|
|
Line 1: |
Line 1: |
| {{Drugbox
| | #REDIRECT [[Tricaine mesylate]] |
| | Verifiedfields = changed
| |
| | Watchedfields = changed
| |
| | verifiedrevid = 455329821
| |
| | IUPAC_name = Ethyl 3-aminobenzoate methanesulfonic acid
| |
| | image = tricaine.png
| |
| | |
| <!--Clinical data-->
| |
| | tradename =
| |
| | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| |
| | pregnancy_US = <!-- A / B / C / D / X -->
| |
| | pregnancy_category =
| |
| | legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| |
| | legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| |
| | legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| |
| | legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| |
| | legal_status =
| |
| | routes_of_administration =
| |
| | |
| <!--Pharmacokinetic data-->
| |
| | bioavailability =
| |
| | protein_bound =
| |
| | metabolism =
| |
| | elimination_half-life =
| |
| | excretion =
| |
| | |
| <!--Identifiers-->
| |
| | CAS_number_Ref = {{cascite|correct|??}}
| |
| | CAS_number = 886-86-2
| |
| | CAS_supplemental =
| |
| | ATCvet = yes
| |
| | ATC_prefix = N01
| |
| | ATC_suffix = AX93
| |
| | ATC_supplemental =
| |
| | DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| |
| | DrugBank =
| |
| | PubChem = 13454
| |
| | ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| |
| | ChemSpiderID = 12878
| |
| | InChI = 1/C9H11NO2.CH4O3S/c1-2-12-9(11)7-4-3-5-8(10)6-7;1-5(2,3)4/h3-6H,2,10H2,1H3;1H3,(H,2,3,4)
| |
| | InChIKey = FQZJYWMRQDKBQN-UHFFFAOYAO
| |
| | StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| |
| | StdInChI = 1S/C9H11NO2.CH4O3S/c1-2-12-9(11)7-4-3-5-8(10)6-7;1-5(2,3)4/h3-6H,2,10H2,1H3;1H3,(H,2,3,4)
| |
| | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| |
| | StdInChIKey = FQZJYWMRQDKBQN-UHFFFAOYSA-N
| |
| | |
| <!--Chemical data-->
| |
| | chemical_formula =
| |
| | C=10 | H=15 | N=1 | O=5 | S=1
| |
| | molecular_weight = 261.296 g/mol
| |
| | smiles = [NH3+]C1=CC=CC(C(OCC)=O)=C1.CS(=O)([O-])=O
| |
| | synonyms = Metacaine<br />Tricaine<br />MS-222<br />Finquel<br />TMS
| |
| | melting_point = 149.5
| |
| }}
| |
| __NOTOC__
| |
| {{SI}}
| |
| {{CMG}}
| |
| ==Overview==
| |
| | |
| '''Tricaine mesylate''' ('''Tricaine methanesulfonate''', '''TMS''', '''MS-222'''), is white powder used for [[anesthesia]], sedation, or [[euthanasia]] of fish. TMS is the only anesthetic licensed in the United States for fin fish that are intended for human consumption.
| |
| The drug can have selective toxicity for [[poikilotherm]]s due to their lower rate of metabolism in the liver.<ref>Wayson KA(1976)."Studies on the comparative pharmacology and selective toxicity of tricaine methanesulfonate: metabolism as a basis of the selectivity toxicity in poikilotherms."''J Pharmacol Exp Ther'''''198'''(3):695-708. [PMID 185356]</ref>
| |
| | |
| TMS is a [[muscle relaxant]] that operates by preventing [[action potential]]s. {{citation needed|date=February 2013}}By blocking action potentials, no signals can be exchanged between the [[brain]] and the extremities. There will be no [[sensory input]] or [[muscle contraction]]s which would have been caused by action potential, which includes most muscles.
| |
| | |
| The optimum concentration may vary with the size and species of the fish, and other variables.
| |
| | |
| It is easily soluble in water (both fresh and salt) but it drastically decreases the [[pH]] of water, increasing the acidity, which may be toxic for fish. [[Sodium bicarbonate]] can be used to buffer the solution to a pH range of 6.5-7.5. Usually an equal amount of buffer is added to attain a neutral pH.<ref>http://www.research.cornell.edu/care/documents/ACUPs/ACUP306.pdf</ref> In salt/marine/sea water, the buffer use may not be necessary because sea water itself has buffering capacity.
| |
| | |
| The solution of TMS needs to be prepared freshly each time because TMS is light-sensitive and might form toxic by-products upon exposure to light.
| |
| | |
| ==References==
| |
| {{Reflist|2}}
| |
| | |
| | |
| [[Category:Drug]]
| |
| [[Category:Benzoates]]
| |