|
|
Line 1: |
Line 1: |
| {{Drugbox
| | #REDIRECT[[Dyphylline]] |
| | Watchedfields = changed
| |
| | verifiedrevid = 443716387
| |
| | IUPAC_name = 7-(2,3-dihydroxypropyl)-1,3-dimethyl-3,7-dihydro-1''H''-purine-2,6-dione
| |
| | image =Dyphylline.png
| |
| | |
| <!--Clinical data-->
| |
| | tradename = Lufyllin
| |
| | Drugs.com = {{drugs.com|CDI|dyphylline}}
| |
| | MedlinePlus = a682494
| |
| | pregnancy_US = C
| |
| | legal_US = Rx-only
| |
| | routes_of_administration =
| |
| | |
| <!--Pharmacokinetic data-->
| |
| | bioavailability =
| |
| | metabolism =
| |
| | elimination_half-life =
| |
| | excretion =
| |
| | |
| <!--Identifiers-->
| |
| | CASNo_Ref = {{cascite|correct|CAS}}
| |
| | CAS_number_Ref = {{cascite|correct|??}}
| |
| | CAS_number = 479-18-5
| |
| | ATC_prefix = R03
| |
| | ATC_suffix = DA01
| |
| | PubChem = 3182
| |
| | DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| |
| | DrugBank = DB00651
| |
| | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| |
| | ChemSpiderID = 3070
| |
| | UNII_Ref = {{fdacite|correct|FDA}}
| |
| | UNII = 263T0E9RR9
| |
| | KEGG_Ref = {{keggcite|correct|kegg}}
| |
| | KEGG = D00691
| |
| | ChEBI_Ref = {{ebicite|correct|EBI}}
| |
| | ChEBI = 4728
| |
| | ChEMBL_Ref = {{ebicite|correct|EBI}}
| |
| | ChEMBL = 1752
| |
| | |
| <!--Chemical data-->
| |
| | C=10 | H=14 | N=4 | O=4
| |
| | molecular_weight = 254.24 g/mol
| |
| | smiles = O=C2N(c1ncn(c1C(=O)N2C)CC(O)CO)C
| |
| | InChI = 1/C10H14N4O4/c1-12-8-7(9(17)13(2)10(12)18)14(5-11-8)3-6(16)4-15/h5-6,15-16H,3-4H2,1-2H3
| |
| | InChIKey = KSCFJBIXMNOVSH-UHFFFAOYAI
| |
| | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| |
| | StdInChI = 1S/C10H14N4O4/c1-12-8-7(9(17)13(2)10(12)18)14(5-11-8)3-6(16)4-15/h5-6,15-16H,3-4H2,1-2H3
| |
| | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| |
| | StdInChIKey = KSCFJBIXMNOVSH-UHFFFAOYSA-N
| |
| | synonyms = 7-(2,3-dihydroxy-propyl)theophylline
| |
| }}
| |
| __Notoc__
| |
| {{SI}}
| |
| {{CMG}}
| |
| ==Overview==
| |
| | |
| '''Dyphylline''' ([[United States Adopted Name|USAN]]) (trade names '''Dilor''', '''Lufyllin'''), also known as '''diprophylline''' ([[International Nonproprietary Name|INN]]), is a [[xanthine]] [[chemical derivative|derivative]] with [[bronchodilator]] and [[vasodilator]] effects. It is used in the treatment of [[respiratory disorder]]s like [[asthma]], [[cardiac dyspnea]], and [[bronchitis]]. It acts as an [[adenosine receptor]] [[receptor antagonist|antagonist]] and [[phosphodiesterase inhibitor]].<ref name="pmid2997628">{{cite journal | author = Schwabe U, Ukena D, Lohse MJ | title = Xanthine derivatives as antagonists at A1 and A2 adenosine receptors | journal = Naunyn-Schmiedeberg's Archives of Pharmacology | volume = 330 | issue = 3 | pages = 212–21 |date=September 1985 | pmid = 2997628 | doi = 10.1007/bf00572436| url = }}</ref><ref name="pmid225216">{{cite journal | author = Iancu L, Shneur A, Cohen H | title = Trials with xanthine derivatives in systemic treatment of psoriasis | journal = Dermatologica | volume = 159 | issue = 1 | pages = 55–61 | year = 1979 | pmid = 225216 | doi = 10.1159/000250562| url = }}</ref>
| |
| | |
| == See also ==
| |
| * [[Xanthine]]
| |
| | |
| == References ==
| |
| {{Reflist|2}}
| |
| | |
| | |
| {{Stimulants}}
| |
| {{Asthma and copd rx}}
| |
| {{Adenosinergics}}
| |
| {{Phosphodiesterase inhibitors}}
| |
| | |
| [[Category:Adenosine receptor antagonists]]
| |
| [[Category:Phosphodiesterase inhibitors]]
| |
| [[Category:Xanthines]]
| |
| [[Category:Diols]]
| |
| [[Category:Drug]]
| |
| | |
| | |
| {{respiratory-system-drug-stub}}
| |