Glafenine: Difference between revisions

Jump to navigation Jump to search
Gerald Chi (talk | contribs)
Created page with "__NOTOC__ {{CMG}}; {{AE}} '''''For patient information about Glafenine, click here''''' {{SB}} ==Overview== ==Category== ==FDA Packag..."
 
Gerald Chi (talk | contribs)
mNo edit summary
 
(6 intermediate revisions by the same user not shown)
Line 1: Line 1:
__NOTOC__
{{Drugbox
| drug_name        = Glafenine
| IUPAC_name        = 2,3-Dihydroxypropyl 2-[(7-chloro-4-quinolinyl)amino]benzoate
| image            = Glafenine.png
| width            = 180
| caption          =


{{CMG}}; {{AE}}
<!-- Clinical data -->
| tradename        =
| Drugs.com        =
| MedlinePlus      =
| pregnancy_AU      = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US      = <!-- A / B            / C / D / X -->
| pregnancy_category=
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_CA = <!-- OTC, Rx-only, Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL, P, POM, CD, CD Lic, CD POM, CD No Reg POM, CD (Benz) POM, CD (Anab) POM or CD Inv POM -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status      =
| routes_of_administration =


'''''For patient information about Glafenine, click [[Glafenine (patient information)|here]]'''''
<!-- Pharmacokinetic data -->
| bioavailability  =
| protein_bound    =
| metabolism        =
| elimination_half-life =
| excretion        =


{{SB}}
<!-- Identifiers -->
| CAS_number        = 3820-67-5
| ATCvet            =
| ATC_prefix        = N02
| ATC_suffix        = BG03
| PubChem          = 3474
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 31653
| DrugBank          =
| ChemSpiderID      = 3355
 
<!-- Chemical data -->
| C=19 | H=17 | Cl=1 | N=2 | O=4
| molecular_weight  = 372.802 g/mol
| smiles            = O=C(OCC(O)CO)c1ccccc1Nc2c3ccc(Cl)cc3ncc2
| InChI            = 1/C19H17ClN2O4/c20-12-5-6-14-17(7-8-21-18(14)9-12)22-16-4-2-1-3-15(16)19(25)26-11-13(24)10-23/h1-9,13,23-24H,10-11H2,(H,21,22)
| InChIKey          = GWOFUCIGLDBNKM-UHFFFAOYAI
| StdInChI          = 1S/C19H17ClN2O4/c20-12-5-6-14-17(7-8-21-18(14)9-12)22-16-4-2-1-3-15(16)19(25)26-11-13(24)10-23/h1-9,13,23-24H,10-11H2,(H,21,22)
| StdInChIKey      = GWOFUCIGLDBNKM-UHFFFAOYSA-N
}}
__NOTOC__
{{CMG}}


==Overview==
==Overview==
'''Glafenine''' is a [[non-steroidal anti-inflammatory drug]] (NSAID).  Use of glafenine is limited due to the risk of [[anaphylaxis]] and [[acute renal failure]].<ref>{{Cite journal | doi = 10.1016/0140-6736(92)91670-4 | title = Withdrawal of glafenine | year = 1992 | journal = The Lancet | volume = 339 | issue = 8789 | pages = 357}}</ref><ref>{{Cite journal | pmid = 2873910 | year = 1986 | last1 = Kleinknecht | first1 = D | last2 = Landais | first2 = P | last3 = Goldfarb | first3 = B | title = Analgesic and non-steroidal anti-inflammatory drug-associated acute renal failure: A prospective collaborative study | volume = 25 | issue = 6 | pages = 275–81 | journal = Clinical nephrology}}</ref>


==Category==
==Category==


==FDA Package Insert==
Non-Steroidal Anti-Inflammatory Drug
 
==References==


'''  [[Glafenine indications and usage|Indications and Usage]]'''
{{Reflist|2}}
'''| [[Glafenine dosage and administration|Dosage and Administration]]'''
'''| [[Glafenine dosage forms and strengths|Dosage Forms and Strengths]]'''
'''| [[Glafenine contraindications|Contraindications]]'''
'''| [[Glafenine warnings and precautions|Warnings and Precautions]]'''
'''| [[Glafenine adverse reactions|Adverse Reactions]]'''
'''| [[Glafenine drug interactions|Drug Interactions]]'''
'''| [[Glafenine use in specific populations|Use in Specific Populations]]'''
'''| [[Glafenine overdosage|Overdosage]]'''
'''| [[Glafenine description|Description]]'''
'''| [[Glafenine clinical pharmacology|Clinical Pharmacology]]'''
'''| [[Glafenine nonclinical toxicology|Nonclinical Toxicology]]'''
'''| [[Glafenine clinical studies|Clinical Studies]]'''
'''| [[Glafenine how supplied storage and handling|How Supplied/Storage and Handling]]'''
'''| [[Glafenine patient counseling information|Patient Counseling Information]]'''
'''| [[Glafenine labels and packages|Labels and Packages]]'''


==Mechanism of Action==


==References==
{{analgesics}}
 


{{Reflist|2}}
[[Category:Needs content]]


[[Category:Cardiovascular Drugs]]
[[Category:Analgesics]]
[[Category:Quinolines]]
[[Category:Drugs]]
[[Category:Drugs]]

Latest revision as of 19:53, 4 February 2014

Glafenine
Clinical data
ATC code
Identifiers
CAS Number
PubChem CID
ChemSpider
ChEBI
E number{{#property:P628}}
ECHA InfoCard{{#property:P2566}}Lua error in Module:EditAtWikidata at line 36: attempt to index field 'wikibase' (a nil value).
Chemical and physical data
FormulaC19H17ClN2O4
Molar mass372.802 g/mol
3D model (JSmol)

Editor-In-Chief: C. Michael Gibson, M.S., M.D. [1]

Overview

Glafenine is a non-steroidal anti-inflammatory drug (NSAID). Use of glafenine is limited due to the risk of anaphylaxis and acute renal failure.[1][2]

Category

Non-Steroidal Anti-Inflammatory Drug

References

  1. "Withdrawal of glafenine". The Lancet. 339 (8789): 357. 1992. doi:10.1016/0140-6736(92)91670-4.
  2. Kleinknecht, D; Landais, P; Goldfarb, B (1986). "Analgesic and non-steroidal anti-inflammatory drug-associated acute renal failure: A prospective collaborative study". Clinical nephrology. 25 (6): 275–81. PMID 2873910.