Ioxaglic acid
{{Drugbox | IUPAC_name = 3-[(2-hydroxyethyl)carbamoyl]-2,4,6-triiodo-5-(2-{[2,4,6-triiodo-3-(methylcarbamoyl)-5-(N-methylacetamido)phenyl]formamido}acetamido)benzoic acid | image = Ioxaglic acid wiki str.png
| tradename =
| Drugs.com = International Drug Names
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =
| CAS_number =
| ATC_prefix = V08
| ATC_suffix = AB03
| PubChem = 3742
| DrugBank =
| UNII_Ref =
| UNII = Z40X7EI2AF
| KEGG = D01761
| ChEMBL = 1201291
| ChemSpiderID = 3611
| chemical_formula = | C=24 | H=21 | I=6 | N=5 | O=8 | molecular_weight = 1268.87906 g/mol | smiles = CC(=O)N(C)C1=C(C(=C(C(=C1I)C(=O)NCC(=O)NC2=C(C(=C(C(=C2I)C(=O)O)I)C(=O)NCCO)I)I)C(=O)NC)I | InChI = 1/C24H21I6N5O8/c1-7(37)35(3)20-17(29)10(21(39)31-2)13(25)11(18(20)30)23(41)33-6-8(38)34-19-15(27)9(22(40)32-4-5-36)14(26)12(16(19)28)24(42)43/h36H,4-6H2,1-3H3,(H,31,39)(H,32,40)(H,33,41)(H,34,38)(H,42,43) | InChIKey = TYYBFXNZMFNZJT-UHFFFAOYAE | StdInChI = 1S/C24H21I6N5O8/c1-7(37)35(3)20-17(29)10(21(39)31-2)13(25)11(18(20)30)23(41)33-6-8(38)34-19-15(27)9(22(40)32-4-5-36)14(26)12(16(19)28)24(42)43/h36H,4-6H2,1-3H3,(H,31,39)(H,32,40)(H,33,41)(H,34,38)(H,42,43) | StdInChIKey = TYYBFXNZMFNZJT-UHFFFAOYSA-N
}}
WikiDoc Resources for Ioxaglic acid |
Articles |
---|
Most recent articles on Ioxaglic acid Most cited articles on Ioxaglic acid |
Media |
Powerpoint slides on Ioxaglic acid |
Evidence Based Medicine |
Clinical Trials |
Ongoing Trials on Ioxaglic acid at Clinical Trials.gov Trial results on Ioxaglic acid Clinical Trials on Ioxaglic acid at Google
|
Guidelines / Policies / Govt |
US National Guidelines Clearinghouse on Ioxaglic acid NICE Guidance on Ioxaglic acid
|
Books |
News |
Commentary |
Definitions |
Patient Resources / Community |
Patient resources on Ioxaglic acid Discussion groups on Ioxaglic acid Patient Handouts on Ioxaglic acid Directions to Hospitals Treating Ioxaglic acid Risk calculators and risk factors for Ioxaglic acid
|
Healthcare Provider Resources |
Causes & Risk Factors for Ioxaglic acid |
Continuing Medical Education (CME) |
International |
|
Business |
Experimental / Informatics |
Editor-In-Chief: C. Michael Gibson, M.S., M.D. [1]
Overview
Ioxaglic acid (trade name Hexabrix) is an iodine containing molecule used as a low-osmolality contrast medium.[1]
References
- ↑ PMID 6999377 (PMID 6999377)
Citation will be completed automatically in a few minutes. Jump the queue or expand by hand