Metipranolol: Difference between revisions
m Robot: Automated text replacement (-{{SIB}} + & -{{EH}} + & -{{EJ}} + & -{{Editor Help}} + & -{{Editor Join}} +) |
Gerald Chi (talk | contribs) mNo edit summary |
||
Line 1: | Line 1: | ||
{{ | |||
| IUPAC_name = | {{Drugbox | ||
| image = Metipranolol. | | verifiedrevid = 411547542 | ||
| IUPAC_name = (''RS'')-4-{[-2-hydroxy-3-(isopropylamino)propyl]oxy}-2,3,6-trimethylphenyl acetate | |||
| image = Metipranolol.svg | |||
| width = 200 | |||
| imagename = 1 : 1 mixture (racemate) | |||
| drug_name = Metipranolol | |||
<!--Clinical data--> | |||
| tradename = Optipranolol | |||
| Drugs.com = {{drugs.com|CONS|metipranolol}} | |||
| MedlinePlus = a601078 | |||
| pregnancy_category = | |||
| legal_status = | |||
| routes_of_administration = | |||
<!--Pharmacokinetic data--> | |||
| bioavailability = | |||
| protein_bound = | |||
| metabolism = | |||
| elimination_half-life = | |||
<!--Identifiers--> | |||
| CASNo_Ref = {{cascite|correct|CAS}} | |||
| CAS_number = 22664-55-7 | | CAS_number = 22664-55-7 | ||
| ATC_prefix = S01 | | ATC_prefix = S01 | ||
| ATC_suffix = ED04 | | ATC_suffix = ED04 | ||
| ATC_supplemental = {{ATC|C07|BA68}} | | ATC_supplemental = {{ATC|C07|BA68}} | ||
| PubChem = 31477 | | PubChem = 31477 | ||
| DrugBank = | | DrugBank_Ref = {{drugbankcite|correct|drugbank}} | ||
| DrugBank = DB01214 | |||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | |||
| ChemSpiderID = 29193 | |||
| UNII_Ref = {{fdacite|correct|FDA}} | |||
| UNII = X39AL81KEB | |||
| KEGG_Ref = {{keggcite|correct|kegg}} | |||
| KEGG = D02374 | |||
| ChEMBL_Ref = {{ebicite|correct|EBI}} | |||
| ChEMBL = 1291 | |||
<!--Chemical data--> | |||
| C=17 | H=27 | N=1 | O=4 | | C=17 | H=27 | N=1 | O=4 | ||
| molecular_weight = 309.401 g/mol | | molecular_weight = 309.401 g/mol | ||
| | | smiles = O=C(Oc1c(c(c(OCC(O)CNC(C)C)cc1C)C)C)C | ||
| | | InChI = 1/C17H27NO4/c1-10(2)18-8-15(20)9-21-16-7-11(3)17(22-14(6)19)13(5)12(16)4/h7,10,15,18,20H,8-9H2,1-6H3 | ||
| | | InChIKey = BQIPXWYNLPYNHW-UHFFFAOYAJ | ||
| | | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | ||
| | | StdInChI = 1S/C17H27NO4/c1-10(2)18-8-15(20)9-21-16-7-11(3)17(22-14(6)19)13(5)12(16)4/h7,10,15,18,20H,8-9H2,1-6H3 | ||
| | | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | ||
| | | StdInChIKey = BQIPXWYNLPYNHW-UHFFFAOYSA-N | ||
}} | }} | ||
__NOTOC__ | __NOTOC__{{Metipranolol}} | ||
{{CMG}} | {{CMG}} | ||
{{SB}} METIPRANOLOL | |||
==Overview== | |||
'''Metipranolol hydrochloride''' (OptiPranolol) is a non-selective [[beta blocker]] used in [[eye drop]]s to treat [[glaucoma]]. | '''Metipranolol hydrochloride''' (OptiPranolol) is a non-selective [[beta blocker]] used in [[eye drop]]s to treat [[glaucoma]]. | ||
==Category== | |||
Beta Blockers | |||
==FDA Package Insert== | |||
====METIPRANOLOL solution/ drops==== | |||
''' [[Metipranolol indications and usage|Indications and Usage]]''' | |||
'''| [[Metipranolol dosage and administration|Dosage and Administration]]''' | |||
'''| [[Metipranolol dosage forms and strengths|Dosage Forms and Strengths]]''' | |||
'''| [[Metipranolol contraindications|Contraindications]]''' | |||
'''| [[Metipranolol warnings and precautions|Warnings and Precautions]]''' | |||
'''| [[Metipranolol adverse reactions|Adverse Reactions]]''' | |||
'''| [[Metipranolol drug interactions|Drug Interactions]]''' | |||
'''| [[Metipranolol use in specific populations|Use in Specific Populations]]''' | |||
'''| [[Metipranolol overdosage|Overdosage]]''' | |||
'''| [[Metipranolol description|Description]]''' | |||
'''| [[Metipranolol clinical pharmacology|Clinical Pharmacology]]''' | |||
'''| [[Metipranolol nonclinical toxicology|Nonclinical Toxicology]]''' | |||
'''| [[Metipranolol clinical studies|Clinical Studies]]''' | |||
'''| [[Metipranolol how supplied storage and handling|How Supplied/Storage and Handling]]''' | |||
'''| [[Metipranolol patient counseling information|Patient Counseling Information]]''' | |||
'''| [[Metipranolol labels and packages|Labels and Packages]]''' | |||
==Mechanism of Action== | |||
Metipranolol blocks beta1 and beta2 (non-selective) adrenergic receptors. It does not have significant intrinsic sympathomimetic activity, and has only weak local anesthetic (membrane-stabilizing) and myocardial depressant activity. | |||
==References== | |||
{{Reflist|2}} | |||
{{beta blockers}} | {{beta blockers}} | ||
{{Antiglaucoma preparations and miotics}} | {{Antiglaucoma preparations and miotics}} | ||
[[Category:Beta blockers]] | [[Category:Beta blockers]] | ||
[[Category:Drugs]] | [[Category:Drugs]] | ||
Revision as of 05:14, 10 February 2014
File:Metipranolol.svg | |
Clinical data | |
---|---|
Trade names | Optipranolol |
AHFS/Drugs.com | Micromedex Detailed Consumer Information |
MedlinePlus | a601078 |
ATC code | |
Identifiers | |
| |
CAS Number | |
PubChem CID | |
DrugBank | |
ChemSpider | |
UNII | |
KEGG | |
ChEMBL | |
E number | {{#property:P628}} |
ECHA InfoCard | {{#property:P2566}}Lua error in Module:EditAtWikidata at line 36: attempt to index field 'wikibase' (a nil value). |
Chemical and physical data | |
Formula | C17H27NO4 |
Molar mass | 309.401 g/mol |
3D model (JSmol) | |
| |
| |
(verify) |
Metipranolol |
---|
METIPRANOLOL® FDA Package Insert |
Indications and Usage |
Dosage and Administration |
Contraindications |
Warnings and Precautions |
Adverse Reactions |
Drug Interactions |
Use in Specific Populations |
Overdosage |
Description |
Clinical Pharmacology |
How Supplied/Storage and Handling |
Patient Counseling Information |
Labels and Packages |
Clinical Trials on Metipranolol |
ClinicalTrials.gov |
Editor-In-Chief: C. Michael Gibson, M.S., M.D. [1]
Synonyms / Brand Names: METIPRANOLOL
Overview
Metipranolol hydrochloride (OptiPranolol) is a non-selective beta blocker used in eye drops to treat glaucoma.
Category
Beta Blockers
FDA Package Insert
METIPRANOLOL solution/ drops
Indications and Usage | Dosage and Administration | Dosage Forms and Strengths | Contraindications | Warnings and Precautions | Adverse Reactions | Drug Interactions | Use in Specific Populations | Overdosage | Description | Clinical Pharmacology | Nonclinical Toxicology | Clinical Studies | How Supplied/Storage and Handling | Patient Counseling Information | Labels and Packages
Mechanism of Action
Metipranolol blocks beta1 and beta2 (non-selective) adrenergic receptors. It does not have significant intrinsic sympathomimetic activity, and has only weak local anesthetic (membrane-stabilizing) and myocardial depressant activity.
References
- Pages with script errors
- Pages with broken file links
- Template:drugs.com link with non-standard subpage
- E number from Wikidata
- ECHA InfoCard ID from Wikidata
- Chemical articles with unknown parameter in Infobox drug
- Infobox drug articles with non-default infobox title
- Drugs with no legal status
- Beta blockers
- Drugs