Ioglycamic acid
{{Drugbox | IUPAC_name = 3-(2-{[(3-carboxy-2,4,6-triiodophenyl)carbamoyl]methoxy}acetamido)-2,4,6-triiodobenzoic acid | image =Ioglycamic acid.png
| tradename = | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration =
| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =
| CAS_number = 2618-25-9 | ATC_prefix = V08 | ATC_suffix = AC03 | PubChem = 17477 | DrugBank = | ChemSpiderID = 16526 | ChEMBL = 2106372 | UNII_Ref = | UNII = ET36GPP4T7
| C=18 | H=10 | I=6 | N=2 | O=7 | molecular_weight = 1127.71 g/mol | smiles = O=C(Nc1c(I)c(c(I)cc1I)C(=O)O)COCC(=O)Nc2c(I)c(C(=O)O)c(I)cc2I }}
WikiDoc Resources for Ioglycamic acid |
Articles |
---|
Most recent articles on Ioglycamic acid Most cited articles on Ioglycamic acid |
Media |
Powerpoint slides on Ioglycamic acid |
Evidence Based Medicine |
Clinical Trials |
Ongoing Trials on Ioglycamic acid at Clinical Trials.gov Trial results on Ioglycamic acid Clinical Trials on Ioglycamic acid at Google
|
Guidelines / Policies / Govt |
US National Guidelines Clearinghouse on Ioglycamic acid NICE Guidance on Ioglycamic acid
|
Books |
News |
Commentary |
Definitions |
Patient Resources / Community |
Patient resources on Ioglycamic acid Discussion groups on Ioglycamic acid Patient Handouts on Ioglycamic acid Directions to Hospitals Treating Ioglycamic acid Risk calculators and risk factors for Ioglycamic acid
|
Healthcare Provider Resources |
Causes & Risk Factors for Ioglycamic acid |
Continuing Medical Education (CME) |
International |
|
Business |
Experimental / Informatics |
Editor-In-Chief: C. Michael Gibson, M.S., M.D. [1]
Overview
Ioglycamic acid is a molecule used as a contrast medium.