Delapril

Revision as of 19:44, 23 July 2014 by ShiSheng (talk | contribs)
(diff) ← Older revision | Latest revision (diff) | Newer revision → (diff)
Jump to navigation Jump to search

{{Drugbox | verifiedrevid = 444593478 | IUPAC_name = 2-[(2S)-N-(2,3-dihydro-1H-inden-2-yl)-2-{[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino}propanamido]acetic acid | image = Delapril.png

| tradename = | Drugs.com = International Drug Names | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration =

| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

| CAS_number_Ref =  ☑Y | CAS_number = 83435-66-9 | ATC_prefix = C09 | ATC_suffix = AA12 | ATC_supplemental = | PubChem = 5362116 | DrugBank_Ref =  ☑Y | DrugBank = | UNII_Ref =  ☑Y | UNII = W77UAL9THI | KEGG_Ref =  ☑Y | KEGG = D07781 | ChemSpiderID = 4514931 | chemical_formula = C26H32N2O5 | molecular_weight = 452.543 | smiles = O=C(OCC)[C@@H](N[C@H](C(=O)N(CC(=O)O)C2Cc1ccccc1C2)C)CCc3ccccc3 | InChI = 1/C26H32N2O5/c1-3-33-26(32)23(14-13-19-9-5-4-6-10-19)27-18(2)25(31)28(17-24(29)30)22-15-20-11-7-8-12-21(20)16-22/h4-12,18,22-23,27H,3,13-17H2,1-2H3,(H,29,30)/t18-,23-/m0/s1 | InChIKey = WOUOLAUOZXOLJQ-MBSDFSHPBY | StdInChI = 1S/C26H32N2O5/c1-3-33-26(32)23(14-13-19-9-5-4-6-10-19)27-18(2)25(31)28(17-24(29)30)22-15-20-11-7-8-12-21(20)16-22/h4-12,18,22-23,27H,3,13-17H2,1-2H3,(H,29,30)/t18-,23-/m0/s1 | StdInChIKey = WOUOLAUOZXOLJQ-MBSDFSHPSA-N

| chemical_formula = | C=26 | H=32 | N=2 | O=5 | molecular_weight = 452.542 g/mol }}

Delapril (INN, also known as alindapril) is an ACE inhibitor used as an antihypertensive drug[1] in a number of European and Asian countries.[2]

References

  1. PMID 17703633 (PMID 17703633)
    Citation will be completed automatically in a few minutes. Jump the queue or expand by hand
  2. Drugs.com: Delapril

Template:ACE inhibitors