|
|
| Line 1: |
Line 1: |
| __NOTOC__ | | __NOTOC__ |
| {{Drugbox | | {{XXXXX}} |
| | Verifiedfields = changed
| | {{CMG}} |
| | verifiedrevid = 459980346
| | |
| | IUPAC_name = 2,2'-sulfanediylbis(4,6-dichlorophenol)
| | ==Overview== |
| | image = Bithionol.png
| | |
| | ==Category== |
|
| |
|
| <!--Clinical data-->
| | ==Brand Names== |
| | tradename =
| |
| | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| |
| | pregnancy_US = <!-- A / B / C / D / X -->
| |
| | pregnancy_category =
| |
| | legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| |
| | legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| |
| | legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| |
| | legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| |
| | legal_status =
| |
| | routes_of_administration =
| |
|
| |
|
| <!--Pharmacokinetic data--> | | BITHIONOL<sup>®</sup> (not available in the U.S.) |
| | bioavailability =
| |
| | protein_bound =
| |
| | metabolism =
| |
| | elimination_half-life =
| |
| | excretion =
| |
|
| |
|
| <!--Identifiers-->
| | ==Prescribing Information== |
| | CAS_number_Ref = {{cascite|changed|??}}
| |
| | CAS_number = 97-18-7
| |
| | ATC_prefix = D10
| |
| | ATC_suffix = AB01
| |
| | ATC_supplemental = {{ATC|P02|BX01}} {{ATCvet|P52|AG07}}
| |
| | PubChem = 2406
| |
| | IUPHAR_ligand = 2338
| |
| | DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| |
| | DrugBank = DB04813
| |
| | UNII_Ref = {{fdacite|correct|FDA}}
| |
| | UNII = AMT77LS62O
| |
| | ChEMBL_Ref = {{ebicite|correct|EBI}}
| |
| | ChEMBL = 290106
| |
| | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| |
| | ChemSpiderID = 2313
| |
| | ChEBI_Ref = {{ebicite|correct|EBI}}
| |
| | ChEBI = 3131
| |
| | SMILES = Clc2cc(Cl)cc(Sc1cc(Cl)cc(Cl)c1O)c2O
| |
| | InChI = 1/C12H6Cl4O2S/c13-5-1-7(15)11(17)9(3-5)19-10-4-6(14)2-8(16)12(10)18/h1-4,17-18H
| |
| | InChIKey = JFIOVJDNOJYLKP-UHFFFAOYAO
| |
| | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| |
| | StdInChI = 1S/C12H6Cl4O2S/c13-5-1-7(15)11(17)9(3-5)19-10-4-6(14)2-8(16)12(10)18/h1-4,17-18H
| |
| | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| |
| | StdInChIKey = JFIOVJDNOJYLKP-UHFFFAOYSA-N
| |
|
| |
|
| <!--Chemical data-->
| | ''' [[XXXXX description|Description]]''' |
| | C=12 | H=6 | Cl=4 | O=2 | S=1 | | '''| [[XXXXX clinical pharmacology|Clinical Pharmacology]]''' |
| | molecular_weight = 356.05 g/mol
| | '''| [[XXXXX microbiology|Microbiology]]''' |
| | synonyms = 2,4-dichloro- 6-(3,5-dichloro- 2-hydroxyphenyl)sulfanylphenol | | '''| [[XXXXX indications and usage|Indications and Usage]]''' |
| }} | | '''| [[XXXXX contraindications|Contraindications]]''' |
| | '''| [[XXXXX warnings and precautions|Warnings and Precautions]]''' |
| | '''| [[XXXXX adverse reactions|Adverse Reactions]]''' |
| | '''| [[XXXXX drug interactions|Drug Interactions]]''' |
| | '''| [[XXXXX overdosage|Overdosage]]''' |
| | '''| [[XXXXX clinical studies|Clinical Studies]]''' |
| | '''| [[XXXXX dosage and administration|Dosage and Administration]]''' |
| | '''| [[XXXXX how supplied|How Supplied]]''' |
| | '''| [[XXXXX labels and packages|Labels and Packages]]''' |
| | |
| | ==Mechanism of Action== |
| | |
| | ==References== |
| | {{Reflist|2}} |
| | |
| | [[Category:Antibiotics]] |
| | [[Category:Wikinfect]] |
|
| |
|
| {{SI}}
| |
| {{CMG}}
| |
| ==Overview== | | ==Overview== |
|
| |
|
Editor-In-Chief: C. Michael Gibson, M.S., M.D. [2]
Overview
Category
Brand Names
BITHIONOL® (not available in the U.S.)
Prescribing Information
Description
| Clinical Pharmacology
| Microbiology
| Indications and Usage
| Contraindications
| Warnings and Precautions
| Adverse Reactions
| Drug Interactions
| Overdosage
| Clinical Studies
| Dosage and Administration
| How Supplied
| Labels and Packages
Mechanism of Action
References
Overview
Bithionol is an anthelmintic used to treat "Anoplocephala perfoliata" (tapeworms) in horses[1] and Fasciola hepatica (liver flukes).
References
- ↑ [1], Sanada Y, Senba H, Mochizuki R, et al. Evaluation of marked rise in fecal egg output after bithionol administration to horse and its application as a diagnostic marker for equine Anoplocephala perfoliata infection. J. Vet. Med. Sci. May 2009;71(5):617-620.
Template:Anthelmintics
Template:Antiinfective-drug-stub
Template:Dermatologic-drug-stub