Elemicin
| Template:Chembox header| Elemicin | |
|---|---|
| Elemicin | |
| Chemical name | 1,2,3-trimethoxy-5- (2-propenyl)benzene |
| Other names | 5-allyl-1,2,3-trimethoxybenzene |
| Chemical formula | C12H16O3 |
| Molecular mass | 208.25 g/mol |
| CAS number | [487-11-6] |
| Density | ? g/cm3 |
| Melting point | ? °C |
| Boiling point | ? °C |
| SMILES | C=CCC1=CC(OC)=C(OC)C(OC)=C1 |
| Template:Chembox header | Disclaimer and references | |
Elemicin is a natural organic compound that is a constituent of the essential oil of nutmeg. It is believed to be responsible for the subtle psychoactive effects of nutmeg.
References
- "Chemistry and psychopharmacology of nutmeg and of several related phenylisopropylamines." Shulgin, Alexander T.; Sargent, Thornton W.; Naranjo, Claudio. United States, Public Health Service Publication (1967), No. 1645 202-14.