Buphenine
{{Drugbox | IUPAC_name = 4-{1-hydroxy-2-[(1-methyl-3-phenylpropyl)amino]propyl}phenol | image = Buphenine.png
| tradename = | Drugs.com = International Drug Names | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration =
| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =
| CAS_number = 447-41-6
| ATC_prefix = C04
| ATC_suffix = AA02
| ATC_supplemental = G02CA02 (WHO)
| PubChem = 4567
| DrugBank =
| ChemSpiderID = 4407
| UNII_Ref =
| UNII = 695DKH33EI
| ChEMBL_Ref =
| ChEMBL = 114655
| C=19 | H=25 | N=1 | O=2 | molecular_weight = 299.41 g/mol | smiles = OC(c1ccc(O)cc1)C(NC(C)CCc2ccccc2)C | InChI = 1/C19H25NO2/c1-14(8-9-16-6-4-3-5-7-16)20-15(2)19(22)17-10-12-18(21)13-11-17/h3-7,10-15,19-22H,8-9H2,1-2H3 | InChIKey = PTGXAUBQBSGPKF-UHFFFAOYAE }}
WikiDoc Resources for Buphenine |
Articles |
---|
Most recent articles on Buphenine |
Media |
Evidence Based Medicine |
Clinical Trials |
Ongoing Trials on Buphenine at Clinical Trials.gov Clinical Trials on Buphenine at Google
|
Guidelines / Policies / Govt |
US National Guidelines Clearinghouse on Buphenine
|
Books |
News |
Commentary |
Definitions |
Patient Resources / Community |
Patient resources on Buphenine Discussion groups on Buphenine Directions to Hospitals Treating Buphenine Risk calculators and risk factors for Buphenine
|
Healthcare Provider Resources |
Causes & Risk Factors for Buphenine |
Continuing Medical Education (CME) |
International |
|
Business |
Experimental / Informatics |
Editor-In-Chief: C. Michael Gibson, M.S., M.D. [1]
Overview
Buphenine (or nylidrin) is a beta-adrenergic agonist[1] that acts as a vasodilator via beta-2 receptors.
References
- ↑ Mittag TW, Tormay A, Messenger M, Podos SM (February 1985). "Ocular hypotension in the rabbit. Receptor mechanisms of pirbuterol and nylidrin". Invest. Ophthalmol. Vis. Sci. 26 (2): 163–9. PMID 2857689.