Azlocillin: Difference between revisions
Jump to navigation
Jump to search
m Bot: Automated text replacement (-{{SIB}} + & -{{EH}} + & -{{EJ}} + & -{{Editor Help}} + & -{{Editor Join}} +) |
No edit summary |
||
Line 1: | Line 1: | ||
{{ | |||
| IUPAC_name = 3,3-dimethyl- | |||
| image = Azlocillin. | {{Drugbox | ||
| verifiedrevid = 458972860 | |||
| IUPAC_name = (2''S'',5''R'',6''R'')-3,3-dimethyl-7-oxo-6-{[(2''R'')-2-{[(2-oxoimidazolidin-1-yl)carbonyl]amino}-2-phenylacetyl]amino}-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid | |||
| image = Azlocillin skeletal.svg | |||
<!--Clinical data--> | |||
| tradename = | |||
| Drugs.com = {{drugs.com|international|azlocillin}} | |||
<!--Identifiers--> | |||
| CASNo_Ref = {{cascite|correct|CAS}} | |||
| CAS_number_Ref = {{cascite|correct|??}} | |||
| CAS_number = 37091-66-0 | | CAS_number = 37091-66-0 | ||
| ATC_prefix = J01 | | ATC_prefix = J01 | ||
| ATC_suffix = CA09 | | ATC_suffix = CA09 | ||
| | | PubChem = 6479523 | ||
| | | DrugBank_Ref = {{drugbankcite|correct|drugbank}} | ||
| DrugBank = | | DrugBank = DB01061 | ||
| C=20 | H=23 | N=5 | O=6 | S=1 | | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ||
| molecular_weight = 461. | | ChemSpiderID = 4980416 | ||
| | | UNII_Ref = {{fdacite|correct|FDA}} | ||
| | | UNII = HUM6H389W0 | ||
| | | KEGG_Ref = {{keggcite|correct|kegg}} | ||
| | | KEGG = D02339 | ||
| | | ChEBI_Ref = {{ebicite|correct|EBI}} | ||
| | | ChEBI = 2956 | ||
| | | ChEMBL_Ref = {{ebicite|correct|EBI}} | ||
| ChEMBL = 1537 | |||
<!--Chemical data--> | |||
| C=20 | H=23 | N=5 | O=6 | S=1 | |||
| molecular_weight = 461.491 g/mol | |||
| smiles = O=C(O)[C@@H]3N4C(=O)[C@@H](NC(=O)[C@@H](c1ccccc1)NC(=O)N2C(=O)NCC2)[C@H]4SC3(C)C | |||
| InChI = 1/C20H23N5O6S/c1-20(2)13(17(28)29)25-15(27)12(16(25)32-20)22-14(26)11(10-6-4-3-5-7-10)23-19(31)24-9-8-21-18(24)30/h3-7,11-13,16H,8-9H2,1-2H3,(H,21,30)(H,22,26)(H,23,31)(H,28,29)/t11-,12-,13+,16-/m1/s1 | |||
| InChIKey = JTWOMNBEOCYFNV-NFFDBFGFBS | |||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | |||
| StdInChI = 1S/C20H23N5O6S/c1-20(2)13(17(28)29)25-15(27)12(16(25)32-20)22-14(26)11(10-6-4-3-5-7-10)23-19(31)24-9-8-21-18(24)30/h3-7,11-13,16H,8-9H2,1-2H3,(H,21,30)(H,22,26)(H,23,31)(H,28,29)/t11-,12-,13+,16-/m1/s1 | |||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | |||
| StdInChIKey = JTWOMNBEOCYFNV-NFFDBFGFSA-N | |||
}} | }} | ||
'''Azlocillin''' is an [[acyl]][[ampicillin]] [[antibiotic]] with an extended spectrum of activity and greater ''[[in vitro]]'' potency than the carboxy [[penicillin]]s. | |||
Azlocillin is similar to [[mezlocillin]] and [[piperacillin]]. It demonstrates antibacterial activity against a broad spectrum of [[bacteria]], including ''[[Pseudomonas aeruginosa]]'' and, in contrast to most [[cephalosporin]]s, exhibits activity against [[enterococcus|enterococci]]. | |||
==Spectrum of bacterial susceptibility== | |||
Azlocillin is | Azlocillin is considered a broad spectrum antibiotic and can be used against a number of Gram positive and Gram negative bacteria. The following represents MIC susceptibility data for a few medically significant organisms.<ref>http://www.toku-e.com/Assets/MIC/Azlocillin%20sodium%20salt.pdf</ref> | ||
* ''Escherichia coli'' 1 μg/mL - 32 μg/mL | |||
* ''Haemophilus'' spp. 0.03 μg/mL - 2 μg/mL | |||
* ''Pseudomonas aeruginosa'' 4 μg/mL - 6.25 μg/mL | |||
==References== | |||
{{reflist|30em}} | |||
{{PenicillinAntiBiotics}} | {{PenicillinAntiBiotics}} | ||
[[Category:Beta-lactam antibiotics]] | [[Category:Beta-lactam antibiotics]] | ||
[[Category:Enantiopure drugs]] | |||
[[Category:Imidazolidinones]] | |||
{{Antibiotic-stub}} | |||
{{ | |||
Revision as of 13:49, 13 April 2015
File:Azlocillin skeletal.svg | |
Clinical data | |
---|---|
AHFS/Drugs.com | International Drug Names |
ATC code | |
Identifiers | |
| |
CAS Number | |
PubChem CID | |
DrugBank | |
ChemSpider | |
UNII | |
KEGG | |
ChEBI | |
ChEMBL | |
E number | {{#property:P628}} |
ECHA InfoCard | {{#property:P2566}}Lua error in Module:EditAtWikidata at line 36: attempt to index field 'wikibase' (a nil value). |
Chemical and physical data | |
Formula | C20H23N5O6S |
Molar mass | 461.491 g/mol |
3D model (JSmol) | |
| |
| |
(verify) |
Azlocillin is an acylampicillin antibiotic with an extended spectrum of activity and greater in vitro potency than the carboxy penicillins. Azlocillin is similar to mezlocillin and piperacillin. It demonstrates antibacterial activity against a broad spectrum of bacteria, including Pseudomonas aeruginosa and, in contrast to most cephalosporins, exhibits activity against enterococci.
Spectrum of bacterial susceptibility
Azlocillin is considered a broad spectrum antibiotic and can be used against a number of Gram positive and Gram negative bacteria. The following represents MIC susceptibility data for a few medically significant organisms.[1]
- Escherichia coli 1 μg/mL - 32 μg/mL
- Haemophilus spp. 0.03 μg/mL - 2 μg/mL
- Pseudomonas aeruginosa 4 μg/mL - 6.25 μg/mL