Tymazoline: Difference between revisions
Jump to navigation
Jump to search
m Robot: Automated text replacement (-{{SIB}} +, -{{EH}} +, -{{EJ}} +, -{{Editor Help}} +, -{{Editor Join}} +) |
No edit summary |
||
Line 1: | Line 1: | ||
{{Drugbox | {{Drugbox | ||
| IUPAC_name | | Verifiedfields = changed | ||
| image | | Watchedfields = changed | ||
| | | verifiedrevid = 470619043 | ||
| | | IUPAC_name = 2-[(5-methyl-2-propan-2-ylphenoxy)methyl]-4,5-dihydro-1H-imidazole | ||
| | | image = Tymazoline.png | ||
| | |||
| | <!--Clinical data--> | ||
| | | tradename = Thymazen | ||
| | | Drugs.com = {{drugs.com|international|tymazoline}} | ||
| | | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | ||
| bioavailability | | pregnancy_US = <!-- A / B / C / D / X --> | ||
| protein_bound | | pregnancy_category = | ||
| metabolism | | legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> | ||
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> | |||
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> | |||
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> | |||
| legal_status = | |||
| routes_of_administration = Nasal | |||
<!--Pharmacokinetic data--> | |||
| bioavailability = | |||
| protein_bound = | |||
| metabolism = | |||
| elimination_half-life = | | elimination_half-life = | ||
| excretion | | excretion = | ||
| | <!--Identifiers--> | ||
| | | CAS_number_Ref = {{cascite|changed|??}} | ||
| | | CAS_number = 24243-97-8 | ||
| ATC_prefix = R01 | |||
| ATC_suffix = AA13 | |||
| PubChem = 34154 | |||
| | | DrugBank_Ref = {{drugbankcite|correct|drugbank}} | ||
| | | DrugBank = DB08803 | ||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | |||
| ChemSpiderID = 31478 | |||
| UNII_Ref = {{fdacite|correct|FDA}} | |||
| UNII = U993RH5585 | |||
| KEGG_Ref = {{keggcite|changed|kegg}} | |||
| KEGG = D07373 | |||
<!--Chemical data--> | |||
| chemical_formula = | |||
| C=14 | H=20 | N=2 | O=1 | |||
| molecular_weight = 232.321 g/mol | |||
| smiles = Cc1ccc(c2c1cccc2OCC3=NCCN3)C(C)C | |||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | |||
| StdInChI = 1S/C14H20N2O/c1-10(2)12-5-4-11(3)8-13(12)17-9-14-15-6-7-16-14/h4-5,8,10H,6-7,9H2,1-3H3,(H,15,16) | |||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | |||
| StdInChIKey = QRORCRWSRPKEHR-UHFFFAOYSA-N | |||
}} | }} | ||
'''Tymazoline''' (trade name '''Thymazen''' in Poland) is a nasal [[decongestant]] that can be used to treat [[rhinitis]]. It acts as an [[antihistaminic]] and [[sympathomimetic]], reducing swelling, inflammation and mucosal secretions.<ref>[[Drugs.com]]: [http://www.drugs.com/international/tymazoline.html Tymazoline]</ref><ref>[[DrugBank]]: [http://www.drugbank.ca/drugs/DB08803 Tymazoline]</ref> | |||
==References== | |||
{{reflist}} | |||
{{Nasal preparations}} | {{Nasal preparations}} | ||
[[Category:Imidazolines]] | [[Category:Imidazolines]] | ||
[[Category:Phenol ethers]] | |||
{{ | {{respiratory-system-drug-stub}} | ||
Revision as of 13:57, 14 April 2015
![]() | |
Clinical data | |
---|---|
Trade names | Thymazen |
AHFS/Drugs.com | International Drug Names |
Routes of administration | Nasal |
ATC code | |
Identifiers | |
| |
CAS Number | |
PubChem CID | |
DrugBank | |
ChemSpider | |
UNII | |
KEGG | |
E number | {{#property:P628}} |
ECHA InfoCard | {{#property:P2566}}Lua error in Module:EditAtWikidata at line 36: attempt to index field 'wikibase' (a nil value). |
Chemical and physical data | |
Formula | C14H20N2O |
Molar mass | 232.321 g/mol |
3D model (JSmol) | |
| |
| |
|
Tymazoline (trade name Thymazen in Poland) is a nasal decongestant that can be used to treat rhinitis. It acts as an antihistaminic and sympathomimetic, reducing swelling, inflammation and mucosal secretions.[1][2]
References
Categories:
- Pages with script errors
- Template:drugs.com link with non-standard subpage
- Articles with changed CASNo identifier
- Articles with changed KEGG identifier
- E number from Wikidata
- ECHA InfoCard ID from Wikidata
- Articles without EBI source
- Drugs with no legal status
- Drugboxes which contain changes to verified fields
- Drugboxes which contain changes to watched fields
- Imidazolines
- Phenol ethers