Cyclobarbital: Difference between revisions
Jump to navigation
Jump to search
m (Protected "Cyclobarbital": Protecting pages from unwanted edits ([edit=sysop] (indefinite) [move=sysop] (indefinite))) |
No edit summary |
||
| Line 1: | Line 1: | ||
{{Drugbox| | {{Drugbox | ||
|IUPAC_name = ''5-(1-cyclohexenyl)-5-ethyl-1,3-diazinane-2,4,6-trione'' | | Verifiedfields = changed | ||
| Watchedfields = changed | |||
| verifiedrevid = 460109682 | |||
| IUPAC_name = ''5-(1-cyclohexenyl)-5-ethyl-1,3-diazinane-2,4,6-trione'' | |||
| image = Cyclobarbital.svg | | image = Cyclobarbital.svg | ||
| width=100 | | width = 100 | ||
| | | image2 = Cyclobarbital ball-and-stick.png | ||
| | | width2 = 180 | ||
| | |||
| | <!--Clinical data--> | ||
| | | Drugs.com = {{Drugs.com|international|cyclobarbital}} | ||
| | | tradename = | ||
| | | pregnancy_category = | ||
| legal_status = | |||
| bioavailability= | | routes_of_administration = Oral | ||
<!--Pharmacokinetic data--> | |||
| bioavailability = | |||
| metabolism = [[Hepatic]] | | metabolism = [[Hepatic]] | ||
| elimination_half-life= | | elimination_half-life = | ||
| excretion = [[Renal]] | | excretion = [[Renal]] | ||
| | |||
| | <!--Identifiers--> | ||
| | | CAS_number_Ref = {{cascite|changed|??}} | ||
| CAS_number = 143-76-0 | |||
| ATC_prefix = N05 | |||
| ATC_suffix = CA10 | |||
| PubChem = 5838 | |||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} | |||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | |||
| ChemSpiderID = 5632 | |||
| UNII_Ref = {{fdacite|correct|FDA}} | |||
| UNII = 0M8A98AD9H | |||
| KEGG_Ref = {{keggcite|changed|kegg}} | |||
| KEGG = D07323 | |||
| ChEMBL_Ref = {{ebicite|correct|EBI}} | |||
| ChEMBL = 268164 | |||
<!--Chemical data--> | |||
| C=12 | H=16 | N=2 | O=3 | |||
| molecular_weight = 236.267 g/mol | |||
| smiles = O=C1NC(=O)NC(=O)C1(/C2=C/CCCC2)CC | |||
| InChI = 1/C12H16N2O3/c1-2-12(8-6-4-3-5-7-8)9(15)13-11(17)14-10(12)16/h6H,2-5,7H2,1H3,(H2,13,14,15,16,17) | |||
| InChIKey = WTYGAUXICFETTC-UHFFFAOYAC | |||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | |||
| StdInChI = 1S/C12H16N2O3/c1-2-12(8-6-4-3-5-7-8)9(15)13-11(17)14-10(12)16/h6H,2-5,7H2,1H3,(H2,13,14,15,16,17) | |||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | |||
| StdInChIKey = WTYGAUXICFETTC-UHFFFAOYSA-N | |||
}} | }} | ||
'''Cyclobarbital''', also known as '''cyclobarbitol''' or '''cyclobarbitone''', is a [[drug]] which is a [[barbiturate]] [[derivative (chemistry)|derivative]]. | '''Cyclobarbital''', also known as '''cyclobarbitol''' or '''cyclobarbitone''', is a [[drug]] which is a [[barbiturate]] [[derivative (chemistry)|derivative]].<ref>{{cite pmid|989475}}</ref> It is primarily available in fixed-dose combination with [[diazepam]] under the brand name '''Reladorm''' (100 mg cyclobarbital + 10 mg diazepam) and is used to treat [[insomnia]] in Russia. | ||
==References== | |||
{{reflist}} | |||
{{Hypnotics and sedatives}} | {{Hypnotics and sedatives}} | ||
{{GABAAR PAMs}} | |||
[[Category:Barbiturates]] | [[Category:Barbiturates]] | ||
[[Category: | [[Category:GABAA receptor positive allosteric modulators]] | ||
{{sedative-stub}} | |||
Revision as of 13:38, 13 April 2015
| File:Cyclobarbital.svg | |
| File:Cyclobarbital ball-and-stick.png | |
| Clinical data | |
|---|---|
| AHFS/Drugs.com | International Drug Names |
| Routes of administration | Oral |
| ATC code | |
| Pharmacokinetic data | |
| Metabolism | Hepatic |
| Excretion | Renal |
| Identifiers | |
| |
| CAS Number | |
| PubChem CID | |
| ChemSpider | |
| UNII | |
| KEGG | |
| ChEMBL | |
| E number | {{#property:P628}} |
| ECHA InfoCard | {{#property:P2566}}Lua error in Module:EditAtWikidata at line 36: attempt to index field 'wikibase' (a nil value). |
| Chemical and physical data | |
| Formula | C12H16N2O3 |
| Molar mass | 236.267 g/mol |
| 3D model (JSmol) | |
| |
| |
  (what is this?) (verify) | |
Cyclobarbital, also known as cyclobarbitol or cyclobarbitone, is a drug which is a barbiturate derivative.[1] It is primarily available in fixed-dose combination with diazepam under the brand name Reladorm (100 mg cyclobarbital + 10 mg diazepam) and is used to treat insomnia in Russia.
References
- ↑ PMID 989475 (PMID 989475)
Citation will be completed automatically in a few minutes. Jump the queue or expand by hand
Categories:
- Pages with script errors
- Pages with incomplete PMID references
- Pages with broken file links
- Template:drugs.com link with non-standard subpage
- Articles with changed CASNo identifier
- Articles with changed KEGG identifier
- E number from Wikidata
- ECHA InfoCard ID from Wikidata
- Chemical articles with unknown parameter in Infobox drug
- Chemical pages without DrugBank identifier
- Drugs with no legal status
- Drugboxes which contain changes to verified fields
- Drugboxes which contain changes to watched fields
- Barbiturates
- GABAA receptor positive allosteric modulators