Troleandomycin: Difference between revisions
Jump to navigation
Jump to search
Gerald Chi (talk | contribs) mNo edit summary |
No edit summary |
||
Line 1: | Line 1: | ||
{{Drugbox | |||
| Verifiedfields = changed | |||
| verifiedrevid = 470617807 | |||
| IUPAC_name = (3''R'',5''R'',6''R'',7''S'',8''R'',11''R'',12''S'',13''R'',14''S'',15''S'')-12-[(4-''O''-acetyl-2,6-dideoxy-3-''O''-methyl-α-<small>L</small>-''arabino''-hexopyranosyl)oxy]-14-{[2-''O''-acetyl-3,4,6-trideoxy-3-(dimethylamino)-β-<small>D</small>-''xylo''-hexopyranosyl]oxy}-5,7,8,11,13,15-hexamethyl-4,10-dioxo-1,9-dioxaspiro[2.13]hexadec-6-yl acetate | |||
| image = troleandomycin.png | |||
<!--Clinical data--> | |||
| tradename = | |||
| Drugs.com = {{drugs.com|MTM|troleandomycin}} | |||
| MedlinePlus = a604026 | |||
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | |||
| pregnancy_US = <!-- A / B / C / D / X --> | |||
| pregnancy_category = | |||
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> | |||
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> | |||
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> | |||
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> | |||
| legal_status = | |||
| routes_of_administration = | |||
<!--Pharmacokinetic data--> | |||
| bioavailability = | |||
| protein_bound = | |||
| metabolism = | |||
| elimination_half-life = | |||
| excretion = | |||
<!--Identifiers--> | |||
| CAS_number_Ref = {{cascite|correct|??}} | |||
| CAS_number = 2751-09-9 | |||
| ATC_prefix = J01 | |||
| ATC_suffix = FA08 | |||
| PubChem = 5284630 | |||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} | |||
| DrugBank = DB01361 | |||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | |||
| ChemSpiderID = 4447675 | |||
| UNII_Ref = {{fdacite|correct|FDA}} | |||
| UNII = C4DZ64560D | |||
| KEGG_Ref = {{keggcite|changed|kegg}} | |||
| KEGG = D01322 | |||
| ChEMBL_Ref = {{ebicite|changed|EBI}} | |||
| ChEMBL = 564085 | |||
<!--Chemical data--> | |||
| C=41 | H=67 | N=1 | O=15 | |||
| molecular_weight = 813.968 g/mol | |||
| smiles = O=C(O[C@@H]4[C@@H](N(C)C)C[C@H](O[C@H]4O[C@@H]3[C@H]([C@H](O[C@@H]1O[C@H]([C@H](OC(=O)C)[C@@H](OC)C1)C)[C@H](C(=O)O[C@H](C)[C@H](C)[C@H](OC(=O)C)[C@H](C(=O)[C@]2(OC2)C[C@@H]3C)C)C)C)C)C | |||
| InChI = 1/C41H67NO15/c1-19-17-41(18-49-41)38(46)23(5)34(53-27(9)43)21(3)25(7)52-39(47)24(6)35(56-32-16-31(48-14)36(26(8)51-32)54-28(10)44)22(4)33(19)57-40-37(55-29(11)45)30(42(12)13)15-20(2)50-40/h19-26,30-37,40H,15-18H2,1-14H3/t19-,20+,21-,22+,23+,24+,25+,26-,30-,31-,32-,33-,34-,35-,36-,37+,40-,41-/m0/s1 | |||
| InChIKey = LQCLVBQBTUVCEQ-MCQAQMIOBT | |||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | |||
| StdInChI = 1S/C41H67NO15/c1-19-17-41(18-49-41)38(46)23(5)34(53-27(9)43)21(3)25(7)52-39(47)24(6)35(56-32-16-31(48-14)36(26(8)51-32)54-28(10)44)22(4)33(19)57-40-37(55-29(11)45)30(42(12)13)15-20(2)50-40/h19-26,30-37,40H,15-18H2,1-14H3/t19-,20+,21-,22+,23+,24+,25+,26-,30-,31-,32-,33-,34-,35-,36-,37+,40-,41-/m0/s1 | |||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | |||
| StdInChIKey = LQCLVBQBTUVCEQ-MCQAQMIOSA-N | |||
}} | |||
'''Troleandomycin''' is a [[macrolide]] antibiotic. It is sold in [[Italy]] (branded '''Triocetin''') and [[Turkey]] (branded '''Tekmisin'''). | |||
Troleandomycin is a [[CYP3A4]] [[enzyme inhibitor|inhibitor]] that may cause [[drug interaction]]s. | |||
{{Macrolides, lincosamides and streptogramins}} | |||
[[Category:Macrolide antibiotics]] | |||
{{antibiotic-stub}} |
Revision as of 13:27, 9 April 2015
Clinical data | |
---|---|
AHFS/Drugs.com | Multum Consumer Information |
MedlinePlus | a604026 |
ATC code | |
Identifiers | |
| |
CAS Number | |
PubChem CID | |
DrugBank | |
ChemSpider | |
UNII | |
KEGG | |
ChEMBL | |
E number | {{#property:P628}} |
ECHA InfoCard | {{#property:P2566}}Lua error in Module:EditAtWikidata at line 36: attempt to index field 'wikibase' (a nil value). |
Chemical and physical data | |
Formula | C41H67NO15 |
Molar mass | 813.968 g/mol |
3D model (JSmol) | |
| |
| |
(what is this?) (verify) |
Troleandomycin is a macrolide antibiotic. It is sold in Italy (branded Triocetin) and Turkey (branded Tekmisin).
Troleandomycin is a CYP3A4 inhibitor that may cause drug interactions.
Categories:
- Pages with script errors
- Template:drugs.com link with non-standard subpage
- Articles with changed KEGG identifier
- Articles with changed EBI identifier
- E number from Wikidata
- ECHA InfoCard ID from Wikidata
- Chemical articles with unknown parameter in Infobox drug
- Drugs with no legal status
- Drugboxes which contain changes to verified fields
- Macrolide antibiotics