Sulfamethizole: Difference between revisions
Jump to navigation
Jump to search
m Robot: Automated text replacement (-{{SIB}} +, -{{EH}} +, -{{EJ}} +, -{{Editor Help}} +, -{{Editor Join}} +) |
No edit summary |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
{{ | |||
{{Drugbox | |||
| verifiedrevid = 470473060 | |||
| IUPAC_name = 4-amino-''N''-(5-methyl-1,3,4-thiadiazol-2-yl)- benzenesulfonamide | | IUPAC_name = 4-amino-''N''-(5-methyl-1,3,4-thiadiazol-2-yl)- benzenesulfonamide | ||
| image = Sulfamethizole. | | image = Sulfamethizole.png | ||
| width = 250 | | width = 250 | ||
<!--Clinical data--> | |||
| tradename = | |||
| Drugs.com = {{drugs.com|CONS|sulfamethizole}} | |||
| MedlinePlus = a682231 | |||
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | |||
| pregnancy_US = <!-- A / B / C / D / X --> | |||
| pregnancy_category = | |||
| legal_AU = <!-- Unscheduled / S2 / S4 / S8 --> | |||
| legal_UK = <!-- GSL / P / POM / CD --> | |||
| legal_US = <!-- OTC / Rx-only --> | |||
| legal_status = | |||
| routes_of_administration = | |||
<!--Pharmacokinetic data--> | |||
| bioavailability = | |||
| protein_bound = 98–99% | |||
| metabolism = | |||
| elimination_half-life = 3–8 hours | |||
| excretion = | |||
<!--Identifiers--> | |||
| CASNo_Ref = {{cascite|correct|CAS}} | |||
| CAS_number_Ref = {{cascite|correct|??}} | |||
| CAS_number = 144-82-1 | | CAS_number = 144-82-1 | ||
| ATC_prefix = B05 | | ATC_prefix = B05 | ||
| ATC_suffix = CA04 | | ATC_suffix = CA04 | ||
| ATC_supplemental = {{ATC|D06|BA04}} | | ATC_supplemental = {{ATC|D06|BA04}} {{ATC|J01|EB02}} {{ATC|S01|AB01}} {{ATCvet|J01|EQ02}} | ||
| PubChem = 5328 | | PubChem = 5328 | ||
| DrugBank = | | DrugBank_Ref = {{drugbankcite|correct|drugbank}} | ||
| C = 9 | H = 10 | N = 4 | O = 2 | S = 2 | | DrugBank = DB00576 | ||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | |||
| ChemSpiderID = 5137 | |||
| UNII_Ref = {{fdacite|correct|FDA}} | |||
| UNII = 25W8454H16 | |||
| KEGG_Ref = {{keggcite|correct|kegg}} | |||
| KEGG = D00870 | |||
| ChEBI_Ref = {{ebicite|correct|EBI}} | |||
| ChEBI = 9331 | |||
| ChEMBL_Ref = {{ebicite|correct|EBI}} | |||
| ChEMBL = 1191 | |||
<!--Chemical data--> | |||
| C=9 | H=10 | N=4 | O=2 | S=2 | |||
| molecular_weight = 270.333 g/mol | | molecular_weight = 270.333 g/mol | ||
| | | smiles = O=S(=O)(Nc1nnc(s1)C)c2ccc(N)cc2 | ||
| InChI = 1/C9H10N4O2S2/c1-6-11-12-9(16-6)13-17(14,15)8-4-2-7(10)3-5-8/h2-5H,10H2,1H3,(H,12,13) | |||
| | | InChIKey = VACCAVUAMIDAGB-UHFFFAOYAZ | ||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | |||
| StdInChI = 1S/C9H10N4O2S2/c1-6-11-12-9(16-6)13-17(14,15)8-4-2-7(10)3-5-8/h2-5H,10H2,1H3,(H,12,13) | |||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | |||
| StdInChIKey = VACCAVUAMIDAGB-UHFFFAOYSA-N | |||
| | |||
| | |||
| | |||
| | |||
}} | }} | ||
__NOTOC__ | |||
{{SI}} | {{SI}} | ||
{{CMG}} | |||
==Overview== | |||
'''Sulfamethizole''' is a [[sulfonamide (medicine)|sulfonamide]] [[antibiotic]]. | |||
==References== | |||
== | |||
{{Reflist|2}} | |||
* {{cite journal | author = Ratanajamit C, Skriver M, Nørgaard M, Jepsen P, Schønheyder H, Sørensen H | title = Adverse pregnancy outcome in users of sulfamethizole during pregnancy: a population-based observational study. | journal = J Antimicrob Chemother | volume = 52 | issue = 5 | pages = 837–41 | year = 2003 | pmid = 14519675 | doi = 10.1093/jac/dkg438}} | |||
* {{cite journal | author = Kerrn M, Frimodt-Møller N, Espersen F | title = Effects of Sulfamethizole and Amdinocillin against Escherichia coli Strains (with Various Susceptibilities) in an Ascending Urinary Tract Infection Mouse Model | journal = Antimicrob Agents Chemother | volume = 47 | issue = 3 | pages = 1002–9 | year = 2003 | pmid = 12604534 | doi = 10.1128/AAC.47.3.1002-1009.2003 | pmc = 149286}} | |||
* {{cite journal | author = Watanabe H, Hastings J | title = Inhibition of bioluminescence in Photobacterium phosphoreum by sulfamethizole and its stimulation by thymine | journal = Biochim Biophys Acta | volume = 1017 | issue = 3 | pages = 229–34 | year = 1990 | pmid = 2372557 | doi = 10.1016/0005-2728(90)90189-B}} | |||
{{Antibiotics and chemotherapeutics for dermatological use}} | {{Antibiotics and chemotherapeutics for dermatological use}} | ||
{{SulfonamideAntiBiotics}} | {{SulfonamideAntiBiotics}} | ||
[[Category:Sulfonamide antibiotics]] | [[Category:Sulfonamide antibiotics]] | ||
[[Category:Drug]] | |||
Latest revision as of 14:45, 13 April 2015
 | |
| Clinical data | |
|---|---|
| AHFS/Drugs.com | Micromedex Detailed Consumer Information |
| MedlinePlus | a682231 |
| ATC code | |
| Pharmacokinetic data | |
| Protein binding | 98–99% |
| Elimination half-life | 3–8 hours |
| Identifiers | |
| |
| CAS Number | |
| PubChem CID | |
| DrugBank | |
| ChemSpider | |
| UNII | |
| KEGG | |
| ChEBI | |
| ChEMBL | |
| E number | {{#property:P628}} |
| ECHA InfoCard | {{#property:P2566}}Lua error in Module:EditAtWikidata at line 36: attempt to index field 'wikibase' (a nil value). |
| Chemical and physical data | |
| Formula | C9H10N4O2S2 |
| Molar mass | 270.333 g/mol |
| 3D model (JSmol) | |
| |
| |
| (verify) | |
|
WikiDoc Resources for Sulfamethizole |
|
Articles |
|---|
|
Most recent articles on Sulfamethizole Most cited articles on Sulfamethizole |
|
Media |
|
Powerpoint slides on Sulfamethizole |
|
Evidence Based Medicine |
|
Clinical Trials |
|
Ongoing Trials on Sulfamethizole at Clinical Trials.gov Trial results on Sulfamethizole Clinical Trials on Sulfamethizole at Google
|
|
Guidelines / Policies / Govt |
|
US National Guidelines Clearinghouse on Sulfamethizole NICE Guidance on Sulfamethizole
|
|
Books |
|
News |
|
Commentary |
|
Definitions |
|
Patient Resources / Community |
|
Patient resources on Sulfamethizole Discussion groups on Sulfamethizole Patient Handouts on Sulfamethizole Directions to Hospitals Treating Sulfamethizole Risk calculators and risk factors for Sulfamethizole
|
|
Healthcare Provider Resources |
|
Causes & Risk Factors for Sulfamethizole |
|
Continuing Medical Education (CME) |
|
International |
|
|
|
Business |
|
Experimental / Informatics |
Editor-In-Chief: C. Michael Gibson, M.S., M.D. [1]
Overview
Sulfamethizole is a sulfonamide antibiotic.
References
- Ratanajamit C, Skriver M, Nørgaard M, Jepsen P, Schønheyder H, Sørensen H (2003). "Adverse pregnancy outcome in users of sulfamethizole during pregnancy: a population-based observational study". J Antimicrob Chemother. 52 (5): 837–41. doi:10.1093/jac/dkg438. PMID 14519675.
- Kerrn M, Frimodt-Møller N, Espersen F (2003). "Effects of Sulfamethizole and Amdinocillin against Escherichia coli Strains (with Various Susceptibilities) in an Ascending Urinary Tract Infection Mouse Model". Antimicrob Agents Chemother. 47 (3): 1002–9. doi:10.1128/AAC.47.3.1002-1009.2003. PMC 149286. PMID 12604534.
- Watanabe H, Hastings J (1990). "Inhibition of bioluminescence in Photobacterium phosphoreum by sulfamethizole and its stimulation by thymine". Biochim Biophys Acta. 1017 (3): 229–34. doi:10.1016/0005-2728(90)90189-B. PMID 2372557.