Diprophylline: Difference between revisions

Jump to navigation Jump to search
Kiran Singh (talk | contribs)
Created page with "{{Drugbox | Watchedfields = changed | verifiedrevid = 443716387 | IUPAC_name = 7-(2,3-dihydroxypropyl)-1,3-dimethyl-3,7-dihydro-1''H''-purine-2,6-dione | image =Dyphylline.png..."
 
Turky Alkathery (talk | contribs)
Redirected page to Dyphylline
 
Line 1: Line 1:
{{Drugbox
#REDIRECT[[Dyphylline]]
| Watchedfields = changed
| verifiedrevid = 443716387
| IUPAC_name = 7-(2,3-dihydroxypropyl)-1,3-dimethyl-3,7-dihydro-1''H''-purine-2,6-dione
| image =Dyphylline.png
 
<!--Clinical data-->
| tradename = Lufyllin
| Drugs.com = {{drugs.com|CDI|dyphylline}}
| MedlinePlus = a682494
| pregnancy_US = C
| legal_US = Rx-only
| routes_of_administration = 
 
<!--Pharmacokinetic data-->
| bioavailability = 
| metabolism = 
| elimination_half-life = 
| excretion = 
 
<!--Identifiers-->
| CASNo_Ref = {{cascite|correct|CAS}}
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 479-18-5
| ATC_prefix = R03
| ATC_suffix = DA01
| PubChem = 3182
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00651
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 3070
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 263T0E9RR9
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D00691
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 4728
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 1752
 
<!--Chemical data-->
| C=10 | H=14 | N=4 | O=4
| molecular_weight = 254.24 g/mol
| smiles = O=C2N(c1ncn(c1C(=O)N2C)CC(O)CO)C
| InChI = 1/C10H14N4O4/c1-12-8-7(9(17)13(2)10(12)18)14(5-11-8)3-6(16)4-15/h5-6,15-16H,3-4H2,1-2H3
| InChIKey = KSCFJBIXMNOVSH-UHFFFAOYAI
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C10H14N4O4/c1-12-8-7(9(17)13(2)10(12)18)14(5-11-8)3-6(16)4-15/h5-6,15-16H,3-4H2,1-2H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = KSCFJBIXMNOVSH-UHFFFAOYSA-N
| synonyms = 7-(2,3-dihydroxy-propyl)theophylline
}}
__Notoc__
{{SI}}
{{CMG}}
==Overview==
 
'''Dyphylline''' ([[United States Adopted Name|USAN]]) (trade names '''Dilor''', '''Lufyllin'''), also known as '''diprophylline''' ([[International Nonproprietary Name|INN]]), is a [[xanthine]] [[chemical derivative|derivative]] with [[bronchodilator]] and [[vasodilator]] effects. It is used in the treatment of [[respiratory disorder]]s like [[asthma]], [[cardiac dyspnea]], and [[bronchitis]]. It acts as an [[adenosine receptor]] [[receptor antagonist|antagonist]] and [[phosphodiesterase inhibitor]].<ref name="pmid2997628">{{cite journal | author = Schwabe U, Ukena D, Lohse MJ | title = Xanthine derivatives as antagonists at A1 and A2 adenosine receptors | journal = Naunyn-Schmiedeberg's Archives of Pharmacology | volume = 330 | issue = 3 | pages = 212–21 |date=September 1985 | pmid = 2997628 | doi = 10.1007/bf00572436| url = }}</ref><ref name="pmid225216">{{cite journal | author = Iancu L, Shneur A, Cohen H | title = Trials with xanthine derivatives in systemic treatment of psoriasis | journal = Dermatologica | volume = 159 | issue = 1 | pages = 55–61 | year = 1979 | pmid = 225216 | doi = 10.1159/000250562| url = }}</ref>
 
== See also ==
* [[Xanthine]]
 
== References ==
{{Reflist|2}}
 
 
{{Stimulants}}
{{Asthma and copd rx}}
{{Adenosinergics}}
{{Phosphodiesterase inhibitors}}
 
[[Category:Adenosine receptor antagonists]]
[[Category:Phosphodiesterase inhibitors]]
[[Category:Xanthines]]
[[Category:Diols]]
[[Category:Drug]]
 
 
{{respiratory-system-drug-stub}}

Latest revision as of 13:22, 17 April 2015

Redirect to: