Clofenamide: Difference between revisions
m Bot: Automated text replacement (-{{SIB}} + & -{{EH}} + & -{{EJ}} + & -{{Editor Help}} + & -{{Editor Join}} +) |
No edit summary |
||
Line 1: | Line 1: | ||
{{Drugbox | {{Drugbox | ||
| | | verifiedrevid = 437148976 | ||
| | | IUPAC_name = 4-chlorobenzene-1,3-disulfonamide | ||
| image = Clofenamide.png | |||
| alt = Skeletal formula of clofenamide | |||
| image2 = Clofenamide-3D-spacefill.png | |||
| alt2 = Ball-and-stick model of clofenamide | |||
| width = 180 | |||
| | |||
| | |||
| | |||
| | |||
| | |||
<!--Clinical data--> | |||
| tradename = | |||
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | |||
| pregnancy_US = <!-- A / B / C / D / X --> | |||
| pregnancy_category = | |||
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> | |||
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> | |||
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> | |||
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> | |||
| legal_status = | |||
| routes_of_administration = | |||
<!--Pharmacokinetic data--> | |||
| bioavailability = | |||
| protein_bound = | |||
| metabolism = | |||
| elimination_half-life = | |||
| excretion = | |||
<!--Identifiers--> | |||
| CAS_number = 671-95-4 | |||
| ATC_prefix = C03 | |||
| ATC_suffix = BA07 | |||
| PubChem = 69594 | |||
| ChEMBL = 1865258 | |||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} | |||
| DrugBank = | |||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | |||
| ChemSpiderID = 62797 | |||
| UNII_Ref = {{fdacite|correct|FDA}} | |||
| UNII = 582ILN204B | |||
| KEGG_Ref = {{keggcite|correct|kegg}} | |||
| KEGG = D01822 | |||
<!--Chemical data--> | |||
| C=6 | H=7 | Cl=1 | N=2 | O=4 | S=2 | |||
| molecular_weight = 270.714 g/mol | |||
| smiles = O=S(=O)(c1cc(ccc1Cl)S(=O)(=O)N)N | |||
| InChI = 1/C6H7ClN2O4S2/c7-5-2-1-4(14(8,10)11)3-6(5)15(9,12)13/h1-3H,(H2,8,10,11)(H2,9,12,13) | |||
| InChIKey = NENBAISIHCWPKP-UHFFFAOYAB | |||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | |||
| StdInChI = 1S/C6H7ClN2O4S2/c7-5-2-1-4(14(8,10)11)3-6(5)15(9,12)13/h1-3H,(H2,8,10,11)(H2,9,12,13) | |||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | |||
| StdInChIKey = NENBAISIHCWPKP-UHFFFAOYSA-N | |||
}} | |||
__NOTOC__ | |||
{{SI}} | |||
{{CMG}} | |||
==Overview== | |||
[[ | '''Clofenamide''' (or '''diumide''') is a [[diuretic#Low ceiling diuretics|low-ceiling]] [[sulfonamide (medicine)|sulfonamide]] [[diuretic]]. | ||
{{ | ==References== | ||
{{reflist|2}} | |||
[[Category:Diuretics]] | |||
[[Category:Sulfonamides]] | |||
[[Category:Cardiovascular Drugs]] | |||
[[Category:Drug]] |
Revision as of 01:15, 25 July 2014
Clinical data | |
---|---|
ATC code | |
Identifiers | |
| |
CAS Number | |
PubChem CID | |
ChemSpider | |
UNII | |
KEGG | |
ChEMBL | |
E number | {{#property:P628}} |
ECHA InfoCard | {{#property:P2566}}Lua error in Module:EditAtWikidata at line 36: attempt to index field 'wikibase' (a nil value). |
Chemical and physical data | |
Formula | C6H7ClN2O4S2 |
Molar mass | 270.714 g/mol |
3D model (JSmol) | |
| |
| |
(verify) |
WikiDoc Resources for Clofenamide |
Articles |
---|
Most recent articles on Clofenamide Most cited articles on Clofenamide |
Media |
Powerpoint slides on Clofenamide |
Evidence Based Medicine |
Clinical Trials |
Ongoing Trials on Clofenamide at Clinical Trials.gov Clinical Trials on Clofenamide at Google
|
Guidelines / Policies / Govt |
US National Guidelines Clearinghouse on Clofenamide
|
Books |
News |
Commentary |
Definitions |
Patient Resources / Community |
Patient resources on Clofenamide Discussion groups on Clofenamide Patient Handouts on Clofenamide Directions to Hospitals Treating Clofenamide Risk calculators and risk factors for Clofenamide
|
Healthcare Provider Resources |
Causes & Risk Factors for Clofenamide |
Continuing Medical Education (CME) |
International |
|
Business |
Experimental / Informatics |
Editor-In-Chief: C. Michael Gibson, M.S., M.D. [1]
Overview
Clofenamide (or diumide) is a low-ceiling sulfonamide diuretic.