Cefapirin: Difference between revisions

Jump to navigation Jump to search
← Older editNewer edit →
VisualWikitext
WikiBot (talk | contribs)
Bots, Bureaucrats, bureaucrats, interwiki, nocaptcha, Administrators
57,550 edits
m Bot: Automated text replacement (-{{SIB}} + & -{{EH}} + & -{{EJ}} + & -{{Editor Help}} + & -{{Editor Join}} +)
Turky Alkathery (talk | contribs)
CMEUser, nocaptcha, Administrators
6,562 edits
No edit summary
Line 1: Line 1:
{{drugbox
{{Drugbox
| IUPAC_name = 4-(acetyloxymethyl)- 7-oxo-8-(2-pyridin-4-ylsulfanylacetyl) amino-2-thia-6-azabicyclo [ 4.2.0] oct-4-ene-5-carboxylic acid
| Watchedfields = changed
| verifiedrevid = 460022704
| IUPAC_name =
| image = Cefapirin.svg
| image = Cefapirin.svg
| CAS_number = 21593-23-7
 
| ATC_prefix = J01
<!--Clinical data-->
| ATC_suffix = DB08
| tradename =
| ATC_supplemental =
| Drugs.com = {{drugs.com|international|cefapirin}}
| PubChem = 30699
| MedlinePlus = a601206
| DrugBank = APRD00860
| C = 17 | H = 17 | N = 3 | O = 6 | S = 2
| molecular_weight = 423.466 g/mol
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =  
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = B
| pregnancy_US = B
| pregnancy_category =  
| pregnancy_category =
| legal_AU = <!-- Unscheduled / S2 / S4 / S8 -->
| legal_AU = <!-- Unscheduled / S2 / S4 / S8 -->
| legal_UK = <!-- GSL / P / POM / CD -->
| legal_UK = <!-- GSL / P / POM / CD -->
| legal_US = Rx-only
| legal_US = Rx-only
| legal_status =  
| legal_status =
| routes_of_administration = [[Intravenous therapy|Intravenous]], [[Intramuscular injection|intramuscular]]
| routes_of_administration = [[Intravenous therapy|Intravenous]], [[Intramuscular injection|intramuscular]]
<!--Pharmacokinetic data-->
| bioavailability = 
| protein_bound = 
| metabolism = 
| elimination_half-life = 
| excretion = 
<!--Identifiers-->
| CASNo_Ref = {{cascite|correct|CAS}}
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 21593-23-7
| ATC_prefix = J01
| ATC_suffix = DB08
| ATC_supplemental = {{ATCvet|G51|AA05}} {{ATCvet|J51|DB08}}
| PubChem = 30699
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB01139
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 28486
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 89B59H32VN
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D07636
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 554446
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 1599
<!--Chemical data-->
| C=17 | H=17 | N=3 | O=6 | S=2
| molecular_weight = 423.466 g/mol
| smiles = O=C2N1/C(=C(\CS[C@@H]1[C@@H]2NC(=O)CSc3ccncc3)COC(=O)C)C(=O)O
| InChI = 1/C17H17N3O6S2/c1-9(21)26-6-10-7-28-16-13(15(23)20(16)14(10)17(24)25)19-12(22)8-27-11-2-4-18-5-3-11/h2-5,13,16H,6-8H2,1H3,(H,19,22)(H,24,25)/t13-,16-/m1/s1
| InChIKey = UQLLWWBDSUHNEB-CZUORRHYBF
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C17H17N3O6S2/c1-9(21)26-6-10-7-28-16-13(15(23)20(16)14(10)17(24)25)19-12(22)8-27-11-2-4-18-5-3-11/h2-5,13,16H,6-8H2,1H3,(H,19,22)(H,24,25)/t13-,16-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = UQLLWWBDSUHNEB-CZUORRHYSA-N
}}
}}
{{SI}}
'''Cefapirin''' ([[International Nonproprietary Name|INN]], also spelled '''cephapirin''') is an injectable, first-generation [[cephalosporin]] [[antibiotic]]. It is marketed under the trade name Cefadyl. Production for use in humans has been discontinued in the United States.<ref>http://www.accessdata.fda.gov/scripts/cder/drugsatfda/index.cfm?fuseaction=Search.Overview&DrugName=CEFADYL</ref>
 


'''Cefapirin''' ([[International Nonproprietary Name|INN]], also spelled '''cephapirin''') is a first-generation [[cephalosporin]] [[antibiotic]]. It is marketed under the trade name '''Cefadyl'''.
It also has a role in [[veterinary medicine]] as Metricure, an intrauterine preparation, and combined with [[prednisolone]] in Mastiplan, an intramammary preparation. Both are licenced in [[cattle]].


This is also used on monkeys to make their fur turn hot pink. It was once used on a monkey named Zoe and she got pink polka dots all over her fur. People are still unsure about what causes this odd reaction in monkeys, but there is extensive research being done about this phenomenon.
==References==
{{reflist}}


{{CephalosporinAntiBiotics}}
{{CephalosporinAntiBiotics}}


[[Category:Cephalosporin antibiotics]]
[[Category:Enantiopure drugs]]
[[Category:Pyridines]]
[[Category:Acetate esters]]


[[pt:Cefapirina]]
{{antibiotic-stub}}
[[th:เซฟาพิริน]]
[[Category:Cephalosporin antibiotics]]
{{WikiDoc Help Menu}}
{{WS}}

Revision as of 12:54, 10 April 2015

Cefapirin
File:Cefapirin.svg
Clinical data
AHFS/Drugs.comInternational Drug Names
MedlinePlusa601206
Pregnancy
category
  • US: B (No risk in non-human studies)
Routes of
administration		Intravenous, intramuscular
ATC code
Legal status
Legal status
Identifiers
CAS Number
PubChem CID
DrugBank
ChemSpider
UNII
KEGG
ChEBI
ChEMBL
E number{{#property:P628}}
ECHA InfoCard{{#property:P2566}}Lua error in Module:EditAtWikidata at line 36: attempt to index field 'wikibase' (a nil value).
Chemical and physical data
FormulaC17H17N3O6S2
Molar mass423.466 g/mol
3D model (JSmol)
  (verify)

Cefapirin (INN, also spelled cephapirin) is an injectable, first-generation cephalosporin antibiotic. It is marketed under the trade name Cefadyl. Production for use in humans has been discontinued in the United States.[1]

It also has a role in veterinary medicine as Metricure, an intrauterine preparation, and combined with prednisolone in Mastiplan, an intramammary preparation. Both are licenced in cattle.

References

  1. ↑ http://www.accessdata.fda.gov/scripts/cder/drugsatfda/index.cfm?fuseaction=Search.Overview&DrugName=CEFADYL

Template:Antibiotic-stub

Retrieved from "https://www.wikidoc.org/index.php?title=Cefapirin&oldid=1085705"