|
|
| Line 1: |
Line 1: |
| {{Drugbox
| |
| | Verifiedfields = changed
| |
| | Watchedfields = changed
| |
| | verifiedrevid = 443228756
| |
| | IUPAC_name = (1''S'',2''S'',3''R'',5''S'')-3-[7-[(1''R'',2''S'')-2-(3,4-Difluorophenyl)cyclopropylamino]-5-(propylthio)- 3H-[1,2,3]triazolo[4,5-d]pyrimidin-3-yl]-5-(2-hydroxyethoxy)cyclopentane-1,2-diol
| |
| | image = Ticagrelor 01.png
| |
| | width = 300
| |
| | image2 = Ticagrelor 18.gif
| |
| | width = 300
| |
|
| |
| <!--Clinical data-->
| |
| | tradename = Brilinta, Brilique, Possia
| |
| | MedlinePlus = a611050
| |
| | licence_EU = Brilique
| |
| | licence_US = Ticagrelor
| |
| | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| |
| | pregnancy_US = C
| |
| | pregnancy_category =
| |
| | legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| |
| | legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| |
| | legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| |
| | legal_US = Rx-only
| |
| | legal_status =
| |
| | routes_of_administration = Oral
| |
|
| |
| <!--Pharmacokinetic data-->
| |
| | bioavailability = 36%
| |
| | protein_bound = >99.7%
| |
| | metabolism = [[Hepatic]] ([[CYP3A4]])
| |
| | elimination_half-life = 7 hrs (ticagrelor), 8.5 hrs ([[active metabolite]] AR-C124910XX)
| |
| | excretion = [[Biliary]]
| |
|
| |
| <!--Identifiers-->
| |
| | CAS_number_Ref = {{cascite|correct|??}}
| |
| | CAS_number = 274693-27-5
| |
| | ATC_prefix = B01
| |
| | ATC_suffix = AC24
| |
| | ATC_supplemental =
| |
| | PubChem = 9871419
| |
| | DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| |
| | DrugBank =
| |
| | UNII_Ref = {{fdacite|correct|FDA}}
| |
| | UNII = GLH0314RVC
| |
| | KEGG_Ref = {{keggcite|correct|kegg}}
| |
| | KEGG = D09017
| |
| | ChEMBL_Ref = {{ebicite|changed|EBI}}
| |
| | ChEMBL = 398435
| |
|
| |
| <!--Chemical data-->
| |
| | chemical_formula =
| |
| | C=23 | H=28 | F=2 | N=6 | O=4 | S=1
| |
| | molecular_weight = 522.567 g/mol
| |
| | smiles = CCCSC1=NC(=C2C(=N1)N(N=N2)[C@@H]3C[C@@H]([C@H]([C@H]3O)O)OCCO)N[C@@H]4C[C@H]4C5=CC(=C(C=C5)F)F
| |
| | StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| |
| | StdInChI = 1S/C23H28F2N6O4S/c1-2-7-36-23-27-21(26-15-9-12(15)11-3-4-13(24)14(25)8-11)18-22(28-23)31(30-29-18)16-10-17(35-6-5-32)20(34)19(16)33/h3-4,8,12,15-17,19-20,32-34H,2,5-7,9-10H2,1H3,(H,26,27,28)/t12-,15+,16+,17-,19-,20+/m0/s1
| |
| | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| |
| | StdInChIKey = OEKWJQXRCDYSHL-FNOIDJSQSA-N
| |
| | ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| |
| | ChemSpiderID = 8047109
| |
| | InChI = 1/C23H28F2N6O4S/c1-2-7-36-23-27-21(26-15-9-12(15)11-3-4-13(24)14(25)8-11)18-22(28-23)31(30-29-18)16-10-17(35-6-5-32)20(34)19(16)33/h3-4,8,12,15-17,19-20,32-34H,2,5-7,9-10H2,1H3,(H,26,27,28)/t12-,15+,16+,17-,19-,20+/m0/s1
| |
| | InChIKey = OEKWJQXRCDYSHL-FNOIDJSQBW
| |
| | synonyms = AZD-6140
| |
| }}
| |
|
| |
| __NOEDITSECTION____NOTOC__ | | __NOEDITSECTION____NOTOC__ |
| {{CMG}} {{AE}}{{JH}} | | {{CMG}} {{AE}}{{JH}} |
Editor-In-Chief: C. Michael Gibson, M.S., M.D. [1] Associate Editor(s)-in-Chief: Jesus Rosario Hernandez, M.D. [2]
Synonyms / Brand Names: Brilinta
Overview
Ticagrelor (trade name Brilinta in the US, Brilique and Possia in the EU) is a platelet aggregation inhibitor produced by AstraZeneca. The drug was approved for use in the European Union by the European Commission on December 3, 2010.[1][2] The drug was approved by the US Food and Drug Administration on July 20, 2011.[3]
Category
P2Y12 platelet inhibitor, platelet aggregation inhibitor
Prescribing Information
References