Octyl salicylate
| Template:Chembox header| Octyl salicylate | |
|---|---|
| Octyl salicylate | |
| Chemical name | 2-ethylhexyl 2-hydroxybenzoate |
| Other names | 2-ethylhexyl salicylate; octisalate; benzoic acid, 2-hydroxy-, 2-ethylhexyl ester; ethyl hexyl salicylate; salicylic acid, 2-ethylhexyl ester; 2-ethylhexyl ester benzoic acid, 2-hydroxy-; 2-ethylhexyl ester salicylic acid; 2-hydroxy- 2-ethylhexyl ester benzoic acid; benzoic acid, 2-hydroxy, 2-ethylhexyl ester; |
| Chemical formula | C15H22O3 |
| Molecular mass | 250.33 g/mol |
| CAS number | [118-60-5] |
| Density | 1.014 g/cm3 |
| Melting point | <25 °C |
| Boiling point | 189 °C |
| SMILES | Oc1c(C(OCC(CCCC)CC)=O)cccc1 |
| NFPA | Template:NFPA 704 |
| Template:Chembox header | Disclaimer and references | |
Octyl salicylate, or 2-ethylhexyl salicylate, is an organic compound used as an ingredient in sunscreens and cosmetics. It is an ester formed by the condensation of a salicylic acid with 2-ethylhexanol. It is a colorless oily liquid with a slight floral odor.
The salicylate portion of the molecule absorbs ultraviolet light, protecting skin from the harmful effects of exposure to sunlight. The ethylhexanol portion is a fatty alcohol, adding emollient and oil-like (water resistant) properties.