View source for Buphenine

{{Drugbox
| IUPAC_name = 4-{1-hydroxy-2-[(1-methyl-3-phenylpropyl)amino]propyl}phenol
| image = Buphenine.png

<!--Clinical data-->
| tradename =  
| Drugs.com = {{drugs.com|international|buphenine}}
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B            / C / D / X -->
| pregnancy_category =  
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status =  
| routes_of_administration =  

<!--Pharmacokinetic data-->
| bioavailability =  
| protein_bound =  
| metabolism =  
| elimination_half-life =  
| excretion =  

<!--Identifiers-->
| CAS_number = 447-41-6
| ATC_prefix = C04
| ATC_suffix = AA02
| ATC_supplemental = {{ATC|G02|CA02}}
| PubChem = 4567
| DrugBank =  
| ChemSpiderID = 4407
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 695DKH33EI
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 114655

<!--Chemical data-->
| C=19 | H=25 | N=1 | O=2 
| molecular_weight = 299.41 g/mol
| smiles = OC(c1ccc(O)cc1)C(NC(C)CCc2ccccc2)C
| InChI = 1/C19H25NO2/c1-14(8-9-16-6-4-3-5-7-16)20-15(2)19(22)17-10-12-18(21)13-11-17/h3-7,10-15,19-22H,8-9H2,1-2H3
| InChIKey = PTGXAUBQBSGPKF-UHFFFAOYAE
}}
__NOTOC__
{{SI}}
{{CMG}}

==Overview==
'''Buphenine''' (or '''nylidrin''') is a [[beta-adrenergic agonist]]<ref name="pmid2857689">{{cite journal |author=Mittag TW, Tormay A, Messenger M, Podos SM |title=Ocular hypotension in the rabbit. Receptor mechanisms of pirbuterol and nylidrin |journal=Invest. Ophthalmol. Vis. Sci. |volume=26 |issue=2 |pages=163–9 |date=February 1985 |pmid=2857689 |doi= |url=http://www.iovs.org/cgi/pmidlookup?view=long&pmid=2857689}}</ref> that acts as a [[vasodilator]] via [[beta-2 receptor]]s.

==References==
{{reflist|2}}

{{Adrenergic agonists}}
{{Peripheral vasodilators}}

[[Category:Cardiovascular Drugs]]
[[Category:Drug]]
[[Category:Vasodilators]]