Diiodotyrosine: Difference between revisions
Jump to navigation
Jump to search
m (Bot: Automated text replacement (-{{SIB}} + & -{{EH}} + & -{{EJ}} + & -{{Editor Help}} + & -{{Editor Join}} +)) |
No edit summary |
||
| Line 1: | Line 1: | ||
{{Chembox | {{Chembox | ||
| Verifiedfields = changed | |||
| Watchedfields = changed | |||
| verifiedrevid = 443688991 | |||
| ImageFile = Diiodotyrosine.png | | ImageFile = Diiodotyrosine.png | ||
| ImageSize = | | ImageSize = | ||
| IUPACName = | | IUPACName = | ||
| OtherNames = | | OtherNames = | ||
| Section1 = {{Chembox Identifiers | |Section1={{Chembox Identifiers | ||
| | | CASNo_Ref = {{cascite|correct|??}} | ||
| | | CASNo = 66-02-4 | ||
| | | PubChem = 6181 | ||
| | | UNII_Ref = {{fdacite|correct|FDA}} | ||
| UNII = 6L57Q44ZWW | |||
| Section2 = {{Chembox Properties | | PubChem2 = 7058163 | ||
| | | ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} | ||
| | | ChemSpiderID = 8946 | ||
| | | SMILES = Ic1cc(cc(I)c1O)C[C@@H](C(=O)O)N | ||
| | | InChI = 1/C9H9I2NO3/c10-5-1-4(2-6(11)8(5)13)3-7(12)9(14)15/h1-2,7,13H,3,12H2,(H,14,15)/t7-/m0/s1 | ||
| | | InChIKey = NYPYHUZRZVSYKL-ZETCQYMHBZ | ||
| | | StdInChI_Ref = {{stdinchicite|changed|chemspider}} | ||
| StdInChI = 1S/C9H9I2NO3/c10-5-1-4(2-6(11)8(5)13)3-7(12)9(14)15/h1-2,7,13H,3,12H2,(H,14,15)/t7-/m0/s1 | |||
| Section3 = {{Chembox Hazards | | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} | ||
| | | StdInChIKey = NYPYHUZRZVSYKL-ZETCQYMHSA-N | ||
| | | MeSHName = Diiodotyrosine | ||
| | }} | ||
| | |Section2={{Chembox Properties | ||
| Formula = C<sub>9</sub>H<sub>9</sub>I<sub>2</sub>NO<sub>3</sub> | |||
| MolarMass = 432.982 g/mol | |||
| Appearance = | |||
| Density = | |||
| MeltingPt = | |||
| BoilingPt = | |||
}} | |||
|Section3={{Chembox Hazards | |||
| Solubility = | |||
| MainHazards = | |||
| FlashPt = | |||
| AutoignitionPt = | |||
}} | |||
}} | }} | ||
'''Diiodotyrosine''' (DIT) is a precursor in the production of [[thyroid hormone]], and results from iodization of [[monoiodotyrosine]] at the other [[Meta- (chemistry)|meta-]] position on the [[phenol]] ring. | |||
==Function== | |||
DIT is a modulator of the enzyme [[thyroid peroxidase]] (which is involved in the production of thyroid hormones).<ref name="pmid1149735">{{cite journal |author=Dème D, Fimiani E, Pommier J, Nunez J |title=Free diiodotyrosine effects on protein iodination and thyroid hormone synthesis catalyzed by thyroid peroxidase |journal=Eur. J. Biochem. |volume=51 |issue=2 |pages=329–36 |date=February 1975 |pmid=1149735 |doi= 10.1111/j.1432-1033.1975.tb03932.x|url=http://www3.interscience.wiley.com/resolve/openurl?genre=article&sid=nlm:pubmed&issn=0014-2956&date=1975&volume=51&issue=2&spage=329}}</ref> | |||
[[Triiodothyronine]] is formed, when diiodotyrosine is combined with [[monoiodotyrosine]] (in the [[Colloid (thyroid)|colloid]] of the [[thyroid follicle]]). | |||
Two molecules of DIT combine to make the thyroid hormone [[thyroxine]] ('T4' and 'T3'). | |||
==See also== | |||
* [[Diiodotyrosine transaminase]] | |||
==References== | |||
{{reflist}} | |||
==External links== | ==External links== | ||
* {{ATC|H03|BX01}} | * {{ATC|H03|BX01}} | ||
{{Thyroid therapy}} | {{Thyroid therapy}} | ||
{{Thyroid hormone intermediates}} | |||
[[Category:Iodinated tyrosine derivatives]] | [[Category:Iodinated tyrosine derivatives]] | ||
{{ | {{organohalide-stub}} | ||
Revision as of 18:33, 9 April 2015
Template:Chembox E number
| |
| Identifiers | |
|---|---|
3D model (JSmol)
|
|
| ChemSpider | |
| ECHA InfoCard | Lua error in Module:Wikidata at line 879: attempt to index field 'wikibase' (a nil value). Lua error in Module:Wikidata at line 879: attempt to index field 'wikibase' (a nil value). |
| MeSH | Diiodotyrosine |
PubChem CID
|
|
| UNII | |
| |
| |
| Properties | |
| C9H9I2NO3 | |
| Molar mass | 432.982 g/mol |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). | |
 verify (what is  ?)
| |
| Infobox references | |
Diiodotyrosine (DIT) is a precursor in the production of thyroid hormone, and results from iodization of monoiodotyrosine at the other meta- position on the phenol ring.
Function
DIT is a modulator of the enzyme thyroid peroxidase (which is involved in the production of thyroid hormones).[1]
Triiodothyronine is formed, when diiodotyrosine is combined with monoiodotyrosine (in the colloid of the thyroid follicle).
Two molecules of DIT combine to make the thyroid hormone thyroxine ('T4' and 'T3').
See also
References
- ↑ Dème D, Fimiani E, Pommier J, Nunez J (February 1975). "Free diiodotyrosine effects on protein iodination and thyroid hormone synthesis catalyzed by thyroid peroxidase". Eur. J. Biochem. 51 (2): 329–36. doi:10.1111/j.1432-1033.1975.tb03932.x. PMID 1149735.
External links
Template:Thyroid therapy Template:Thyroid hormone intermediates
Categories:
- Pages with script errors
- CS1 maint: Multiple names: authors list
- Chemical articles with multiple compound IDs
- Multiple chemicals in an infobox that need indexing
- Chemical articles with multiple PubChem CIDs
- Articles without EBI source
- Articles without KEGG source
- Articles with changed ChemSpider identifier
- ECHA InfoCard ID from Wikidata
- Articles with changed InChI identifier
- Articles containing unverified chemical infoboxes
- Iodinated tyrosine derivatives