Tymazoline: Difference between revisions

Jump to navigation Jump to search
WikiBot (talk | contribs)
m Robot: Automated text replacement (-{{SIB}} +, -{{EH}} +, -{{EJ}} +, -{{Editor Help}} +, -{{Editor Join}} +)
 
Turky Alkathery (talk | contribs)
No edit summary
Line 1: Line 1:
{{Drugbox
{{Drugbox
| IUPAC_name       = 2-[(5-methyl-2-propan-2-ylphenoxy)methyl]-4,5-dihydro-1H-imidazole
| Verifiedfields = changed
| image             = Tymazoline.png
| Watchedfields = changed
| CAS_number        =  
| verifiedrevid = 470619043
| ATC_prefix        = R01
| IUPAC_name = 2-[(5-methyl-2-propan-2-ylphenoxy)methyl]-4,5-dihydro-1H-imidazole
| ATC_suffix        = AA13
| image = Tymazoline.png
| PubChem          = 34154
 
| DrugBank          =  
<!--Clinical data-->
| chemical_formula  =  
| tradename = Thymazen
| C=14|H=20|N=2|O=1
| Drugs.com = {{drugs.com|international|tymazoline}}
| molecular_weight  = 232.321 g/mol
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| bioavailability   =  
| pregnancy_US = <!-- A / B            / C / D / X -->
| protein_bound     =  
| pregnancy_category =  
| metabolism       =  
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA = <!--            / Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL        / P      / POM / CD / Class A, B, C -->
| legal_US = <!-- OTC                  / Rx-only  / Schedule I, II, III, IV, V -->
| legal_status =  
| routes_of_administration = Nasal
 
<!--Pharmacokinetic data-->
| bioavailability =  
| protein_bound =  
| metabolism =  
| elimination_half-life =  
| elimination_half-life =  
| excretion         =  
| excretion =  
| pregnancy_AU      =  <!-- A / B1 / B2 / B3 / C / D / X -->
 
| pregnancy_US      = <!-- A / B            / C / D / X -->
<!--Identifiers-->
| pregnancy_category=
| CAS_number_Ref = {{cascite|changed|??}}
| legal_AU          = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| CAS_number = 24243-97-8
| legal_CA          =  <!--             / Schedule I, II, III, IV, V, VI, VII, VIII -->
| ATC_prefix = R01
| legal_UK          =  <!-- GSL        / P      / POM / CD / Class A, B, C -->
| ATC_suffix = AA13
| legal_US          =  <!-- OTC                  / Rx-only  / Schedule I, II, III, IV, V -->
| PubChem = 34154
| legal_status      =  
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| routes_of_administration =  
| DrugBank = DB08803
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 31478
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = U993RH5585
| KEGG_Ref = {{keggcite|changed|kegg}}
| KEGG = D07373
 
<!--Chemical data-->
| chemical_formula =
| C=14 | H=20 | N=2 | O=1
| molecular_weight = 232.321 g/mol
| smiles = Cc1ccc(c2c1cccc2OCC3=NCCN3)C(C)C
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C14H20N2O/c1-10(2)12-5-4-11(3)8-13(12)17-9-14-15-6-7-16-14/h4-5,8,10H,6-7,9H2,1-3H3,(H,15,16)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = QRORCRWSRPKEHR-UHFFFAOYSA-N
}}
}}
{{CMG}}


'''Tymazoline''' (trade name '''Thymazen''' in Poland) is a nasal [[decongestant]] that can be used to treat [[rhinitis]]. It acts as an [[antihistaminic]] and [[sympathomimetic]], reducing swelling, inflammation and mucosal secretions.<ref>[[Drugs.com]]: [http://www.drugs.com/international/tymazoline.html Tymazoline]</ref><ref>[[DrugBank]]: [http://www.drugbank.ca/drugs/DB08803 Tymazoline]</ref>


 
==References==
'''Tymazoline''' is a nasal preparation.
{{reflist}}


{{Nasal preparations}}
{{Nasal preparations}}


[[Category:Imidazolines]]
[[Category:Imidazolines]]
[[Category:Phenol ethers]]


{{WH}}
{{respiratory-system-drug-stub}}
{{WS}}

Revision as of 13:57, 14 April 2015

Tymazoline
Clinical data
Trade namesThymazen
AHFS/Drugs.comInternational Drug Names
Routes of
administration
Nasal
ATC code
Identifiers
CAS Number
PubChem CID
DrugBank
ChemSpider
UNII
KEGG
E number{{#property:P628}}
ECHA InfoCard{{#property:P2566}}Lua error in Module:EditAtWikidata at line 36: attempt to index field 'wikibase' (a nil value).
Chemical and physical data
FormulaC14H20N2O
Molar mass232.321 g/mol
3D model (JSmol)
 ☒N☑Y (what is this?)  (verify)

Tymazoline (trade name Thymazen in Poland) is a nasal decongestant that can be used to treat rhinitis. It acts as an antihistaminic and sympathomimetic, reducing swelling, inflammation and mucosal secretions.[1][2]

References


Template:Respiratory-system-drug-stub