Template:Benazepril: Difference between revisions
Jump to navigation
Jump to search
Gerald Chi (talk | contribs) mNo edit summary |
Ahmed Zaghw (talk | contribs) No edit summary |
||
Line 1: | Line 1: | ||
{| | {{Drugbox | ||
| verifiedrevid = 459529583 | |||
| | | IUPAC_name = 2-[(3''S'')-3-{[(2''S'')-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino}- | ||
| image = Benazepril structure.png | |||
| | |||
<!--Clinical data--> | |||
| tradename = Lotensin | |||
| Drugs.com = {{drugs.com|monograph|benazepril-hydrochloride}} | |||
|- | | MedlinePlus = a692011 | ||
| pregnancy_category = D | |||
| legal_status = Rx-only | |||
! | | routes_of_administration = Oral | ||
| | |||
<!--Pharmacokinetic data--> | |||
|- | | bioavailability = | ||
| protein_bound = 96.7% | |||
| | | metabolism = [[Liver|Hepatic]] [[glucuronidation]] | ||
| elimination_half-life = 10-11 hours | |||
| | | excretion = [[Kidney|Renal]] and biliary | ||
| | <!--Identifiers--> | ||
| CASNo_Ref = {{cascite|correct|CAS}} | |||
| | | CAS_number_Ref = {{cascite|correct|??}} | ||
| CAS_number = 86541-75-5 | |||
| | | ATC_prefix = C09 | ||
| ATC_suffix = AA07 | |||
|- | | PubChem = 5362124 | ||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} | |||
| | | DrugBank = DB00542 | ||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | |||
|- | | ChemSpiderID = 4514935 | ||
| UNII_Ref = {{fdacite|correct|FDA}} | |||
|- | | UNII = UDM7Q7QWP8 | ||
| ChEBI_Ref = {{ebicite|correct|EBI}} | |||
|- | | ChEBI = 3011 | ||
| ChEMBL_Ref = {{ebicite|correct|EBI}} | |||
| ChEMBL = 838 | |||
<!--Chemical data--> | |||
| C=24 | H=28 | N=2 | O=5 | |||
| molecular_weight = 424.49 g/mol | |||
| smiles = O=C(OCC)[C@@H](N[C@@H]2C(=O)N(c1ccccc1CC2)CC(=O)O)CCc3ccccc3 | |||
| InChI = 1/C24H28N2O5/c1-2-31-24(30)20(14-12-17-8-4-3-5-9-17)25-19-15-13-18-10-6-7-11-21(18)26(23(19)29)16-22(27)28/h3-11,19-20,25H,2,12-16H2,1H3,(H,27,28)/t19-,20-/m0/s1 | |||
| InChIKey = XPCFTKFZXHTYIP-PMACEKPBBT | |||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | |||
| StdInChI = 1S/C24H28N2O5/c1-2-31-24(30)20(14-12-17-8-4-3-5-9-17)25-19-15-13-18-10-6-7-11-21(18)26(23(19)29)16-22(27)28/h3-11,19-20,25H,2,12-16H2,1H3,(H,27,28)/t19-,20-/m0/s1 | |||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | |||
| StdInChIKey = XPCFTKFZXHTYIP-PMACEKPBSA-N | |||
}} |
Revision as of 15:52, 24 March 2014
Clinical data | |
---|---|
Trade names | Lotensin |
AHFS/Drugs.com | Monograph |
MedlinePlus | a692011 |
Pregnancy category |
|
Routes of administration | Oral |
ATC code | |
Legal status | |
Legal status |
|
Pharmacokinetic data | |
Protein binding | 96.7% |
Metabolism | Hepatic glucuronidation |
Elimination half-life | 10-11 hours |
Excretion | Renal and biliary |
Identifiers | |
| |
CAS Number | |
PubChem CID | |
DrugBank | |
ChemSpider | |
UNII | |
ChEBI | |
ChEMBL | |
E number | {{#property:P628}} |
ECHA InfoCard | {{#property:P2566}}Lua error in Module:EditAtWikidata at line 36: attempt to index field 'wikibase' (a nil value). |
Chemical and physical data | |
Formula | C24H28N2O5 |
Molar mass | 424.49 g/mol |
3D model (JSmol) | |
| |
| |
(verify) |