Budipine: Difference between revisions

Jump to navigation Jump to search
VisualWikitext
m (Protected "Budipine": Protecting pages from unwanted edits ([edit=sysop] (indefinite) [move=sysop] (indefinite)))
 
No edit summary
Line 1: Line 1:
{{drugbox
{{Drugbox
| IUPAC_name       = 1-tert-butyl-4,4-dicyclohexylpiperidine
| verifiedrevid = 437186133
| image             = Budipine.svg
| IUPAC_name = 1-tert-butyl-4,4-diphenylpiperidine<ref>Martndale: The Complete Drug Reference, 35th Ed.</ref>
| CAS_number       = 57982-78-2
| image = Budipine.svg
| ATC_prefix       = N04
 
| ATC_suffix       = BX03  
<!--Clinical data-->
| PubChem           = 68778
| tradename = 
| DrugBank         =  
| Drugs.com = {{drugs.com|international|budipine}}
| C = 21 | H = 27 | N = 1
| pregnancy_category = 
| molecular_weight  = 293.446 g/mol
| legal_status = 
| bioavailability  = 64
| routes_of_administration = 
| protein_bound    = 567
 
| metabolism        = 12
<!--Pharmacokinetic data-->
| elimination_half-life = 45656
| bioavailability = 
| excretion        =  
| protein_bound = 
| pregnancy_AU      = <!-- A / B1 / B2 / B3 / C / D / X -->
| metabolism = 
| pregnancy_US      = <!-- A / B            / C / D / X -->
| elimination_half-life = 
| pregnancy_category=
| excretion = 
| legal_AU          = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
 
| legal_CA          =  <!--             / Schedule I, II, III, IV, V, VI, VII, VIII -->
<!--Identifiers-->
| legal_UK          = <!-- GSL        / P      / POM / CD / Class A, B, C -->
| CAS_number_Ref = {{cascite|correct|??}}
| legal_US          =  <!-- OTC                  / Rx-only  / Schedule I, II, III, IV, V -->
| CAS_number = 57982-78-2
| legal_status      =  
| ATC_prefix = N04
| routes_of_administration =  
| ATC_suffix = BX03
| PubChem = 68778
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 62021
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = L9026OPI2Z
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D07306
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 334491
 
<!--Chemical data-->
| C=21 | H=27 | N=1
| molecular_weight = 293.446 g/mol
| smiles = c1(ccccc1)C3(c2ccccc2)CCN(C(C)(C)C)CC3
| InChI = 1/C21H27N/c1-20(2,3)22-16-14-21(15-17-22,18-10-6-4-7-11-18)19-12-8-5-9-13-19/h4-13H,14-17H2,1-3H3
| InChIKey = QIHLUZAFSSMXHQ-UHFFFAOYAT
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C21H27N/c1-20(2,3)22-16-14-21(15-17-22,18-10-6-4-7-11-18)19-12-8-5-9-13-19/h4-13H,14-17H2,1-3H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = QIHLUZAFSSMXHQ-UHFFFAOYSA-N
}}
}}
'''Budipine''' is a [[dopaminergic]] agent.
 
'''Budipine''' is an [[antiparkinson agent]].
 
Its [[mechanism of action]] is not well characterized.<ref name="pmid16784759">{{cite journal |author=Reichmann H |title=Budipine in Parkinson's tremor |journal=J. Neurol. Sci. |volume=248 |issue=1-2 |pages=53–5 |date=October 2006 |pmid=16784759 |doi=10.1016/j.jns.2006.05.039 |url=http://linkinghub.elsevier.com/retrieve/pii/S0022-510X(06)00235-8}}</ref> It is believed to be an [[NMDA receptor antagonist]],<ref>J. Kornhuber, B. Herr, J. Thome, P. Riederer. "The antiparkinsonian drug budipine binds to NMDA and sigma receptors in postmortem human brain tissue". J.Neural Transm.Suppl. 46:127-133, 1995. PMID 8821048</ref> however, promoting the synthesis of [[dopamine]].<ref name="url">{{cite web |url=http://www.umm.edu/patiented/articles/what_other_drugs_used_parkinsons_disease_000051_8.htm |title=umm.edu |format= |work= |accessdate=}}</ref>
 
Because it provides additional benefits relative to existing treatments, it probably does not precisely mimic the mechanism of an existing known treatment.<ref name="pmid12020263">{{cite journal |author=Przuntek H, Bittkau S, Bliesath H, ''et al.'' |title=Budipine provides additional benefit in patients with Parkinson disease receiving a stable optimum dopaminergic drug regimen |journal=Arch. Neurol. |volume=59 |issue=5 |pages=803–6 |date=May 2002 |pmid=12020263 |doi= 10.1001/archneur.59.5.803|url=http://archneur.ama-assn.org/cgi/pmidlookup?view=long&pmid=12020263}}</ref>


==See also==
==See also==
* [[Piperidine]]
* [[Piperidine]]


{{Dopaminergic agents}}
==References==
{{Reflist|2}}
 
 
{{Antiparkinson}}
{{Glutamatergics}}


[[Category:Antiparkinsonian agents]]
[[Category:Antiparkinsonian agents]]
[[Category:Piperidines]]


{{pharma-stub}}
{{nervous-system-drug-stub}}

Revision as of 13:41, 10 April 2015

Budipine
File:Budipine.svg
Clinical data
AHFS/Drugs.comInternational Drug Names
ATC code
Identifiers
CAS Number
PubChem CID
ChemSpider
UNII
KEGG
ChEMBL
E number{{#property:P628}}
ECHA InfoCard{{#property:P2566}}Lua error in Module:EditAtWikidata at line 36: attempt to index field 'wikibase' (a nil value).
Chemical and physical data
FormulaC21H27N
Molar mass293.446 g/mol
3D model (JSmol)
  (verify)

Budipine is an antiparkinson agent.

Its mechanism of action is not well characterized.[2] It is believed to be an NMDA receptor antagonist,[3] however, promoting the synthesis of dopamine.[4]

Because it provides additional benefits relative to existing treatments, it probably does not precisely mimic the mechanism of an existing known treatment.[5]

See also

References

  1. ↑ Martndale: The Complete Drug Reference, 35th Ed.
  2. ↑ Reichmann H (October 2006). "Budipine in Parkinson's tremor". J. Neurol. Sci. 248 (1–2): 53–5. doi:10.1016/j.jns.2006.05.039. PMID 16784759.
  3. ↑ J. Kornhuber, B. Herr, J. Thome, P. Riederer. "The antiparkinsonian drug budipine binds to NMDA and sigma receptors in postmortem human brain tissue". J.Neural Transm.Suppl. 46:127-133, 1995. PMID 8821048
  4. ↑ "umm.edu".
  5. ↑ Przuntek H, Bittkau S, Bliesath H; et al. (May 2002). "Budipine provides additional benefit in patients with Parkinson disease receiving a stable optimum dopaminergic drug regimen". Arch. Neurol. 59 (5): 803–6. doi:10.1001/archneur.59.5.803. PMID 12020263.


Template:Antiparkinson


Template:Nervous-system-drug-stub

Retrieved from "https://www.wikidoc.org/index.php?title=Budipine&oldid=1085793"