Pheneturide: Difference between revisions
Jump to navigation
Jump to search
m Protected "Pheneturide": Protecting pages from unwanted edits ([edit=sysop] (indefinite) [move=sysop] (indefinite)) |
No edit summary |
||
Line 1: | Line 1: | ||
{{ | {{Drugbox | ||
| Verifiedfields = changed | |||
| verifiedrevid = 464200183 | |||
| IUPAC_name = (''RS'')-''N''-carbamoyl-2-phenyl-butanamide | |||
| image = Pheneturide.svg | |||
| width = 250px | |||
| imagename = 1 : 1 mixture (racemate) | |||
| drug_name = Pheneturide | |||
{{ | <!--Clinical data--> | ||
| | | tradename = | ||
| | | Drugs.com = {{drugs.com|international|pheneturide}} | ||
| CAS_number=90-49-3 | | pregnancy_category = | ||
| ATC_prefix=N03 | | legal_status = | ||
| ATC_suffix=AX13 | | routes_of_administration = | ||
| | |||
| | <!--Pharmacokinetic data--> | ||
| | | bioavailability = | ||
| C = 11 | H = 14 | N = 2 | O = 2 | | metabolism = | ||
| excretion = | |||
<!--Identifiers--> | |||
| CAS_number_Ref = {{cascite|changed|??}} | |||
| CAS_number = 90-49-3 | |||
| ATC_prefix = N03 | |||
| ATC_suffix = AX13 | |||
| PubChem = 72060 | |||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} | |||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | |||
| ChemSpiderID = 65046 | |||
| UNII_Ref = {{fdacite|correct|FDA}} | |||
| UNII = 878CEJ4HGX | |||
| KEGG_Ref = {{keggcite|correct|kegg}} | |||
| KEGG = D01190 | |||
<!--Chemical data--> | |||
| C=11 | H=14 | N=2 | O=2 | |||
| molecular_weight = 206.241 g/mol | | molecular_weight = 206.241 g/mol | ||
| | | smiles = O=C(N)NC(=O)C(c1ccccc1)CC | ||
| | | InChI = 1/C11H14N2O2/c1-2-9(10(14)13-11(12)15)8-6-4-3-5-7-8/h3-7,9H,2H2,1H3,(H3,12,13,14,15) | ||
| | | InChIKey = AJOQSQHYDOFIOX-UHFFFAOYAE | ||
| | | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | ||
| | | StdInChI = 1S/C11H14N2O2/c1-2-9(10(14)13-11(12)15)8-6-4-3-5-7-8/h3-7,9H,2H2,1H3,(H3,12,13,14,15) | ||
| | | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | ||
| | | StdInChIKey = AJOQSQHYDOFIOX-UHFFFAOYSA-N | ||
}} | }} | ||
'''Pheneturide''' (or '''ethylphenacemide''') is an [[anticonvulsant]] medication. | '''Pheneturide''' (or '''ethylphenacemide''') is an [[anticonvulsant]] medication.<ref name="pmid10423278">{{cite journal |author=Byrne B, Rothchild R |title=1H NMR studies of drugs with achiral and chiral lanthanide shift reagents: applications to the anticonvulsant pheneturide |journal=Chirality |volume=11 |issue=7 |pages=529–35 |year=1999 |pmid=10423278 |doi=10.1002/(SICI)1520-636X(1999)11:7<529::AID-CHIR3>3.0.CO;2-K}}</ref> | ||
==References== | |||
{{Reflist}} | |||
{{Anticonvulsants}} | |||
[[Category:Ureas]] | |||
{{anticonvulsant-stub}} | {{anticonvulsant-stub}} |
Revision as of 14:35, 9 April 2015
File:Pheneturide.svg | |
Clinical data | |
---|---|
AHFS/Drugs.com | International Drug Names |
ATC code | |
Identifiers | |
| |
CAS Number | |
PubChem CID | |
ChemSpider | |
UNII | |
KEGG | |
E number | {{#property:P628}} |
ECHA InfoCard | {{#property:P2566}}Lua error in Module:EditAtWikidata at line 36: attempt to index field 'wikibase' (a nil value). |
Chemical and physical data | |
Formula | C11H14N2O2 |
Molar mass | 206.241 g/mol |
3D model (JSmol) | |
| |
| |
|
Pheneturide (or ethylphenacemide) is an anticonvulsant medication.[1]
References
- ↑ Byrne B, Rothchild R (1999). "1H NMR studies of drugs with achiral and chiral lanthanide shift reagents: applications to the anticonvulsant pheneturide". Chirality. 11 (7): 529–35. doi:10.1002/(SICI)1520-636X(1999)11:7<529::AID-CHIR3>3.0.CO;2-K. PMID 10423278.
Categories:
- Pages with script errors
- Pages with broken file links
- Template:drugs.com link with non-standard subpage
- Articles with changed CASNo identifier
- E number from Wikidata
- ECHA InfoCard ID from Wikidata
- Chemical articles with unknown parameter in Infobox drug
- Infobox drug articles with non-default infobox title
- Articles without EBI source
- Chemical pages without DrugBank identifier
- Drugs with no legal status
- Drugboxes which contain changes to verified fields
- Ureas
- Anticonvulsant stubs