Roxatidine: Difference between revisions

Jump to navigation Jump to search
Newer edit →
VisualWikitext
WikiBot (talk | contribs)
Bots, Bureaucrats, bureaucrats, interwiki, nocaptcha, Administrators
57,550 edits
m Protected "Roxatidine": Protecting pages from unwanted edits ([edit=sysop] (indefinite) [move=sysop] (indefinite))
 
Turky Alkathery (talk | contribs)
CMEUser, nocaptcha, Administrators
6,562 edits
No edit summary
Line 1: Line 1:
{{Drugbox|<!--All drugbox data refers to roxatidine acetate-->
{{Drugbox
|IUPAC_name = 3-[3-(1-piperidylmethyl)phenoxy]propylcarbamoylmethyl acetate
| Verifiedfields = changed
| image= Roxatidine acetate.svg
| verifiedrevid = 464384032
| IUPAC_name = 2-oxo-2-(3-[3-(piperidin-1-ylmethyl)phenoxy]propylamino)ethyl acetate
| image = Roxatidine acetate.svg
| width = 250
| width = 250
| CAS_number=78628-28-1
| drug_name = Roxatidine acetate
| ATC_prefix=A02
 
| ATC_suffix=BA06
<!--Clinical data-->
| ATC_supplemental=
| tradename =
| PubChem=5105
| pregnancy_category =
| DrugBank=
| legal_status =
| C = 19 | H = 28 | N = 2 | O = 4
| routes_of_administration = Oral
| molecular_weight = 348.437 g/mol
 
| bioavailability= 80–90%
<!--Pharmacokinetic data-->
| bioavailability = 80–90%
| protein_bound = 5–7%
| protein_bound = 5–7%
| metabolism = [[Liver|Hepatic]] [[acetylation|deacetylation]]<br>Minor involvement of [[CYP2D6]] and [[CYP2A6]]
| metabolism = [[Liver|Hepatic]] [[acetylation|deacetylation]]<br>Minor involvement of [[CYP2D6]] and [[CYP2A6]]
| elimination_half-life= 5–7 hours
| elimination_half-life = 5–7 hours
| excretion = [[Kidney|Renal]]
| excretion = [[Kidney|Renal]]
| pregnancy_category =  
 
| legal_status =  
<!--Identifiers-->
| routes_of_administration= Oral
| CAS_number_Ref = {{cascite|changed|??}}
| CAS_number = 78628-28-1
| ATC_prefix = A02
| ATC_suffix = BA06
| PubChem = 5105
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB08806
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 4926
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = IV9VHT3YUM
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D08495
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 46102
 
<!--Chemical data-->
| C=19 | H=28 | N=2 | O=4
| molecular_weight = 348.437 g/mol
| smiles = O=C(OCC(=O)NCCCOc1cc(ccc1)CN2CCCCC2)C
| InChI = 1/C19H28N2O4/c1-16(22)25-15-19(23)20-9-6-12-24-18-8-5-7-17(13-18)14-21-10-3-2-4-11-21/h5,7-8,13H,2-4,6,9-12,14-15H2,1H3,(H,20,23)
| InChIKey = SMTZFNFIKUPEJC-UHFFFAOYAO
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C19H28N2O4/c1-16(22)25-15-19(23)20-9-6-12-24-18-8-5-7-17(13-18)14-21-10-3-2-4-11-21/h5,7-8,13H,2-4,6,9-12,14-15H2,1H3,(H,20,23)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = SMTZFNFIKUPEJC-UHFFFAOYSA-N
}}
}}
'''Roxatidine acetate''' is a specific and competitive [[histamine H2 receptor|H<sub>2</sub> receptor]] antagonist. The antisecretory effect of roxatidine acetate is mediated by its main metabolite, roxatidine.
'''Roxatidine acetate''' is a specific and competitive [[H2 antagonist|histamine H<sub>2</sub> receptor antagonist]] drug that is used to treat [[gastric ulcers]], [[Zollinger–Ellison syndrome]], [[erosive esophagitis]],  [[gastro-oesophageal reflux disease]], and [[gastritis]].<ref name=Murdoch>{{cite journal |title = Roxatidine acetate. A review of its pharmacodynamic and pharmacokinetic properties, and its therapeutic potential in peptic ulcer disease and related disorders |author = Murdoch D, McTavish D |journal =Drugs |year = 1991 |volume = 42 |issue = 2 |pages = 240–260 |pmid = 1717223 |url = http://ukpmc.ac.uk/abstract/MED/1717223 |doi=10.2165/00003495-199142020-00006}}</ref><ref name=Biospectrum>BioSpectrum Bureau 1 November 2012  [http://www.biospectrumasia.com/biospectrum/news/121261/sinhua-heart-generic-production-approval Sinhuan's generic heart drug gets production approval]</ref>
[[Pharmacodynamics|Pharmacodynamic]] studies revealed that 150 mg of roxatidine acetate were optimal in suppressing [[gastric acid]] secretion, and that a single bedtime dose of 150 mg was more effective than a dose of 75 mg twice daily in terms of inhibiting nocturnal acid secretion.


Roxatidine acetate has no [[antiandrogen]]ic effects and does not influence [[Drug metabolism|drug-metabolizing]] [[enzyme]]s in the liver.
[[Pharmacodynamics|Pharmacodynamic]] studies showed that 150&nbsp;mg of roxatidine acetate were optimal in suppressing [[gastric acid]] secretion, and that a single bedtime dose of 150&nbsp;mg was more effective than a dose of 75&nbsp;mg twice daily in terms of inhibiting nocturnal acid secretion.<ref name=Murdoch/>
 
It is available in countries including China, Japan, Korea, Germany, Italy, the Netherlands, Greece and South Africa.<ref name=Biospectrum/>
 
== References ==
{{reflist|2}}
 
{{Histaminergics}}
{{H2-receptor antagonist}}


[[Category:H2 receptor antagonists]]
[[Category:H2 receptor antagonists]]
[[Category:Piperidines]]
[[Category:Phenol ethers]]
[[Category:Acetamides]]
[[Category:Acetate esters]]


{{pharma-stub}}
{{gastrointestinal-drug-stub}}
{{H2-receptor antagonist}}

Revision as of 13:53, 13 April 2015

Roxatidine acetate
File:Roxatidine acetate.svg
Clinical data
Routes of
administration		Oral
ATC code
Pharmacokinetic data
Bioavailability80–90%
Protein binding5–7%
MetabolismHepatic deacetylation
Minor involvement of CYP2D6 and CYP2A6
Elimination half-life5–7 hours
ExcretionRenal
Identifiers
CAS Number
PubChem CID
DrugBank
ChemSpider
UNII
KEGG
ChEMBL
E number{{#property:P628}}
ECHA InfoCard{{#property:P2566}}Lua error in Module:EditAtWikidata at line 36: attempt to index field 'wikibase' (a nil value).
Chemical and physical data
FormulaC19H28N2O4
Molar mass348.437 g/mol
3D model (JSmol)
 ☒N☑Y (what is this?)  (verify)

Roxatidine acetate is a specific and competitive histamine H2 receptor antagonist drug that is used to treat gastric ulcers, Zollinger–Ellison syndrome, erosive esophagitis, gastro-oesophageal reflux disease, and gastritis.[1][2]

Pharmacodynamic studies showed that 150 mg of roxatidine acetate were optimal in suppressing gastric acid secretion, and that a single bedtime dose of 150 mg was more effective than a dose of 75 mg twice daily in terms of inhibiting nocturnal acid secretion.[1]

It is available in countries including China, Japan, Korea, Germany, Italy, the Netherlands, Greece and South Africa.[2]

References

  1. ↑ 1.0 1.1 Murdoch D, McTavish D (1991). "Roxatidine acetate. A review of its pharmacodynamic and pharmacokinetic properties, and its therapeutic potential in peptic ulcer disease and related disorders". Drugs. 42 (2): 240–260. doi:10.2165/00003495-199142020-00006. PMID 1717223.
  2. ↑ 2.0 2.1 BioSpectrum Bureau 1 November 2012 Sinhuan's generic heart drug gets production approval

Template:H2-receptor antagonist

Template:Gastrointestinal-drug-stub

Retrieved from "https://www.wikidoc.org/index.php?title=Roxatidine&oldid=1086472"