast cells, just prevents it binding to receptors. Side effects can include dry mouth and throat.[1]

References

  1. "MIZOLASTINE: British National Formulary". Retrieved 2010-02-01.


Template:Respiratory-system-drug-stub